commit f396a42774134015dd7a13d1a80310a61f48e80c Author: shenyu <448766534@qq.com> Date: Tue Dec 3 19:37:44 2019 +0800 first commit diff --git a/README.md b/README.md new file mode 100644 index 0000000..ac128b1 --- /dev/null +++ b/README.md @@ -0,0 +1,219 @@ +# Ayer + +> :desert_island: Ayer is a clean and elegant theme for Hexo, also responsive. If you have any queries or advice during the process of using, Please contact me! My email: shenyu@hotmail.com + + +### [Preview](https://shen-yu.gitee.io) + +### [中文说明](https://shen-yu.gitee.io/2019/ayer/) + +![Screenshot](screenshots/hexo-theme-ayer.png) + +### Install + +``` bash +$ git clone https://github.com/Shen-Yu/hexo-theme-ayer.git themes/ayer +``` + +### Enable + +Modify `theme` setting in `_config.yml` to `ayer` + +``` yml +theme: ayer +``` + +### Update + +``` bash +cd themes/ayer +git pull +``` + +### Configuration + +let me know if you can’t find something. + +``` yml +# Menu-侧边栏菜单 +menu: + Home: / + Archives: /archives + Gallery: http://shenyu-vip.lofter.com + Travel: /tags/旅行/ + About: /2019/about + +# 网站图标和侧边栏logo +favicon: /favicon.ico +logo: /images/ayer-side.svg + +# 封面配置 +# enable-是否启用封面；path-封面背景图；logo-封面logo +cover: + enable: true + path: /images/cover1.jpg # images目录下附送多张美图，可更换 + logo: /images/ayer.svg + +# 页面顶部进度条 +progressBar: ture + +# 文章配置 +# 文章太长，截断按钮文字(在需要截断的行增加此标记：) +excerpt_link: Read More... +# 文章分享文字 +share_text: Share +# 搜索文字 +search_text: Search +# 分页文字 +nav_text: + page_prev: Prev page + page_next: Next page + post_prev: Newer posts + post_next: Older posts + +# 文章页是否显示目录 +toc: true + +# 是否启用搜索 +search: true + +# RSS订阅(先安装hexo-generator-feed插件，再去博客根目录config进行配置) +rss: /atom.xml + +# 评论：1、Valine(推荐)；2、Gitalk + +# 1、Valine[一款快速、简洁且高效的无后端评论系统](https://github.com/xCss/Valine) +# 启用Valine必须先创建leancloud应用， 获取 id|key 填入即可 +leancloud: + enable: true + app_id: # + app_key: # +# Valine配置 +valine: + enable: true # 是否启用 + avatar: mp # 头像样式(https://valine.js.org/avatar.html) + placeholder: 给我的文章加点评论吧~ # placeholder + +# 2、Gitalk(https://github.com/gitalk/gitalk) +gitalk: + enable: false # true + clientID: # GitHub Application Client ID + clientSecret: # Client Secret + repo: # Repository name + owner: # GitHub ID + admin: # GitHub ID + +# fancybox(仅用于相册展示，若需要可配置albums) +fancybox: true + +# 访问量统计(不蒜子) +busuanzi: + enable: true + +# 友盟cnzz统计(url填js代码src链接) +cnzz: + enable: true + url: # + +# 数学公式 +mathjax: true + +# 网站成立年份(默认为 2019，若填入年份小于当前年份，则显示为 2018-2019 类似的格式) +since: 2019 + +#是否显示页脚信息(建议保留，有助于本主题的推广) +pageFooter: true +``` + +### Plugins + ++ [hexo-generator-search](https://github.com/wzpan/hexo-generator-search) Local search + + ```yml + $ npm install hexo-generator-searchdb --save + ``` + Then add the plugin configuration for hexo's configuration file `_config.yml` (note: not the theme's configuration file): + + ```yml + # Hexo-generator-search + search: + path: search.xml + field: post + format: html + ``` + ++ [hexo-generate-feed](https://github.com/hexojs/hexo-generator-feed) RSS + + ```yml + $ npm install hexo-generator-feed --save + ``` + + Then add the plugin configuration for hexo's configuration file `_config.yml` (note: not the theme's configuration file): + + ```yml + feed: + type: atom + path: atom.xml + limit: 20 + hub: + content: + content_limit: 140 + content_limit_delim: ' ' + order_by: -date + ``` + ++ [hexo-generator-index-pin-top](https://github.com/netcan/hexo-generator-index-pin-top) + + ``` bash + $ npm uninstall hexo-generator-index --save + $ npm install hexo-generator-index-pin-top --save + ``` + +### Post poster + +``` md +--- +title: Post name + +photos: [ + ["img_url"], + ["img_url"] + ] +--- +``` + +### Gallery +Need to write in the head of the markdown, this is not a good way to write, I hope to get a better way to write on github. + +``` md +--- +title: Gallery + +albums: [ + ["img_url","img_caption"], + ["img_url","img_caption"] + ] +--- +``` + +### Toc + +Use Tocbot to parse the title tags (h1~h6) in the content and insert the directory. + ++ ayer/_config.yml + + ``` bash + # Toc + toc: true + ``` ++ If Toc is turned on in ayer/_config.yml, then Tocbot will generate a Toc article directory in the title tag of each blog parsing content, but not all blogs require Toc, so in the Front-matter section of markdown Can be closed: + + ``` md + --- + toc: false + --- + ``` + +--- + +Creative Commons License
Ayer by Eric-Shen is licensed under a Creative Commons Attribution-NonCommercial-ShareAlike 4.0 International License. \ No newline at end of file diff --git a/_config.yml b/_config.yml new file mode 100644 index 0000000..30d1e64 --- /dev/null +++ b/_config.yml @@ -0,0 +1,88 @@ +# 侧边栏菜单 +menu: + Home: / + Archives: /archives + Gallery: http://shenyu-vip.lofter.com + Travel: /tags/旅行/ + About: /2019/about + +# 网站图标和侧边栏logo +favicon: /favicon.ico +logo: /images/ayer-side.svg + +# 封面配置 +# enable-是否启用封面；path-封面背景图；logo-封面logo +cover: + enable: true + path: /images/cover1.jpg # images目录下附送多张美图，可更换 + logo: /images/ayer.svg + +# 页面顶部进度条 +progressBar: ture + +# 文章配置 +# 文章太长，截断按钮文字(在需要截断的行增加此标记：) +excerpt_link: Read More... +# 文章分享文字 +share_text: Share +# 搜索文字 +search_text: Search +# 分页文字 +nav_text: + page_prev: Prev page + page_next: Next page + post_prev: Newer posts + post_next: Older posts + +# 文章页是否显示目录 +toc: true + +# 是否启用搜索 +search: true + +# RSS订阅(先安装hexo-generator-feed插件，再去博客根目录config进行配置) +rss: /atom.xml + +# 评论：1、Valine(推荐)；2、Gitalk + +# 1、Valine[一款快速、简洁且高效的无后端评论系统](https://github.com/xCss/Valine) +# 启用Valine必须先创建leancloud应用， 获取 id|key 填入即可 +leancloud: + enable: true + app_id: chaSYi8FMdJBwzIBpxeNjqWC-gzGzoHsz + app_key: PqqkLYgPkHvH1BmyQqySWnSK +# Valine配置 +valine: + enable: true # 是否启用 + avatar: mp # 头像样式(https://valine.js.org/avatar.html) + placeholder: 给我的文章加点评论吧~ # placeholder + +# 2、Gitalk(https://github.com/gitalk/gitalk) +gitalk: + enable: false # true + clientID: # GitHub Application Client ID + clientSecret: # Client Secret + repo: # Repository name + owner: # GitHub ID + admin: # GitHub ID + +# fancybox(仅用于相册展示，若需要可配置albums) +fancybox: true + +# 访问量统计(不蒜子) +busuanzi: + enable: true + +# 友盟cnzz统计(url填js代码src链接) +cnzz: + enable: true + url: https://s9.cnzz.com/z_stat.php?id=1278069914&web_id=1278069914 + +# 数学公式 +mathjax: true + +# 网站成立年份(默认为 2019，若填入年份小于当前年份，则显示为 2018-2019 类似的格式) +since: 2015 + +#是否显示页脚信息(建议保留，有助于本主题的推广) +pageFooter: true \ No newline at end of file diff --git a/languages/de.yml b/languages/de.yml new file mode 100644 index 0000000..630055f --- /dev/null +++ b/languages/de.yml @@ -0,0 +1,19 @@ +categories: Kategorien +search: Suche +tags: Tags +tagcloud: Tag Cloud +tweets: Tweets +prev: zurück +next: weiter +comment: Kommentare +archive_a: Archiv +archive_b: "Archive: %s" +page: Seite %d +recent_posts: letzter Beitrag +newer: Neuer +older: Älter +share: Teilen +powered_by: Powered by +rss_feed: RSS Feed +category: Kategorie +tag: Tag diff --git a/languages/default.yml b/languages/default.yml new file mode 100644 index 0000000..3ef7e92 --- /dev/null +++ b/languages/default.yml @@ -0,0 +1,19 @@ +categories: Categories +search: Search +tags: Tags +tagcloud: Tag Cloud +tweets: Tweets +prev: Prev +next: Next +comment: Comments +archive_a: Archives +archive_b: "Archives: %s" +page: Page %d +recent_posts: Recent Posts +newer: Newer +older: Older +share: Share +powered_by: Powered by +rss_feed: RSS Feed +category: Category +tag: Tag \ No newline at end of file diff --git a/languages/es.yml b/languages/es.yml new file mode 100644 index 0000000..d862e87 --- /dev/null +++ b/languages/es.yml @@ -0,0 +1,19 @@ +categories: Categorías +search: Buscar +tags: Tags +tagcloud: Nube de Tags +tweets: Tweets +prev: Previo +next: Siguiente +comment: Comentarios +archive_a: Archivos +archive_b: "Archivos: %s" +page: Página %d +recent_posts: Posts recientes +newer: Nuevo +older: Viejo +share: Compartir +powered_by: Construido por +rss_feed: RSS +category: Categoría +tag: Tag \ No newline at end of file diff --git a/languages/fr.yml b/languages/fr.yml new file mode 100644 index 0000000..c84f51b --- /dev/null +++ b/languages/fr.yml @@ -0,0 +1,19 @@ +categories: Catégories +search: Rechercher +tags: Mot-clés +tagcloud: Nuage de mot-clés +tweets: Tweets +prev: Précédent +next: Suivant +comment: Commentaires +archive_a: Archives +archive_b: "Archives: %s" +page: Page %d +recent_posts: Articles récents +newer: Récent +older: Ancien +share: Partager +powered_by: Propulsé par +rss_feed: Flux RSS +category: Catégorie +tag: Mot-clé diff --git a/languages/ja.yml b/languages/ja.yml new file mode 100644 index 0000000..af0f7fe --- /dev/null +++ b/languages/ja.yml @@ -0,0 +1,19 @@ +categories: カテゴリ +search: 検索 +tags: タグ +tagcloud: タグクラウド +tweets: ツイート +prev: 戻る +next: 次へ +comment: コメント +archive_a: アーカイブ +archive_b: "アーカイブ: %s" +page: ページ %d +recent_posts: 最近の投稿 +newer: 次の記事 +older: 前の記事 +share: 共有 +powered_by: Powered by +rss_feed: RSSフィード +category: カテゴリ +tag: タグ diff --git a/languages/ko.yml b/languages/ko.yml new file mode 100644 index 0000000..1d27b43 --- /dev/null +++ b/languages/ko.yml @@ -0,0 +1,19 @@ +categories: 카테고리 +search: 검색 +tags: 태그 +tagcloud: 태그 클라우드 +tweets: 트윗 +prev: 이전 +next: 다음 +comment: 댓글 +archive_a: 아카이브 +archive_b: "아카이브: %s" +page: 페이지 %d +recent_posts: 최근 포스트 +newer: 최신 +older: 이전 +share: 공유 +powered_by: Powered by +rss_feed: RSS Feed +category: 카테고리 +tag: 태그 diff --git a/languages/nl.yml b/languages/nl.yml new file mode 100644 index 0000000..568d33e --- /dev/null +++ b/languages/nl.yml @@ -0,0 +1,20 @@ + +categories: Categorieën +search: Zoeken +tags: Labels +tagcloud: Tag Cloud +tweets: Tweets +prev: Vorige +next: Volgende +comment: Commentaren +archive_a: Archieven +archive_b: "Archieven: %s" +page: Pagina %d +recent_posts: Recente berichten +newer: Nieuwer +older: Ouder +share: Delen +powered_by: Powered by +rss_feed: RSS Feed +category: Categorie +tag: Label diff --git a/languages/no.yml b/languages/no.yml new file mode 100644 index 0000000..b997691 --- /dev/null +++ b/languages/no.yml @@ -0,0 +1,19 @@ +categories: Kategorier +search: Søk +tags: Tags +tagcloud: Tag Cloud +tweets: Tweets +prev: Forrige +next: Neste +comment: Kommentarer +archive_a: Arkiv +archive_b: "Arkiv: %s" +page: Side %d +recent_posts: Siste innlegg +newer: Newer +older: Older +share: Share +powered_by: Powered by +rss_feed: RSS Feed +category: Category +tag: Tag \ No newline at end of file diff --git a/languages/pt.yml b/languages/pt.yml new file mode 100644 index 0000000..3d74af3 --- /dev/null +++ b/languages/pt.yml @@ -0,0 +1,19 @@ +categories: Categorias +search: Buscar +tags: Tags +tagcloud: Nuvem de Tags +tweets: Tweets +prev: Anterior +next: Próximo +comment: Comentários +archive_a: Arquivos +archive_b: "Arquivos: %s" +page: Página %d +recent_posts: Postagens Recentes +newer: Mais Recente +older: Mais Antigo +share: Compartilhar +powered_by: Desenvolvido por +rss_feed: Feed RSS +category: Categoria +tag: Tag diff --git a/languages/ru.yml b/languages/ru.yml new file mode 100644 index 0000000..625a83c --- /dev/null +++ b/languages/ru.yml @@ -0,0 +1,19 @@ +categories: Категории +search: Поиск +tags: Метки +tagcloud: Облако меток +tweets: Твиты +prev: Назад +next: Вперед +comment: Комментарии +archive_a: Архив +archive_b: "Архив: %s" +page: Страница %d +recent_posts: Недавние записи +newer: Следующий +older: Предыдущий +share: Поделиться +powered_by: Создано с помощью +rss_feed: RSS-каналы +category: Категория +tag: Метка \ No newline at end of file diff --git a/languages/zh-CN.yml b/languages/zh-CN.yml new file mode 100644 index 0000000..e298b77 --- /dev/null +++ b/languages/zh-CN.yml @@ -0,0 +1,19 @@ +categories: 分类 +search: 搜索 +tags: 标签 +tagcloud: 标签云 +tweets: 推文 +prev: 上一页 +next: 下一页 +comment: 留言 +archive_a: 归档 +archive_b: 归档：%s +page: 第 %d 页 +recent_posts: 最新文章 +newer: Newer +older: Older +share: 分享 +powered_by: Powered by +rss_feed: RSS Feed +category: Category +tag: Tag \ No newline at end of file diff --git a/languages/zh-TW.yml b/languages/zh-TW.yml new file mode 100644 index 0000000..76d2916 --- /dev/null +++ b/languages/zh-TW.yml @@ -0,0 +1,19 @@ +categories: 分類 +search: 搜尋 +tags: 標籤 +tagcloud: 標籤雲 +tweets: 推文 +prev: 上一頁 +next: 下一頁 +comment: 留言 +archive_a: 彙整 +archive_b: 彙整：%s +page: 第 %d 頁 +recent_posts: 最新文章 +newer: Newer +older: Older +share: Share +powered_by: Powered by +rss_feed: RSS Feed +category: Category +tag: Tag \ No newline at end of file diff --git a/layout/_partial/after-footer.ejs b/layout/_partial/after-footer.ejs new file mode 100644 index 0000000..21fdd99 --- /dev/null +++ b/layout/_partial/after-footer.ejs @@ -0,0 +1,36 @@ +<%- js('/js/jquery-2.0.3.min') %> +<%- js('/js/jquery.justifiedGallery.min') %> +<%- js('/js/lazyload.min') %> +<%- js('/js/busuanzi-2.3.pure.min') %> +<% if (theme.fancybox){ %> + <%- js('fancybox/jquery.fancybox.min') %> +<% } %> + +<% if (theme.toc && is_post()){ %> + <%- js('/js/tocbot.min') %> + +<% } %> + + + +<%- js('js/ayer') %> + +<% if (theme.mathjax){ %> + <%- partial('mathjax') %> +<% } %> diff --git a/layout/_partial/archive-post.ejs b/layout/_partial/archive-post.ejs new file mode 100644 index 0000000..c06bdec --- /dev/null +++ b/layout/_partial/archive-post.ejs @@ -0,0 +1,14 @@ +
+
+
+ <%- partial('post/date', {class_name: 'archive-article-date', date_format: 'MM/DD'}) %> + <%- partial('post/title', {class_name: 'archive-article-title'}) %> +
+ <% if(page.category){ %> + <%- partial('post/category') %> + <% } %> + <% if(page.tag){ %> + <%- partial('post/tag') %> + <% } %> +
+
\ No newline at end of file diff --git a/layout/_partial/archive.ejs b/layout/_partial/archive.ejs new file mode 100644 index 0000000..5607aac --- /dev/null +++ b/layout/_partial/archive.ejs @@ -0,0 +1,55 @@ +
+
+ <% + var title = ''; + if (page.category) title = page.category; + if (page.tag) title = "#" + " " + page.tag; + if (page.archive) { + if (page.year) title = page.year + (page.month ? '/' + page.month : ''); + else title = __('archive_a'); + } + %> +

<%- title %>

+ + <% if (pagination == 2){ %> + <% page.posts.each(function(post){ %> + <%- partial('article', {post: post, index: true}) %> + <% }) %> +
+ <% } else { %> + <% var last; %> + <% page.posts.each(function(post, i){ %> + <% var year = post.date.year(); %> + <% if (last != year){ %> + <% if (last != null){ %> + + + <% } %> + <% last = year; %> +
+
+ <%= year %> +
+
+ <% } %> + <%- partial('archive-post', {post: post, even: i % 2 == 0}) %> + <% }) %> + <% if (page.posts.length){ %> +
+
+ <% } %> + <% } %> + + <% if (page.total > 1){ %> + + <% } %> +
\ No newline at end of file diff --git a/layout/_partial/article.ejs b/layout/_partial/article.ejs new file mode 100644 index 0000000..98e223d --- /dev/null +++ b/layout/_partial/article.ejs @@ -0,0 +1,58 @@ +
+ +
+ <% if (post.link || post.title){ %> +
+ <%- partial('post/title', {class_name: 'article-title'}) %> +
+ <% } %> + + <% if (index || is_post()) { %> +
+ <%- partial('post/date', {class_name: 'article-date', date_format: null}) %> + <%- partial('post/category') %> +
+ <% } %> + + <% if (theme.toc && is_post()){ %> + <%- partial('post/tocbot') %> + <% } %> + +
+ <%- partial('post/justifiedGallery') %> + <%- partial('post/gallery') %> + <% if (post.excerpt && index){ %> + <%- post.excerpt %> + <% if (theme.excerpt_link){ %> + <%= theme.excerpt_link %> + <% } %> + <% } else { %> + <%- post.content %> + <% } %> +
+ + +
+ + <% if (!index){ %> + <%- partial('post/nav') %> + <% } %> + + <% if (theme.valine && theme.valine.enable){ %> + <%- partial('post/valine', { + key: post.slug, + title: post.title, + url: config.url+url_for(post.path) + }) %> + <% } %> + + <% if (is_post()) { %> + <%- partial('post/gitalk') %> + <%} %> + +
\ No newline at end of file diff --git a/layout/_partial/ayer.ejs b/layout/_partial/ayer.ejs new file mode 100644 index 0000000..097ca70 --- /dev/null +++ b/layout/_partial/ayer.ejs @@ -0,0 +1,23 @@ +<% if (theme.cover.enable) { %> +
+
+
+ image frame +
+
+

<%= config.title %>

+

<%= config.subtitle %>

+
+ +
+
+
+
+ +
+
+<% } %> \ No newline at end of file diff --git a/layout/_partial/footer.ejs b/layout/_partial/footer.ejs new file mode 100644 index 0000000..48f38f1 --- /dev/null +++ b/layout/_partial/footer.ejs @@ -0,0 +1,32 @@ + \ No newline at end of file diff --git a/layout/_partial/head.ejs b/layout/_partial/head.ejs new file mode 100644 index 0000000..69bc754 --- /dev/null +++ b/layout/_partial/head.ejs @@ -0,0 +1,34 @@ + + + + + <% var title = page.title; if (is_archive()) { title = __('archive_a'); if + (is_month()) { title += ': ' + page.year + '/' + page.month; } else if + (is_year()) { title += ': ' + page.year; } } else if (is_category()) { title + = __('categories.ejs') + ': ' + page.categories; } else if (is_tag()) { + title = __('tag') + ': ' + page.tag; } %> <% if (page.keywords){ %> + + <% } else if (config.keywords){ %> + + <% } %> <% if (page.description){ %> + + <% } else if (config.description){ %> + + <% } %> + + + <% if (title){ %><%= title %> | <% } %> <%= config.title %> + + <% if (theme.favicon){ %> + + <% } %> + <%- css('css/style') %> <% if (theme.fancybox){ %> <%- + css('fancybox/jquery.fancybox.min') %> <% } %> <%- js('/js/pace.min.js') %> + + diff --git a/layout/_partial/mathjax.ejs b/layout/_partial/mathjax.ejs new file mode 100644 index 0000000..b7d1997 --- /dev/null +++ b/layout/_partial/mathjax.ejs @@ -0,0 +1,18 @@ + + + \ No newline at end of file diff --git a/layout/_partial/post/albums.ejs b/layout/_partial/post/albums.ejs new file mode 100644 index 0000000..69d3091 --- /dev/null +++ b/layout/_partial/post/albums.ejs @@ -0,0 +1,18 @@ +<% if (post.albums && post.albums.length){ %> +
+ +
+<% } %> diff --git a/layout/_partial/post/busuanzi.ejs b/layout/_partial/post/busuanzi.ejs new file mode 100644 index 0000000..1583bab --- /dev/null +++ b/layout/_partial/post/busuanzi.ejs @@ -0,0 +1,9 @@ + \ No newline at end of file diff --git a/layout/_partial/post/category.ejs b/layout/_partial/post/category.ejs new file mode 100644 index 0000000..51ef300 --- /dev/null +++ b/layout/_partial/post/category.ejs @@ -0,0 +1,10 @@ +<% if (post.categories && post.categories.length){ %> +
+ <%- list_categories(post.categories, { + show_count: false, + class: 'article-category', + style: 'none', + separator: ' / ' + }) %> +
+<% } %> \ No newline at end of file diff --git a/layout/_partial/post/date.ejs b/layout/_partial/post/date.ejs new file mode 100644 index 0000000..3f49613 --- /dev/null +++ b/layout/_partial/post/date.ejs @@ -0,0 +1,3 @@ + + + \ No newline at end of file diff --git a/layout/_partial/post/gallery.ejs b/layout/_partial/post/gallery.ejs new file mode 100644 index 0000000..36bdf8d --- /dev/null +++ b/layout/_partial/post/gallery.ejs @@ -0,0 +1,15 @@ +<% if (post.photos && post.photos.length){ %> +
+
+ <% post.photos.forEach(function(photo, i){ %> + <% if (index){ %> + + + + <% } else { %> + + <% } %> + <% }) %> +
+
+<% } %> diff --git a/layout/_partial/post/gitalk.ejs b/layout/_partial/post/gitalk.ejs new file mode 100644 index 0000000..8f86da6 --- /dev/null +++ b/layout/_partial/post/gitalk.ejs @@ -0,0 +1,21 @@ +<% if (theme.gitalk.enable) { %> +
+ <%- css('https://unpkg.com/gitalk/dist/gitalk.css') %> + <%- js('https://unpkg.com/gitalk/dist/gitalk.min.js') %> + <%- js('https://cdn.bootcss.com/blueimp-md5/2.10.0/js/md5.min.js') %> + +<% } %> \ No newline at end of file diff --git a/layout/_partial/post/justifiedGallery.ejs b/layout/_partial/post/justifiedGallery.ejs new file mode 100644 index 0000000..4ce98d4 --- /dev/null +++ b/layout/_partial/post/justifiedGallery.ejs @@ -0,0 +1,12 @@ +<% if (post.albums && post.albums.length){ %> + +<% } %> + diff --git a/layout/_partial/post/nav.ejs b/layout/_partial/post/nav.ejs new file mode 100644 index 0000000..6020c98 --- /dev/null +++ b/layout/_partial/post/nav.ejs @@ -0,0 +1,22 @@ +<% if (post.prev || post.next){ %> + +<% } %> diff --git a/layout/_partial/post/search.ejs b/layout/_partial/post/search.ejs new file mode 100644 index 0000000..81f8508 --- /dev/null +++ b/layout/_partial/post/search.ejs @@ -0,0 +1,4 @@ +
+ +
+
\ No newline at end of file diff --git a/layout/_partial/post/tag.ejs b/layout/_partial/post/tag.ejs new file mode 100644 index 0000000..e0f327f --- /dev/null +++ b/layout/_partial/post/tag.ejs @@ -0,0 +1,6 @@ +<% if (post.tags && post.tags.length){ %> + <%- list_tags(post.tags, { + show_count: false, + class: 'article-tag' + }) %> +<% } %> \ No newline at end of file diff --git a/layout/_partial/post/title.ejs b/layout/_partial/post/title.ejs new file mode 100644 index 0000000..5447b01 --- /dev/null +++ b/layout/_partial/post/title.ejs @@ -0,0 +1,17 @@ +<% if (post.link){ %> +

+ +

+<% } else if (post.title){ %> <% if (index){ %> +

+ <%= post.title %> +

+<% } else { %> +

+ <%= post.title %> +

+<% } %> <%- partial('topping') %> <% } %> diff --git a/layout/_partial/post/tocbot.ejs b/layout/_partial/post/tocbot.ejs new file mode 100644 index 0000000..52d66d0 --- /dev/null +++ b/layout/_partial/post/tocbot.ejs @@ -0,0 +1,6 @@ +<% if (post.toc != false && toc(page.content).length!==0){ %> +
+<% } %> + + + diff --git a/layout/_partial/post/topping.ejs b/layout/_partial/post/topping.ejs new file mode 100644 index 0000000..e4dfd65 --- /dev/null +++ b/layout/_partial/post/topping.ejs @@ -0,0 +1,5 @@ +<% if (is_home() && post.top) { %> +
+ +
+<% } %> \ No newline at end of file diff --git a/layout/_partial/post/valine.ejs b/layout/_partial/post/valine.ejs new file mode 100644 index 0000000..674823a --- /dev/null +++ b/layout/_partial/post/valine.ejs @@ -0,0 +1,51 @@ +<% if (!index && theme.leancloud && theme.leancloud.enable){ %> + +
+
+
+
+ + + + +<% } %> \ No newline at end of file diff --git a/layout/_partial/sidebar.ejs b/layout/_partial/sidebar.ejs new file mode 100644 index 0000000..b37b703 --- /dev/null +++ b/layout/_partial/sidebar.ejs @@ -0,0 +1,34 @@ + + + +
+ <%- partial('post/search') %> +
\ No newline at end of file diff --git a/layout/_partial/totop.ejs b/layout/_partial/totop.ejs new file mode 100644 index 0000000..f81daaa --- /dev/null +++ b/layout/_partial/totop.ejs @@ -0,0 +1,3 @@ +
+ +
\ No newline at end of file diff --git a/layout/archive.ejs b/layout/archive.ejs new file mode 100644 index 0000000..52f9b21 --- /dev/null +++ b/layout/archive.ejs @@ -0,0 +1 @@ +<%- partial('_partial/archive', {pagination: config.archive, index: true}) %> \ No newline at end of file diff --git a/layout/categories.ejs b/layout/categories.ejs new file mode 100644 index 0000000..54d6be4 --- /dev/null +++ b/layout/categories.ejs @@ -0,0 +1,6 @@ +
+ <% if (site.categories.length){ %> +

<%= __('categories') %>

+ <%- list_categories({show_count: theme.show_count}) %> + <% } %> +
\ No newline at end of file diff --git a/layout/index.ejs b/layout/index.ejs new file mode 100644 index 0000000..89c4bed --- /dev/null +++ b/layout/index.ejs @@ -0,0 +1,7 @@ +<%- partial('_partial/ayer') %> +
+ <%- partial('_partial/archive', {pagination: 2, index: true}) %> +
+ <%- partial('_partial/totop') %> +
+
diff --git a/layout/layout.ejs b/layout/layout.ejs new file mode 100644 index 0000000..d43156c --- /dev/null +++ b/layout/layout.ejs @@ -0,0 +1,20 @@ +<%- partial('_partial/head') %> + + +
+
+ <%- body %> + <%- partial('_partial/footer', null, {cache: !config.relative_link}) %> +
+ <% if (theme.toc && is_post()){ %> +
+ + + \ No newline at end of file diff --git a/layout/page.ejs b/layout/page.ejs new file mode 100644 index 0000000..65afaa4 --- /dev/null +++ b/layout/page.ejs @@ -0,0 +1,3 @@ +
+ <%- partial('_partial/article', {post: page, index: false}) %> +
\ No newline at end of file diff --git a/layout/post.ejs b/layout/post.ejs new file mode 100644 index 0000000..65afaa4 --- /dev/null +++ b/layout/post.ejs @@ -0,0 +1,3 @@ +
+ <%- partial('_partial/article', {post: page, index: false}) %> +
\ No newline at end of file diff --git a/layout/tags.ejs b/layout/tags.ejs new file mode 100644 index 0000000..ea529a5 --- /dev/null +++ b/layout/tags.ejs @@ -0,0 +1,7 @@ +
+ <% if (site.tags.length){ %> +

<%= __('tags') %>

+ <%- list_tags({show_count: theme.show_count}) %> + <% } %> +
+ diff --git a/package.json b/package.json new file mode 100644 index 0000000..26c8064 --- /dev/null +++ b/package.json @@ -0,0 +1,18 @@ +{ + "name": "ayer", + "version": "1.0.0", + "description": "ayer 是一个轻量优雅的 Hexo 主题", + "main": "index.js", + "dependencies": {}, + "devDependencies": {}, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "keywords": [ + "ayer", + "hexo", + "light" + ], + "author": "shenyu", + "license": "ISC" +} diff --git a/screenshots/hexo-theme-ayer.png b/screenshots/hexo-theme-ayer.png new file mode 100644 index 0000000..e3d847f Binary files /dev/null and b/screenshots/hexo-theme-ayer.png differ diff --git a/source/404.html b/source/404.html new file mode 100644 index 0000000..2493df3 --- /dev/null +++ b/source/404.html @@ -0,0 +1,24 @@ + + + + + 404 + + + + + +
+ + + +
+
+

404
Not Found!

+

Life was like a box of chocolates, you never know what you're going to get.

+
+ +
+
+ + \ No newline at end of file diff --git a/source/css/404.styl b/source/css/404.styl new file mode 100644 index 0000000..99a44e1 --- /dev/null +++ b/source/css/404.styl @@ -0,0 +1,40 @@ +@charset "utf-8" +// +// 404 +html, body, div, figure, img + margin 0 + padding 0 + +body + font-family "Helvetica Neue", Helvetica, "PingFang SC", "Hiragino Sans GB", "Microsoft YaHei", "微软雅黑", Arial, sans-serif; + +.notfound + position absolute + top 50% + left 50% + transform translate(-50%, -50%) + +figure.forrestgump + position relative + width 100% + img + width 100% + figcaption + float right + clear right + width 100% + padding 0 + text-align right + +@media (min-width: 768.02px) + figure.forrestgump + width 30rem + figcaption + width 60% + padding 0 2rem + +.notfound-link + position absolute + z-index 9 + margin-top 2rem + \ No newline at end of file diff --git a/source/css/_extend.styl b/source/css/_extend.styl new file mode 100644 index 0000000..8fa8c23 --- /dev/null +++ b/source/css/_extend.styl @@ -0,0 +1,82 @@ +$block-caption + text-decoration none + color sea-lighter + &:hover + color sea-lighter + +$block + border-radius 4px + +$base-style + h1, h2, h3, h4, h5, h6 + margin 1.5rem 0 + hr + height border-width + background-color border-color + border none + padding 0 + margin 1.5rem 0 + strong + font-weight bold + em, cite + font-style italic + sup, sub + font-size 75% + line-height 0 + position relative + vertical-align baseline + sup + top -.5rem + sub + bottom -.25rem + small + font-size 85% + acronym, abbr + border-bottom border-width border-color dotted + ul, ol, dl + margin 1.5rem 0 + line-height line-height + + p, table, blockquote + margin 1.5rem 0 + + img, video + max-width 100% + height auto + display block + margin auto + iframe + border none + table + width 100% + border-collapse collapse + vertical-align middle + empty-cells show + text-align left + th, td, & + border border-width border-color solid + th, td + padding 1rem 1.5rem + tbody + tr:nth-child(2n) + background-color rgba(froth, .25) + + blockquote + display block + padding 0 1.5rem + width 100% + overflow auto + border-left .3rem water solid + color sea-lighter + > :first-child + margin-top 0; + > :last-child + margin-bottom 0; + footer + cite + &:before + content "—" + padding 0 .5rem + + + diff --git a/source/css/_mixins.styl b/source/css/_mixins.styl new file mode 100644 index 0000000..f6b3634 --- /dev/null +++ b/source/css/_mixins.styl @@ -0,0 +1,59 @@ +clearfix() + &::before, &::after + content "" + display table + clear both + +hide-text() + text-indent: 100% + white-space: nowrap + overflow: hidden + +list-unstyled() + list-style none + padding-left 0 + margin-left 0 + +// Center +center() + top 50% + left 50% + transform translate(-50%, -50%) + +// Horizontal Center +center-x() + left 50% + transform translateX(-50%) + +// Vertical Center +center-y() + top 50% + transform translateY(-50%) + + +border-radius(n) + -webkit-border-radius n + -moz-border-radius n + border-radius n + +border-top-radius(n) + border-top-left-radius n + border-top-right-radius n + +border-right-radius(n) + border-top-right-radius n + border-bottom-right-radius n + +border-bottom-radius(n) + border-bottom-left-radius n + border-bottom-right-radius n + +transition(transition) + transition transition + +rounded-circle(size) + width size + height size + border-radius size / 2 + +// Media queries diff --git a/source/css/_normalize.styl b/source/css/_normalize.styl new file mode 100644 index 0000000..97ecf71 --- /dev/null +++ b/source/css/_normalize.styl @@ -0,0 +1,308 @@ +/*! normalize.css v8.0.0 | MIT License | github.com/necolas/normalize.css */ + +/* Document + ========================================================================== */ + +/** + * 1. Correct the line height in all browsers. + * 2. Prevent adjustments of font size after orientation changes in iOS. + */ + +html + line-height 1.15 /* 1 */ + -webkit-text-size-adjust 100% /* 2 */ + +/* Sections + ========================================================================== */ + +/** + * Remove the margin in all browsers. + */ + +body + margin 0 + +/** + * Correct the font size and margin on `h1` elements within `section` and + * `article` contexts in Chrome, Firefox, and Safari. + */ + +h1 + font-size 2em + margin 0.67em 0 + +/* Grouping content + ========================================================================== */ + +/** + * 1. Add the correct box sizing in Firefox. + * 2. Show the overflow in Edge and IE. + */ + +hr + box-sizing content-box /* 1 */ + height 0 /* 1 */ + overflow visible /* 2 */ + +/** + * 1. Correct the inheritance and scaling of font size in all browsers. + * 2. Correct the odd `em` font sizing in all browsers. + */ + +pre + font-family monospace, monospace /* 1 */ + font-size 1em /* 2 */ + +/* Text-level semantics + ========================================================================== */ + +/** + * Remove the gray background on active links in IE 10. + */ + +a + background-color transparent + +/** + * 1. Remove the bottom border in Chrome 57- + * 2. Add the correct text decoration in Chrome, Edge, IE, Opera, and Safari. + */ + +abbr[title] + border-bottom none /* 1 */ + text-decoration underline /* 2 */ + text-decoration underline dotted /* 2 */ + +/** + * Add the correct font weight in Chrome, Edge, and Safari. + */ + +b, +strong + font-weight bolder + +/** + * 1. Correct the inheritance and scaling of font size in all browsers. + * 2. Correct the odd `em` font sizing in all browsers. + */ + +code, +kbd, +samp + font-family monospace, monospace /* 1 */ + font-size 1em /* 2 */ + +/** + * Add the correct font size in all browsers. + */ + +small + font-size 80% + +/** + * Prevent `sub` and `sup` elements from affecting the line height in + * all browsers. + */ + +sub, +sup + font-size 75% + line-height 0 + position relative + vertical-align baseline + +sub + bottom -0.25em + +sup + top -0.5em + +/* Embedded content + ========================================================================== */ + +/** + * Remove the border on images inside links in IE 10. + */ + +img + border-style none + +/* Forms + ========================================================================== */ + +/** + * 1. Change the font styles in all browsers. + * 2. Remove the margin in Firefox and Safari. + */ + +button, +input, +optgroup, +select, +textarea + font-family inherit /* 1 */ + font-size 100% /* 1 */ + line-height 1.15 /* 1 */ + margin 0 /* 2 */ + +/** + * Show the overflow in IE. + * 1. Show the overflow in Edge. + */ + +button, +input /* 1 */ + overflow visible + +/** + * Remove the inheritance of text transform in Edge, Firefox, and IE. + * 1. Remove the inheritance of text transform in Firefox. + */ + +button, +select /* 1 */ + text-transform none + +/** + * Correct the inability to style clickable types in iOS and Safari. + */ + +button, +[type="button"], +[type="reset"], +[type="submit"] + -webkit-appearance button + +/** + * Remove the inner border and padding in Firefox. + */ + +button::-moz-focus-inner, +[type="button"]::-moz-focus-inner, +[type="reset"]::-moz-focus-inner, +[type="submit"]::-moz-focus-inner + border-style none + padding 0 + +/** + * Restore the focus styles unset by the previous rule. + */ + +button:-moz-focusring, +[type="button"]-moz-focusring, +[type="reset"]-moz-focusring, +[type="submit"]-moz-focusring + outline 1px dotted ButtonText + +/** + * Correct the padding in Firefox. + */ + +fieldset + padding 0.35em 0.75em 0.625em + +/** + * 1. Correct the text wrapping in Edge and IE. + * 2. Correct the color inheritance from `fieldset` elements in IE. + * 3. Remove the padding so developers are not caught out when they zero out + * `fieldset` elements in all browsers. + */ + +legend + box-sizing border-box /* 1 */ + color inherit /* 2 */ + display table /* 1 */ + max-width 100% /* 1 */ + padding 0 /* 3 */ + white-space normal /* 1 */ + +/** + * Add the correct vertical alignment in Chrome, Firefox, and Opera. + */ + +progress + vertical-align baseline + +/** + * Remove the default vertical scrollbar in IE 10+. + */ + +textarea + overflow auto + +/** + * 1. Add the correct box sizing in IE 10. + * 2. Remove the padding in IE 10. + */ + +[type="checkbox"], +[type="radio"] + box-sizing border-box /* 1 */ + padding 0 /* 2 */ + +/** + * Correct the cursor style of increment and decrement buttons in Chrome. + */ + +[type="number"]::-webkit-inner-spin-button, +[type="number"]::-webkit-outer-spin-button + height auto + +/** + * 1. Correct the odd appearance in Chrome and Safari. + * 2. Correct the outline style in Safari. + */ + +[type="search"] + -webkit-appearance textfield /* 1 */ + outline-offset -2px /* 2 */ + +/** + * Remove the inner padding in Chrome and Safari on macOS. + */ + +[type="search"]::-webkit-search-decoration + -webkit-appearance none + +/** + * 1. Correct the inability to style clickable types in iOS and Safari. + * 2. Change font properties to `inherit` in Safari. + */ + +::-webkit-file-upload-button + -webkit-appearance button /* 1 */ + font inherit /* 2 */ + +/* Interactive + ========================================================================== */ + +/* + * Add the correct display in Edge, IE 10+, and Firefox. + */ + +details + display block + +/* + * Add the correct display in all browsers. + */ + +summary + display list-item + +/* Misc + ========================================================================== */ + +/** + * Add the correct display in IE 10+. + */ + +template + display none + +/** + * Add the correct display in IE 10. + */ + +[hidden] + display none \ No newline at end of file diff --git a/source/css/_partial/albums.styl b/source/css/_partial/albums.styl new file mode 100644 index 0000000..ab567b3 --- /dev/null +++ b/source/css/_partial/albums.styl @@ -0,0 +1,55 @@ + +.article-albums + position relative + +.article-albums-photos + position relative + display flex + flex-wrap wrap + list-unstyled() + clearfix() + &::after + content: '' + flex-grow 999999999 + .article-albums-item + position relative + flex-grow 1 + margin .5rem + overflow hidden + img + object-fit cover + max-width 100% + min-width 100% + vertical-align: center + .article-albums-caption + display block + width 100% + padding 1rem 0 + text-align center + +// Media Query +@media (min-width: 576px) + .article-albums-item + img + height 32rem + .article-albums-caption + position absolute + bottom 0 + left 0 + width 100% + background-color rgba(black, .5) + background linear-gradient(to top, rgba(black, .5), transparent) + color white + padding 1rem + opacity 0 + transform translateY(100%) + transition(transition-base) + &:hover + .article-albums-caption + opacity 1 + transform translateY(0) + +@media (min-width: 768px) + .article-albums-item + img + height 20rem diff --git a/source/css/_partial/apple.styl b/source/css/_partial/apple.styl new file mode 100644 index 0000000..0d509c0 --- /dev/null +++ b/source/css/_partial/apple.styl @@ -0,0 +1,89 @@ + +// apple product +// +// macbook air +color-macbook = white +color-macbook-darken = darken(color-macbook, 5%) + +// +// browser +color-browser-light = white +color-browser-btns = + close #eb6b60 + minimize #f4be4f + maximize #66c655 + +scrolling-wrap-height = 30rem + +// +// macbook air +.macbook + position relative + .macbook-screen + position relative + background-color transparent + border-style solid + border-color color-macbook + border-radius 1rem + border-width 1.25rem + box-shadow 0 1rem 3rem rgba(black, .15), 0 0 .5rem rgba(black, .15) inset + + .macbook-keyboard + display none + position relative + box-sizing content-box + background-color color-macbook + border-bottom solid .75rem color-macbook-darken + border-bottom-radius(50%) + margin -.5rem -5rem 0 + height .5rem + box-shadow 0 .5rem 3rem rgba(0,0,0,.15) + &::before + content '' + position absolute + center-x() + background linear-gradient(90deg, color-macbook-darken, color-macbook, color-macbook-darken) + box-shadow 0 0 .1rem rgba(0, 0, 0, .05) inset + width 20% + height .3rem + border-radius .125rem + + +// +@media (min-width: 768px) + .macbook + .macbook-screen + border-width 2rem 1.25rem 1.25rem + .macbook-keyboard + display block + +// +// markdown article +.macbook-wrap + padding 1rem 9rem + +// +// markdown article shwo scrolling page +@keyframes scrolling-animation + 0% + top 0 + 10% + top 0 + transform translateY(0) + 30% + transform translateY(-35%) + 60% + transform translateY(-75%) + 90% + transform translateY(-100%) + 100% + transform translateY(-100%) + +.scrolling-wrap + min-height scrolling-wrap-height + overflow hidden +.scrolling + position absolute + top scrolling-wrap-height + width 100% + animation scrolling-animation 10s ease-in-out 1s infinite diff --git a/source/css/_partial/archive.styl b/source/css/_partial/archive.styl new file mode 100644 index 0000000..0d74698 --- /dev/null +++ b/source/css/_partial/archive.styl @@ -0,0 +1,92 @@ +.archives-wrap + position relative + clearfix() + &:first-child + margin-top 3rem + &:last-child + margin-bottom 3rem + +.archive-year-wrap + position absolute + top 0 + left 0 + width years-width + .archive-year + position relative + display inline-block + @extend $block-caption + &::after + content '' + position absolute + left 0 + bottom 0 + height .15rem + background-color sea-lighter + width 100% + +.archives + margin-left years-width + border-left border-width border-color dashed + padding-left 3rem + clearfix() + +.archive-article + avoid-column-break() + +.archive-article-inner + @extend $block + margin-bottom 1.5rem + +.archive-article-header + display table-row + > a, > h2 + display table-cell + h2 + margin 0 + padding-left 3rem + .archive-article-title + text-decoration: none + font-size 1.5rem + +.archive-article-footer + margin-top: 1.5rem + +.archive-article-date + position relative + display: block + @extend $block-caption + &::before + content '' + position absolute + top 50% + left -3.5rem + margin-top -.5rem + rounded-circle(1rem) + background-color border-color + +.page-type-title + margin 0 + padding 3rem 0 + +.page-nav + clearfix() + margin: 3rem auto + text-align: center + overflow: hidden + a, span + padding: 1rem 1.5rem + line-height: 1 + a + text-decoration: none + .prev + float: left + .next + float: right + .page-number + display: inline-block + @media mq-mobile + display: none + .current + font-weight: bold + .space + color: border-color \ No newline at end of file diff --git a/source/css/_partial/article.styl b/source/css/_partial/article.styl new file mode 100644 index 0000000..c7ac5bd --- /dev/null +++ b/source/css/_partial/article.styl @@ -0,0 +1,256 @@ + +.article + padding 5rem 0 3rem + .sea-center + text-align center + color black + &::after + border-bottom: 2px dashed water; + content: ''; + width: 100px; + display: block; + margin: .2em auto 0; + height: 2px +//.article-inner +// overflow hidden + +.article-topping + position absolute + top 0 + left -3rem + color: #ea434a + &>i + font-size 2rem + line-height 1.7 + + +.article-meta + clearfix() + +.article-date + @extend $block-caption + &::before + content '\eaf2' + margin-right .5rem + font-family remixicon + opacity .5 + +.article-category + display inline-block + margin-left 1.5rem + &:before + content "\efde" + font-family remixicon + margin-right .5rem + opacity 0.6 + .article-category-link + @extend $block-caption + +.archive-article-header + + .article-category + margin-left 0 + +.article-entry + font-size 110% + margin-top 1rem + clearfix() + @extend $base-style + color body-color + .pullquote + text-align left + width 45% + margin 0 + &.left + margin-left 0.5em + margin-right 1em + &.right + margin-right 0.5em + margin-left 1em + .caption + color color-grey + display block + font-size 0.9em + margin-top 0.5em + position relative + text-align center + // http://webdesignerwall.com/tutorials/css-elastic-videos + .video-container + position relative + padding-top (9 / 16 * 100) % // 16:9 ratio + height 0 + overflow hidden + iframe, object, embed + position absolute + top 0 + left 0 + width 100% + height 100% + margin-top 0 + +.article-header + position relative + h1, h2 + margin 0 + .article-title + display block + font-size 1.8em + font-weight bold + margin-bottom 3rem + text-decoration none + color body-color + padding-left 2rem + border-left 4px solid body-color + +.article-footer + clearfix() + margin-top 3rem + +// Tags +.article-tag-list + list-unstyled() + margin 0 + &:before + color: tag-color + content "\eec3" + font-family remixicon + margin-right .5rem + .article-tag-list-item + display inline-block + padding-right 1rem + .article-tag-list-link + font-size: 11px + text-decoration: none + display: block; + color: white; + float: left; + height 18px + line-height 18px + padding 0px 8px; + position: relative; + border-radius: 9px; + background-color tag-color + +.article-comment-link + float right + &:before + content "\ee0d" + font-family remixicon + padding-right 8px + +.article-share-link + cursor pointer + float right + margin-left 20px + &:before + content "\ef76" + font-family remixicon + padding-right 6px + +// Nav Older & Newer +.article-nav + clearfix() + position relative + padding-top 3rem + margin-top 5rem + border-top border-width border-color solid + +.article-nav-link + display block + text-decoration none + &:first-child + float left + &:last-child + float right + text-align right + +.article-nav-caption + color sea-lighter + +.article-nav-title + font-size inherit + +// Share +.article-share-box + position absolute + display none + background white + border-radius(.4rem) + box-shadow 1px 2px 10px rgba(0, 0, 0, 0.2) + border-radius 3px + margin-left -145px + overflow hidden + z-index 1 + &.on + display block + +.article-share-input + width 100% + background none + box-sizing border-box + padding 0 1.5rem + outline none + border none + border-bottom border-width border-color solid + height 3.6rem + line-height 3.6rem + +.article-share-links + clearfix() + +$article-share-link + position relative + display block + float left + width 5rem + height 3.6rem + color body-color + text-align center + text-decoration none + &:before + font-size 20px + font-family remixicon + absolute-center(font-size-base) + &:hover + color white + +.article-share-twitter + @extend $article-share-link + &:before + content "\f068" + &:hover + background twitter-color + text-shadow 0 1px darken(twitter-color, 20%) + +.article-share-facebook + @extend $article-share-link + &:before + content "\ec30" + &:hover + background facebook-color + text-shadow 0 1px darken(facebook-color, 20%) + +.article-share-pinterest + @extend $article-share-link + &:before + content "\eea8" + &:hover + background pinterest-color + text-shadow 0 1px darken(pinterest-color, 20%) + +.article-share-google + @extend $article-share-link + &:before + content "\ed15" + &:hover + background google-color + text-shadow 0 1px darken(google-color, 20%) + + +@import "tocbot" +@import "gallery" +@import "albums" +@import "justifiedGallery" + +@media (max-width: 768px) + .article-entry + font-size 120% \ No newline at end of file diff --git a/source/css/_partial/articles.styl b/source/css/_partial/articles.styl new file mode 100644 index 0000000..b3f8f49 --- /dev/null +++ b/source/css/_partial/articles.styl @@ -0,0 +1,21 @@ +.articles + .article + padding 4.5rem 0 + &:not(:last-child) + border-bottom border-width border-color solid + .article-entry, .article-footer + margin-top 0 + .article-entry + margin 1rem 0 + padding 0 2rem 2rem + border 1px dashed lighten(tag-color,80%) + .article-more-link + display inline-block + float right + background-color body-color + padding .5rem 1rem + border-radius 4px + color white !important + text-decoration none + .article-gallery + margin-top 1.5rem \ No newline at end of file diff --git a/source/css/_partial/ayer.styl b/source/css/_partial/ayer.styl new file mode 100644 index 0000000..e6f6648 --- /dev/null +++ b/source/css/_partial/ayer.styl @@ -0,0 +1,72 @@ +@keyframes down + 0% + margin-bottom 0 + opacity 1 + 100% + margin-bottom -15px + opacity .1 +// +.cover-frame + position relative + min-width 100% + height 100vh + .bg-box + width 100% + height 100% + &>img + display block + width 100vw + height 100vh + object-fit cover + object-position center center +.cover-inner + position absolute + top 50% + left 50% + transform translate(-50%, -100%) + h1 + font-size 8rem + margin 0 + h2 + font-size 3rem + margin .5rem 0 1.5rem + a, & + color white + text-decoration none + video, img + position relative + .cover-logo + width cover-logo-size + + +.cover-learn-more + position absolute + z-index 1 + bottom 10px + left 0 + width 100% + a > i + font-size 3rem + color white + animation down 1s linear infinite + &:hover + color sea + +.to_top + position fixed + bottom 10rem + right 50px + z-index 9 + text-align center + +// Media Query +@media (max-width: 768px) + .cover-inner + transform: translate(-50%, -70%); + h1 + font-size 6rem + h2 + font-size 2.3rem + + .to_top + right 10px \ No newline at end of file diff --git a/source/css/_partial/categories.styl b/source/css/_partial/categories.styl new file mode 100644 index 0000000..483e26c --- /dev/null +++ b/source/css/_partial/categories.styl @@ -0,0 +1,13 @@ +// Categories + +.category-list + list-unstyled() + margin-right -.5rem + margin-left -.5rem + > .category-list-item + display inline-block + padding .5rem 1rem + &:before + content "\efde" + font-family remixicon + margin-right .5rem \ No newline at end of file diff --git a/source/css/_partial/float.styl b/source/css/_partial/float.styl new file mode 100644 index 0000000..5c65061 --- /dev/null +++ b/source/css/_partial/float.styl @@ -0,0 +1,9 @@ + +.float-left + float: left !important; + +.float-right + float: right !important; + +.float-none + float: none !important; \ No newline at end of file diff --git a/source/css/_partial/footer.styl b/source/css/_partial/footer.styl new file mode 100644 index 0000000..786acfe --- /dev/null +++ b/source/css/_partial/footer.styl @@ -0,0 +1,17 @@ + +.footer + border-top border-width solid border-color + padding 3rem 0 + .outer + &>ul + position relative + display flex + justify-content space-between + &:first-child + border-bottom border-width solid darken(froth-light,10%) + + li + display inline-block + padding .5rem 0 + span + margin-right 6px \ No newline at end of file diff --git a/source/css/_partial/gallery.styl b/source/css/_partial/gallery.styl new file mode 100644 index 0000000..f04a7be --- /dev/null +++ b/source/css/_partial/gallery.styl @@ -0,0 +1,20 @@ + +.article-gallery + position: relative + +.article-gallery-photos + position: relative + overflow: hidden + +.article-gallery-img + display: none + max-width: 100% + &:first-child + display: block + &.loaded + position: absolute + display: block + img + display: block + max-width: 100% + margin: 0 auto \ No newline at end of file diff --git a/source/css/_partial/gitalk.styl b/source/css/_partial/gitalk.styl new file mode 100644 index 0000000..6ca9883 --- /dev/null +++ b/source/css/_partial/gitalk.styl @@ -0,0 +1,7 @@ +.gitalk,.markdown-body + font-size font-size-base!important + +.gt-container + .gt-avatar.gt-comment-avatar + img + border-radius 50%!important \ No newline at end of file diff --git a/source/css/_partial/highlight.styl b/source/css/_partial/highlight.styl new file mode 100644 index 0000000..b26b6ad --- /dev/null +++ b/source/css/_partial/highlight.styl @@ -0,0 +1,148 @@ +highlight-background = #f6f8fa +highlight-current-line = #efefef +highlight-selection = #d6d6d6 +highlight-foreground = #4d4d4c +highlight-comment = #8e908c +highlight-red = #f2777a +highlight-orange = #f99157 +highlight-yellow = #ffcc66 +highlight-green = #99cc99 +highlight-aqua = #66cccc +highlight-blue = #6699cc +highlight-purple = #cc99cc + +$code-block + background highlight-background + padding 1.5rem + margin 1.5rem 0 + border-radius .4rem + overflow auto + color highlight-foreground + +$line-numbers + color highlight-comment + +.article-entry + pre, code + font-family inherit + text-shadow none + code + background highlight-background + padding .25rem + border-radius(.4rem) + pre + @extend $code-block + code + background none + padding 0 + .highlight + @extend $code-block + pre + border none + margin 0 + padding 0 + table + margin 0 + width auto + border none + td + border none + padding 0 + figcaption + clearfix() + font-size 85% + color highlight-comment + line-height 1rem + margin-bottom 1rem + a + float right + .gutter + -webkit-user-select none + -moz-user-select none + -ms-user-select none + user-select none + .gutter pre + @extend $line-numbers + text-align right + padding-right 1.5rem + .line + height inherit + .line.marked + background highlight-selection + .gist + background highlight-background + .gist-file + border none + margin 0 + .gist-data + background none + border none + .line-numbers + @extend $line-numbers + background none + border none + .line-data + padding 0 !important + .highlight + margin 0 + padding 0 + border none + .gist-meta + background highlight-background + color highlight-comment + padding 0 + margin-top 1rem + a + font-weight normal + &:hover + text-decoration underline + +pre + .comment + .title + color highlight-comment + .variable + .attribute + .tag + .regexp + .ruby .constant + .xml .tag .title + .xml .pi + .xml .doctype + .html .doctype + .css .id + .css .class + .css .pseudo + color highlight-red + .number + .preprocessor + .built_in + .literal + .params + .constant + color highlight-orange + .class + .ruby .class .title + .css .rules .attribute + color highlight-green + .string + .value + .inheritance + .header + .ruby .symbol + .xml .cdata + color highlight-green + .css .hexcolor + color highlight-aqua + .function + .python .decorator + .python .title + .ruby .function .title + .ruby .title .keyword + .perl .sub + .javascript .title + .coffeescript .title + color highlight-blue + .keyword + .javascript .function + color highlight-purple diff --git a/source/css/_partial/justifiedGallery.styl b/source/css/_partial/justifiedGallery.styl new file mode 100644 index 0000000..d2240e2 --- /dev/null +++ b/source/css/_partial/justifiedGallery.styl @@ -0,0 +1,73 @@ +/* + * Justified Gallery - v4.0.0-alpha + * http://miromannino.com/projects/justified-gallery/ + * Copyright (c) 2019 Miro Mannino + * Licensed under the MIT license. + */ + +.justified-gallery + width 100% + position relative + overflow hidden + > a, > div, > figure + position absolute + display inline-block + overflow hidden + background gray /* To have gray placeholders while the gallery is loading with waitThumbnailsLoad = false */ + filter "alpha(opacity=10)" + opacity 0.1 + margin 0 + padding 0 + > img, > a > img, > svg, > a > svg + position absolute + top 50% + left 50% + margin 0 + padding 0 + border none + filter "alpha(opacity=0)" + opacity 0 + > .caption + display none + position absolute + right 0 + bottom 0 + left 0 + padding 1rem + background-color rgba(black, .5) + background linear-gradient(to top, rgba(black, .5), transparent) + color white + &.caption-visible + display initial + > .jg-entry-visible + filter "alpha(opacity=100)" + opacity 1 + background none + > img, > a > img, > svg, > a > svg + filter "alpha(opacity=100)" + opacity 1 + -webkit-transition opacity 500ms ease-in + -moz-transition opacity 500ms ease-in + -o-transition opacity 500ms ease-in + transition opacity 500ms ease-in + > .jg-filtered + display none + > .spinner + position absolute + bottom 0 + margin-left -24px + padding 10px 0 10px 0 + left 50% + filter "alpha(opacity=100)" + opacity 1 + overflow initial + > span + display inline-block + filter "alpha(opacity=0)" + opacity 0 + width 8px + height 8px + margin 0 4px 0 4px + background-color #000 + border-radius 6px + \ No newline at end of file diff --git a/source/css/_partial/layout.styl b/source/css/_partial/layout.styl new file mode 100644 index 0000000..2527d6f --- /dev/null +++ b/source/css/_partial/layout.styl @@ -0,0 +1,97 @@ +// Layout +#app + height 100% + width 100% + position relative + overflow hidden + +.cover + position relative + padding 0 + margin-bottom 3rem + text-align center + +.content, .sidebar + transition(transition-base) + +.content + position relative + z-index 1 + margin-left 0 + height 100% + width 100% + overflow-y scroll + overflow-x: hidden + -webkit-overflow-scrolling touch + &.on + transform translateX(aside-width) + margin-left 0 !important + +.sidebar + position fixed + z-index 9 + left - aside-width + bottom 0 + width aside-width + height 100% + background-color rgba(0,0,0,.8) + &.on + left 0 + +.navbar-toggle + position absolute + top gutter-width + left: gutter-width + aside-width + border none + height 4rem + width 4rem + border-radius 50% + background-color rgba(black, .5) + color white + transition(transition-base) + opacity .5 + &:hover + opacity 1 + &::before + content '\ee09' + font-family remixicon + font-size larger + +.wrap, .outer + width 100% + padding-right gutter-width + padding-left gutter-width + margin auto + overflow-x hidden + clearfix() + +.local-search + width 100% + + +// Media Query +@media (min-width: 768px) + .cover + margin-bottom 0 + height 100% + + .wrap, .outer + width wrap-width + padding-right 0 + padding-left 0 + + .local-search + width wrap-width + + .content + &.on + transform: none + +@media (max-width: 768px) + .content + &.on + margin-left -1px !important + .sidebar + background-color body-color + .navbar-toggle + transform: scale(1.1) \ No newline at end of file diff --git a/source/css/_partial/lists.styl b/source/css/_partial/lists.styl new file mode 100644 index 0000000..7de7d5b --- /dev/null +++ b/source/css/_partial/lists.styl @@ -0,0 +1,2 @@ +.list-unstyled + list-unstyled() \ No newline at end of file diff --git a/source/css/_partial/mobile.styl b/source/css/_partial/mobile.styl new file mode 100644 index 0000000..8b13789 --- /dev/null +++ b/source/css/_partial/mobile.styl @@ -0,0 +1 @@ + diff --git a/source/css/_partial/navbar.styl b/source/css/_partial/navbar.styl new file mode 100644 index 0000000..3b3dee3 --- /dev/null +++ b/source/css/_partial/navbar.styl @@ -0,0 +1,41 @@ +.navbar + position relative + padding-top 3rem + text-align center + .nav + list-unstyled() + .nav-item-link + display block + padding 1rem + color #bbb + text-decoration none + cursor pointer + &:hover + opacity .8 + background-color body-color + &.nav-main + .nav-item-link + i + font-size 1rem + display block + line-height 1 +.navbar-bottom + position absolute + bottom 0 + width 100% + font-size 2rem +.logo + text-align center + margin-bottom 2rem + img + width logo-size + +// Media Query +@media (max-width: 768px) + .navbar + .nav + .nav-item-link + &.nav-item-search + display: none + + diff --git a/source/css/_partial/pace.styl b/source/css/_partial/pace.styl new file mode 100644 index 0000000..9667408 --- /dev/null +++ b/source/css/_partial/pace.styl @@ -0,0 +1,25 @@ + +.pace + -webkit-pointer-events none + pointer-events none + -webkit-user-select none + -moz-user-select none + user-select none + .pace-progress + position fixed + z-index 2000 + top 0 + right 100% + width 100% + height .2rem + background-color sea-blue + +.pace-inactive + display none + +@media (max-width: 768px) + .pace + display none + + + diff --git a/source/css/_partial/search.styl b/source/css/_partial/search.styl new file mode 100644 index 0000000..d07e6f0 --- /dev/null +++ b/source/css/_partial/search.styl @@ -0,0 +1,76 @@ + +.search-form-wrap + width 100% + position fixed + top -100% + right aside-width + left 0 + opacity 0 + transition(.3s) + &.on + top 0 + opacity 1 + +//------------- +.local-search + position relative + margin 0 auto + padding 1rem 3rem + background-color rgba(255,255,255,.5) + box-shadow 0 1rem 3rem rgba(sea, .05) + max-height 100vh + overflow-y auto + +.local-search-input + font-size 120% + border 0 + border-radius(.4rem) + width 100% + padding 1rem 1.5rem + outline: none + &::-webkit-search-results-decoration + &::-webkit-search-cancel-button + -webkit-appearance: none + +.local-search-close + position absolute + top 1.85rem + right 4.25rem + display block + height 2rem + width 2rem + padding 0 + border none + border-radius(50%) + color white + text-align center + cursor pointer + &::before + font-size: 150% + content '\eb52' + font-family remixicon + +// 搜索结果 +.local-search-result + text-align left + +.search-result-list + list-unstyled() + li + padding 1.5rem 0 + &:not(:last-child) + border-bottom border-width border-color solid + + .search-result-title + font-size 1.6rem + font-weight bold + .search-result + padding-top .5rem + margin 0 + max-height 12rem + overflow hidden + em.search-keyword + color sand + +.search-result-empty + padding 3rem 0 0 diff --git a/source/css/_partial/sidebar.styl b/source/css/_partial/sidebar.styl new file mode 100644 index 0000000..e6d22ae --- /dev/null +++ b/source/css/_partial/sidebar.styl @@ -0,0 +1,2 @@ +@import "navbar" +@import "totop" \ No newline at end of file diff --git a/source/css/_partial/tag.styl b/source/css/_partial/tag.styl new file mode 100644 index 0000000..f723bd2 --- /dev/null +++ b/source/css/_partial/tag.styl @@ -0,0 +1,13 @@ +// Tags + +.tag-list + list-unstyled() + margin-right -.5rem + margin-left -.5rem + > .tag-list-item + display inline-block + padding .5rem 1rem + &:before + content "\eec3" + font-family remixicon + margin-right .5rem \ No newline at end of file diff --git a/source/css/_partial/tocbot.styl b/source/css/_partial/tocbot.styl new file mode 100644 index 0000000..810024e --- /dev/null +++ b/source/css/_partial/tocbot.styl @@ -0,0 +1,56 @@ + +.tocbot + position fixed + top 14rem + left calc((100vw - 70rem) / 2 + 70rem) + font-size 80% + opacity .8 + > .toc-list + position relative + overflow hidden + + +.toc-list + list-unstyled() + padding-left 1rem + + +a.toc-link + height 100% + color sea-dark + text-decoration none + font-size 115% + + +.is-collapsible + max-height 1000px + overflow hidden + transition all 300ms ease-in-out + + +.is-collapsed + max-height 0 + + +.is-position-fixed + position fixed !important + top 0 + right aside-width + +.is-active-link + font-weight 700 + +// Left line before pseudo element. +.toc-link::before + background-color water + content ' ' + display inline-block + height inherit + left 0 + margin-top -1px + position absolute + width 2px + + +.is-active-link::before + background-color link-active-color diff --git a/source/css/_partial/totop.styl b/source/css/_partial/totop.styl new file mode 100644 index 0000000..3312847 --- /dev/null +++ b/source/css/_partial/totop.styl @@ -0,0 +1,31 @@ + +@keyframes rocket { + 0% { + transform translateY(0) + opacity 1; + } + 45% { + transform translateY(-3.2rem) + opacity 0; + } + 55% { + transform translateY(3.2rem) + opacity 0; + } + 100% { + transform translateY(0) + opacity 1; + } +} + +.totop + position relative + display inline-block + overflow hidden + cursor pointer + rounded-circle(3.2rem) + background-color froth-light + line-height 3rem + &:hover > i { + animation rocket .3s ease-in-out + } diff --git a/source/css/_remixicon.styl b/source/css/_remixicon.styl new file mode 100644 index 0000000..1738431 --- /dev/null +++ b/source/css/_remixicon.styl @@ -0,0 +1,1820 @@ +/* +* Remix Icon v2.1.0 +* https://remixicon.com +* https://github.com/Remix-Design/RemixIcon +* +* Copyright RemixIcon.com +* Released under the Apache License Version 2.0 +* +* Date: 2019-11-03 +*/ + +// variables +remixicon-font-path = 'remixicon/' !default; + +@font-face + font-family: remixicon; + src: url(remixicon-font-path +'remixicon.eot?t=1572787439022'); /* IE9*/ + src: url(remixicon-font-path +'remixicon.eot?t=1572787439022#iefix') format('embedded-opentype'), /* IE6-IE8 */ + url(remixicon-font-path +'remixicon.woff2?t=1572787439022') format("woff2"), + url(remixicon-font-path +'remixicon.woff?t=1572787439022') format("woff"), + url(remixicon-font-path +'remixicon.ttf?t=1572787439022') format('truetype'), /* chrome, firefox, opera, Safari, Android, iOS 4.2+*/ + url(remixicon-font-path +'remixicon.svg?t=1572787439022#remixicon') format('svg'); /* iOS 4.1- */ + font-display: swap; + + +[class^="ri-"], [class*=" ri-"] + display inline-block; + font-family: 'remixicon' !important; + font-style: normal; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; + + +.ri-lg { font-size: 1.3333em; line-height: 0.75em; vertical-align: -.0667em; } +.ri-xl { font-size: 1.5em; line-height: 0.6666em; vertical-align: -.075em; } +.ri-xxs { font-size: .5em; } +.ri-xs { font-size: .75em; } +.ri-sm { font-size: .875em } +.ri-1x { font-size: 1em; } +.ri-2x { font-size: 2em; } +.ri-3x { font-size: 3em; } +.ri-4x { font-size: 4em; } +.ri-5x { font-size: 5em; } +.ri-6x { font-size: 6em; } +.ri-7x { font-size: 7em; } +.ri-8x { font-size: 8em; } +.ri-9x { font-size: 9em; } +.ri-10x { font-size: 10em; } +.ri-fw { text-align: center; width: 1.25em; } + +.ri-4k-fill:before { content: "\ea01"; } +.ri-4k-line:before { content: "\ea02"; } +.ri-account-box-fill:before { content: "\ea03"; } +.ri-account-box-line:before { content: "\ea04"; } +.ri-account-circle-fill:before { content: "\ea05"; } +.ri-account-circle-line:before { content: "\ea06"; } +.ri-account-pin-box-fill:before { content: "\ea07"; } +.ri-account-pin-box-line:before { content: "\ea08"; } +.ri-account-pin-circle-fill:before { content: "\ea09"; } +.ri-account-pin-circle-line:before { content: "\ea0a"; } +.ri-add-box-fill:before { content: "\ea0b"; } +.ri-add-box-line:before { content: "\ea0c"; } +.ri-add-circle-fill:before { content: "\ea0d"; } +.ri-add-circle-line:before { content: "\ea0e"; } +.ri-add-fill:before { content: "\ea0f"; } +.ri-add-line:before { content: "\ea10"; } +.ri-admin-fill:before { content: "\ea11"; } +.ri-admin-line:before { content: "\ea12"; } +.ri-airplay-fill:before { content: "\ea13"; } +.ri-airplay-line:before { content: "\ea14"; } +.ri-alarm-fill:before { content: "\ea15"; } +.ri-alarm-line:before { content: "\ea16"; } +.ri-alarm-warning-fill:before { content: "\ea17"; } +.ri-alarm-warning-line:before { content: "\ea18"; } +.ri-album-fill:before { content: "\ea19"; } +.ri-album-line:before { content: "\ea1a"; } +.ri-alert-fill:before { content: "\ea1b"; } +.ri-alert-line:before { content: "\ea1c"; } +.ri-align-bottom:before { content: "\ea1d"; } +.ri-align-center:before { content: "\ea1e"; } +.ri-align-justify:before { content: "\ea1f"; } +.ri-align-left:before { content: "\ea20"; } +.ri-align-right:before { content: "\ea21"; } +.ri-align-top:before { content: "\ea22"; } +.ri-align-vertically:before { content: "\ea23"; } +.ri-alipay-fill:before { content: "\ea24"; } +.ri-alipay-line:before { content: "\ea25"; } +.ri-amazon-fill:before { content: "\ea26"; } +.ri-amazon-line:before { content: "\ea27"; } +.ri-anchor-fill:before { content: "\ea28"; } +.ri-anchor-line:before { content: "\ea29"; } +.ri-android-fill:before { content: "\ea2a"; } +.ri-android-line:before { content: "\ea2b"; } +.ri-angularjs-fill:before { content: "\ea2c"; } +.ri-angularjs-line:before { content: "\ea2d"; } +.ri-anticlockwise-2-fill:before { content: "\ea2e"; } +.ri-anticlockwise-2-line:before { content: "\ea2f"; } +.ri-anticlockwise-fill:before { content: "\ea30"; } +.ri-anticlockwise-line:before { content: "\ea31"; } +.ri-apple-fill:before { content: "\ea32"; } +.ri-apple-line:before { content: "\ea33"; } +.ri-apps-2-fill:before { content: "\ea34"; } +.ri-apps-2-line:before { content: "\ea35"; } +.ri-apps-fill:before { content: "\ea36"; } +.ri-apps-line:before { content: "\ea37"; } +.ri-archive-drawer-fill:before { content: "\ea38"; } +.ri-archive-drawer-line:before { content: "\ea39"; } +.ri-archive-fill:before { content: "\ea3a"; } +.ri-archive-line:before { content: "\ea3b"; } +.ri-arrow-down-circle-fill:before { content: "\ea3c"; } +.ri-arrow-down-circle-line:before { content: "\ea3d"; } +.ri-arrow-down-fill:before { content: "\ea3e"; } +.ri-arrow-down-line:before { content: "\ea3f"; } +.ri-arrow-down-s-fill:before { content: "\ea40"; } +.ri-arrow-down-s-line:before { content: "\ea41"; } +.ri-arrow-drop-down-fill:before { content: "\ea42"; } +.ri-arrow-drop-down-line:before { content: "\ea43"; } +.ri-arrow-drop-left-fill:before { content: "\ea44"; } +.ri-arrow-drop-left-line:before { content: "\ea45"; } +.ri-arrow-drop-right-fill:before { content: "\ea46"; } +.ri-arrow-drop-right-line:before { content: "\ea47"; } +.ri-arrow-drop-up-fill:before { content: "\ea48"; } +.ri-arrow-drop-up-line:before { content: "\ea49"; } +.ri-arrow-go-back-fill:before { content: "\ea4a"; } +.ri-arrow-go-back-line:before { content: "\ea4b"; } +.ri-arrow-go-forward-fill:before { content: "\ea4c"; } +.ri-arrow-go-forward-line:before { content: "\ea4d"; } +.ri-arrow-left-circle-fill:before { content: "\ea4e"; } +.ri-arrow-left-circle-line:before { content: "\ea4f"; } +.ri-arrow-left-down-fill:before { content: "\ea50"; } +.ri-arrow-left-down-line:before { content: "\ea51"; } +.ri-arrow-left-fill:before { content: "\ea52"; } +.ri-arrow-left-line:before { content: "\ea53"; } +.ri-arrow-left-s-fill:before { content: "\ea54"; } +.ri-arrow-left-s-line:before { content: "\ea55"; } +.ri-arrow-left-up-fill:before { content: "\ea56"; } +.ri-arrow-left-up-line:before { content: "\ea57"; } +.ri-arrow-right-circle-fill:before { content: "\ea58"; } +.ri-arrow-right-circle-line:before { content: "\ea59"; } +.ri-arrow-right-down-fill:before { content: "\ea5a"; } +.ri-arrow-right-down-line:before { content: "\ea5b"; } +.ri-arrow-right-fill:before { content: "\ea5c"; } +.ri-arrow-right-line:before { content: "\ea5d"; } +.ri-arrow-right-s-fill:before { content: "\ea5e"; } +.ri-arrow-right-s-line:before { content: "\ea5f"; } +.ri-arrow-right-up-fill:before { content: "\ea60"; } +.ri-arrow-right-up-line:before { content: "\ea61"; } +.ri-arrow-up-circle-fill:before { content: "\ea62"; } +.ri-arrow-up-circle-line:before { content: "\ea63"; } +.ri-arrow-up-fill:before { content: "\ea64"; } +.ri-arrow-up-line:before { content: "\ea65"; } +.ri-arrow-up-s-fill:before { content: "\ea66"; } +.ri-arrow-up-s-line:before { content: "\ea67"; } +.ri-artboard-2-fill:before { content: "\ea68"; } +.ri-artboard-2-line:before { content: "\ea69"; } +.ri-artboard-fill:before { content: "\ea6a"; } +.ri-artboard-line:before { content: "\ea6b"; } +.ri-article-fill:before { content: "\ea6c"; } +.ri-article-line:before { content: "\ea6d"; } +.ri-asterisk:before { content: "\ea6e"; } +.ri-at-fill:before { content: "\ea6f"; } +.ri-at-line:before { content: "\ea70"; } +.ri-attachment-2:before { content: "\ea71"; } +.ri-attachment-fill:before { content: "\ea72"; } +.ri-attachment-line:before { content: "\ea73"; } +.ri-auction-fill:before { content: "\ea74"; } +.ri-auction-line:before { content: "\ea75"; } +.ri-award-fill:before { content: "\ea76"; } +.ri-award-line:before { content: "\ea77"; } +.ri-baidu-fill:before { content: "\ea78"; } +.ri-baidu-line:before { content: "\ea79"; } +.ri-ball-pen-fill:before { content: "\ea7a"; } +.ri-ball-pen-line:before { content: "\ea7b"; } +.ri-bank-card-2-fill:before { content: "\ea7c"; } +.ri-bank-card-2-line:before { content: "\ea7d"; } +.ri-bank-card-fill:before { content: "\ea7e"; } +.ri-bank-card-line:before { content: "\ea7f"; } +.ri-bank-fill:before { content: "\ea80"; } +.ri-bank-line:before { content: "\ea81"; } +.ri-bar-chart-2-fill:before { content: "\ea82"; } +.ri-bar-chart-2-line:before { content: "\ea83"; } +.ri-bar-chart-box-fill:before { content: "\ea84"; } +.ri-bar-chart-box-line:before { content: "\ea85"; } +.ri-bar-chart-fill:before { content: "\ea86"; } +.ri-bar-chart-grouped-fill:before { content: "\ea87"; } +.ri-bar-chart-grouped-line:before { content: "\ea88"; } +.ri-bar-chart-horizontal-fill:before { content: "\ea89"; } +.ri-bar-chart-horizontal-line:before { content: "\ea8a"; } +.ri-bar-chart-line:before { content: "\ea8b"; } +.ri-barcode-box-fill:before { content: "\ea8c"; } +.ri-barcode-box-line:before { content: "\ea8d"; } +.ri-barcode-fill:before { content: "\ea8e"; } +.ri-barcode-line:before { content: "\ea8f"; } +.ri-barricade-fill:before { content: "\ea90"; } +.ri-barricade-line:before { content: "\ea91"; } +.ri-base-station-fill:before { content: "\ea92"; } +.ri-base-station-line:before { content: "\ea93"; } +.ri-battery-2-charge-fill:before { content: "\ea94"; } +.ri-battery-2-charge-line:before { content: "\ea95"; } +.ri-battery-2-fill:before { content: "\ea96"; } +.ri-battery-2-line:before { content: "\ea97"; } +.ri-battery-charge-fill:before { content: "\ea98"; } +.ri-battery-charge-line:before { content: "\ea99"; } +.ri-battery-fill:before { content: "\ea9a"; } +.ri-battery-line:before { content: "\ea9b"; } +.ri-battery-low-fill:before { content: "\ea9c"; } +.ri-battery-low-line:before { content: "\ea9d"; } +.ri-behance-fill:before { content: "\ea9e"; } +.ri-behance-line:before { content: "\ea9f"; } +.ri-bike-fill:before { content: "\eaa0"; } +.ri-bike-line:before { content: "\eaa1"; } +.ri-bilibili-fill:before { content: "\eaa2"; } +.ri-bilibili-line:before { content: "\eaa3"; } +.ri-bill-fill:before { content: "\eaa4"; } +.ri-bill-line:before { content: "\eaa5"; } +.ri-bit-coin-fill:before { content: "\eaa6"; } +.ri-bit-coin-line:before { content: "\eaa7"; } +.ri-bluetooth-connect-fill:before { content: "\eaa8"; } +.ri-bluetooth-connect-line:before { content: "\eaa9"; } +.ri-bluetooth-fill:before { content: "\eaaa"; } +.ri-bluetooth-line:before { content: "\eaab"; } +.ri-blur-off-fill:before { content: "\eaac"; } +.ri-blur-off-line:before { content: "\eaad"; } +.ri-bold:before { content: "\eaae"; } +.ri-book-2-fill:before { content: "\eaaf"; } +.ri-book-2-line:before { content: "\eab0"; } +.ri-book-3-fill:before { content: "\eab1"; } +.ri-book-3-line:before { content: "\eab2"; } +.ri-book-fill:before { content: "\eab3"; } +.ri-book-line:before { content: "\eab4"; } +.ri-book-mark-fill:before { content: "\eab5"; } +.ri-book-mark-line:before { content: "\eab6"; } +.ri-book-open-fill:before { content: "\eab7"; } +.ri-book-open-line:before { content: "\eab8"; } +.ri-book-read-fill:before { content: "\eab9"; } +.ri-book-read-line:before { content: "\eaba"; } +.ri-bookmark-2-fill:before { content: "\eabb"; } +.ri-bookmark-2-line:before { content: "\eabc"; } +.ri-bookmark-3-fill:before { content: "\eabd"; } +.ri-bookmark-3-line:before { content: "\eabe"; } +.ri-bookmark-fill:before { content: "\eabf"; } +.ri-bookmark-line:before { content: "\eac0"; } +.ri-braces-fill:before { content: "\eac1"; } +.ri-braces-line:before { content: "\eac2"; } +.ri-brackets-fill:before { content: "\eac3"; } +.ri-brackets-line:before { content: "\eac4"; } +.ri-briefcase-2-fill:before { content: "\eac5"; } +.ri-briefcase-2-line:before { content: "\eac6"; } +.ri-briefcase-3-fill:before { content: "\eac7"; } +.ri-briefcase-3-line:before { content: "\eac8"; } +.ri-briefcase-4-fill:before { content: "\eac9"; } +.ri-briefcase-4-line:before { content: "\eaca"; } +.ri-briefcase-5-fill:before { content: "\eacb"; } +.ri-briefcase-5-line:before { content: "\eacc"; } +.ri-briefcase-fill:before { content: "\eacd"; } +.ri-briefcase-line:before { content: "\eace"; } +.ri-broadcast-fill:before { content: "\eacf"; } +.ri-broadcast-line:before { content: "\ead0"; } +.ri-brush-2-fill:before { content: "\ead1"; } +.ri-brush-2-line:before { content: "\ead2"; } +.ri-brush-3-fill:before { content: "\ead3"; } +.ri-brush-3-line:before { content: "\ead4"; } +.ri-brush-4-fill:before { content: "\ead5"; } +.ri-brush-4-line:before { content: "\ead6"; } +.ri-brush-fill:before { content: "\ead7"; } +.ri-brush-line:before { content: "\ead8"; } +.ri-bug-2-fill:before { content: "\ead9"; } +.ri-bug-2-line:before { content: "\eada"; } +.ri-bug-fill:before { content: "\eadb"; } +.ri-bug-line:before { content: "\eadc"; } +.ri-building-2-fill:before { content: "\eadd"; } +.ri-building-2-line:before { content: "\eade"; } +.ri-building-3-fill:before { content: "\eadf"; } +.ri-building-3-line:before { content: "\eae0"; } +.ri-building-4-fill:before { content: "\eae1"; } +.ri-building-4-line:before { content: "\eae2"; } +.ri-building-fill:before { content: "\eae3"; } +.ri-building-line:before { content: "\eae4"; } +.ri-bus-2-fill:before { content: "\eae5"; } +.ri-bus-2-line:before { content: "\eae6"; } +.ri-bus-fill:before { content: "\eae7"; } +.ri-bus-line:before { content: "\eae8"; } +.ri-calculator-fill:before { content: "\eae9"; } +.ri-calculator-line:before { content: "\eaea"; } +.ri-calendar-2-fill:before { content: "\eaeb"; } +.ri-calendar-2-line:before { content: "\eaec"; } +.ri-calendar-check-fill:before { content: "\eaed"; } +.ri-calendar-check-line:before { content: "\eaee"; } +.ri-calendar-event-fill:before { content: "\eaef"; } +.ri-calendar-event-line:before { content: "\eaf0"; } +.ri-calendar-fill:before { content: "\eaf1"; } +.ri-calendar-line:before { content: "\eaf2"; } +.ri-calendar-todo-fill:before { content: "\eaf3"; } +.ri-calendar-todo-line:before { content: "\eaf4"; } +.ri-camera-2-fill:before { content: "\eaf5"; } +.ri-camera-2-line:before { content: "\eaf6"; } +.ri-camera-3-fill:before { content: "\eaf7"; } +.ri-camera-3-line:before { content: "\eaf8"; } +.ri-camera-fill:before { content: "\eaf9"; } +.ri-camera-lens-fill:before { content: "\eafa"; } +.ri-camera-lens-line:before { content: "\eafb"; } +.ri-camera-line:before { content: "\eafc"; } +.ri-camera-off-fill:before { content: "\eafd"; } +.ri-camera-off-line:before { content: "\eafe"; } +.ri-camera-switch-fill:before { content: "\eaff"; } +.ri-camera-switch-line:before { content: "\eb00"; } +.ri-car-fill:before { content: "\eb01"; } +.ri-car-line:before { content: "\eb02"; } +.ri-car-washing-fill:before { content: "\eb03"; } +.ri-car-washing-line:before { content: "\eb04"; } +.ri-cast-fill:before { content: "\eb05"; } +.ri-cast-line:before { content: "\eb06"; } +.ri-cellphone-fill:before { content: "\eb07"; } +.ri-cellphone-line:before { content: "\eb08"; } +.ri-celsius-fill:before { content: "\eb09"; } +.ri-celsius-line:before { content: "\eb0a"; } +.ri-charging-pile-2-fill:before { content: "\eb0b"; } +.ri-charging-pile-2-line:before { content: "\eb0c"; } +.ri-charging-pile-fill:before { content: "\eb0d"; } +.ri-charging-pile-line:before { content: "\eb0e"; } +.ri-chat-1-fill:before { content: "\eb0f"; } +.ri-chat-1-line:before { content: "\eb10"; } +.ri-chat-2-fill:before { content: "\eb11"; } +.ri-chat-2-line:before { content: "\eb12"; } +.ri-chat-3-fill:before { content: "\eb13"; } +.ri-chat-3-line:before { content: "\eb14"; } +.ri-chat-4-fill:before { content: "\eb15"; } +.ri-chat-4-line:before { content: "\eb16"; } +.ri-chat-check-fill:before { content: "\eb17"; } +.ri-chat-check-line:before { content: "\eb18"; } +.ri-chat-delete-fill:before { content: "\eb19"; } +.ri-chat-delete-line:before { content: "\eb1a"; } +.ri-chat-download-fill:before { content: "\eb1b"; } +.ri-chat-download-line:before { content: "\eb1c"; } +.ri-chat-forward-fill:before { content: "\eb1d"; } +.ri-chat-forward-line:before { content: "\eb1e"; } +.ri-chat-heart-fill:before { content: "\eb1f"; } +.ri-chat-heart-line:before { content: "\eb20"; } +.ri-chat-new-fill:before { content: "\eb21"; } +.ri-chat-new-line:before { content: "\eb22"; } +.ri-chat-off-fill:before { content: "\eb23"; } +.ri-chat-off-line:before { content: "\eb24"; } +.ri-chat-settings-fill:before { content: "\eb25"; } +.ri-chat-settings-line:before { content: "\eb26"; } +.ri-chat-smile-2-fill:before { content: "\eb27"; } +.ri-chat-smile-2-line:before { content: "\eb28"; } +.ri-chat-smile-3-fill:before { content: "\eb29"; } +.ri-chat-smile-3-line:before { content: "\eb2a"; } +.ri-chat-smile-fill:before { content: "\eb2b"; } +.ri-chat-smile-line:before { content: "\eb2c"; } +.ri-chat-upload-fill:before { content: "\eb2d"; } +.ri-chat-upload-line:before { content: "\eb2e"; } +.ri-chat-voice-fill:before { content: "\eb2f"; } +.ri-chat-voice-line:before { content: "\eb30"; } +.ri-check-double-fill:before { content: "\eb31"; } +.ri-check-double-line:before { content: "\eb32"; } +.ri-check-fill:before { content: "\eb33"; } +.ri-check-line:before { content: "\eb34"; } +.ri-checkbox-blank-circle-fill:before { content: "\eb35"; } +.ri-checkbox-blank-circle-line:before { content: "\eb36"; } +.ri-checkbox-blank-fill:before { content: "\eb37"; } +.ri-checkbox-blank-line:before { content: "\eb38"; } +.ri-checkbox-circle-fill:before { content: "\eb39"; } +.ri-checkbox-circle-line:before { content: "\eb3a"; } +.ri-checkbox-fill:before { content: "\eb3b"; } +.ri-checkbox-indeterminate-fill:before { content: "\eb3c"; } +.ri-checkbox-indeterminate-line:before { content: "\eb3d"; } +.ri-checkbox-line:before { content: "\eb3e"; } +.ri-checkbox-multiple-blank-fill:before { content: "\eb3f"; } +.ri-checkbox-multiple-blank-line:before { content: "\eb40"; } +.ri-checkbox-multiple-fill:before { content: "\eb41"; } +.ri-checkbox-multiple-line:before { content: "\eb42"; } +.ri-china-railway-fill:before { content: "\eb43"; } +.ri-china-railway-line:before { content: "\eb44"; } +.ri-chrome-fill:before { content: "\eb45"; } +.ri-chrome-line:before { content: "\eb46"; } +.ri-clapperboard-fill:before { content: "\eb47"; } +.ri-clapperboard-line:before { content: "\eb48"; } +.ri-clipboard-fill:before { content: "\eb49"; } +.ri-clipboard-line:before { content: "\eb4a"; } +.ri-clockwise-2-fill:before { content: "\eb4b"; } +.ri-clockwise-2-line:before { content: "\eb4c"; } +.ri-clockwise-fill:before { content: "\eb4d"; } +.ri-clockwise-line:before { content: "\eb4e"; } +.ri-close-circle-fill:before { content: "\eb4f"; } +.ri-close-circle-line:before { content: "\eb50"; } +.ri-close-fill:before { content: "\eb51"; } +.ri-close-line:before { content: "\eb52"; } +.ri-cloud-fill:before { content: "\eb53"; } +.ri-cloud-line:before { content: "\eb54"; } +.ri-cloud-off-fill:before { content: "\eb55"; } +.ri-cloud-off-line:before { content: "\eb56"; } +.ri-cloud-windy-fill:before { content: "\eb57"; } +.ri-cloud-windy-line:before { content: "\eb58"; } +.ri-cloudy-2-fill:before { content: "\eb59"; } +.ri-cloudy-2-line:before { content: "\eb5a"; } +.ri-cloudy-fill:before { content: "\eb5b"; } +.ri-cloudy-line:before { content: "\eb5c"; } +.ri-code-box-fill:before { content: "\eb5d"; } +.ri-code-box-line:before { content: "\eb5e"; } +.ri-code-fill:before { content: "\eb5f"; } +.ri-code-line:before { content: "\eb60"; } +.ri-code-s-fill:before { content: "\eb61"; } +.ri-code-s-line:before { content: "\eb62"; } +.ri-code-s-slash-fill:before { content: "\eb63"; } +.ri-code-s-slash-line:before { content: "\eb64"; } +.ri-code-view:before { content: "\eb65"; } +.ri-codepen-fill:before { content: "\eb66"; } +.ri-codepen-line:before { content: "\eb67"; } +.ri-command-fill:before { content: "\eb68"; } +.ri-command-line:before { content: "\eb69"; } +.ri-community-fill:before { content: "\eb6a"; } +.ri-community-line:before { content: "\eb6b"; } +.ri-compass-2-fill:before { content: "\eb6c"; } +.ri-compass-2-line:before { content: "\eb6d"; } +.ri-compass-3-fill:before { content: "\eb6e"; } +.ri-compass-3-line:before { content: "\eb6f"; } +.ri-compass-4-fill:before { content: "\eb70"; } +.ri-compass-4-line:before { content: "\eb71"; } +.ri-compass-discover-fill:before { content: "\eb72"; } +.ri-compass-discover-line:before { content: "\eb73"; } +.ri-compass-fill:before { content: "\eb74"; } +.ri-compass-line:before { content: "\eb75"; } +.ri-compasses-2-fill:before { content: "\eb76"; } +.ri-compasses-2-line:before { content: "\eb77"; } +.ri-compasses-fill:before { content: "\eb78"; } +.ri-compasses-line:before { content: "\eb79"; } +.ri-computer-fill:before { content: "\eb7a"; } +.ri-computer-line:before { content: "\eb7b"; } +.ri-contacts-book-2-fill:before { content: "\eb7c"; } +.ri-contacts-book-2-line:before { content: "\eb7d"; } +.ri-contacts-book-fill:before { content: "\eb7e"; } +.ri-contacts-book-line:before { content: "\eb7f"; } +.ri-contacts-fill:before { content: "\eb80"; } +.ri-contacts-line:before { content: "\eb81"; } +.ri-contrast-2-fill:before { content: "\eb82"; } +.ri-contrast-2-line:before { content: "\eb83"; } +.ri-contrast-drop-2-fill:before { content: "\eb84"; } +.ri-contrast-drop-2-line:before { content: "\eb85"; } +.ri-contrast-drop-fill:before { content: "\eb86"; } +.ri-contrast-drop-line:before { content: "\eb87"; } +.ri-contrast-fill:before { content: "\eb88"; } +.ri-contrast-line:before { content: "\eb89"; } +.ri-copper-coin-fill:before { content: "\eb8a"; } +.ri-copper-coin-line:before { content: "\eb8b"; } +.ri-copper-diamond-fill:before { content: "\eb8c"; } +.ri-copper-diamond-line:before { content: "\eb8d"; } +.ri-copyright-fill:before { content: "\eb8e"; } +.ri-copyright-line:before { content: "\eb8f"; } +.ri-coreos-fill:before { content: "\eb90"; } +.ri-coreos-line:before { content: "\eb91"; } +.ri-coupon-2-fill:before { content: "\eb92"; } +.ri-coupon-2-line:before { content: "\eb93"; } +.ri-coupon-3-fill:before { content: "\eb94"; } +.ri-coupon-3-line:before { content: "\eb95"; } +.ri-coupon-4-fill:before { content: "\eb96"; } +.ri-coupon-4-line:before { content: "\eb97"; } +.ri-coupon-5-fill:before { content: "\eb98"; } +.ri-coupon-5-line:before { content: "\eb99"; } +.ri-coupon-fill:before { content: "\eb9a"; } +.ri-coupon-line:before { content: "\eb9b"; } +.ri-cpu-fill:before { content: "\eb9c"; } +.ri-cpu-line:before { content: "\eb9d"; } +.ri-crop-2-fill:before { content: "\eb9e"; } +.ri-crop-2-line:before { content: "\eb9f"; } +.ri-crop-fill:before { content: "\eba0"; } +.ri-crop-line:before { content: "\eba1"; } +.ri-css3-fill:before { content: "\eba2"; } +.ri-css3-line:before { content: "\eba3"; } +.ri-cup-fill:before { content: "\eba4"; } +.ri-cup-line:before { content: "\eba5"; } +.ri-currency-fill:before { content: "\eba6"; } +.ri-currency-line:before { content: "\eba7"; } +.ri-cursor-fill:before { content: "\eba8"; } +.ri-cursor-line:before { content: "\eba9"; } +.ri-customer-service-2-fill:before { content: "\ebaa"; } +.ri-customer-service-2-line:before { content: "\ebab"; } +.ri-customer-service-fill:before { content: "\ebac"; } +.ri-customer-service-line:before { content: "\ebad"; } +.ri-dashboard-fill:before { content: "\ebae"; } +.ri-dashboard-line:before { content: "\ebaf"; } +.ri-database-2-fill:before { content: "\ebb0"; } +.ri-database-2-line:before { content: "\ebb1"; } +.ri-database-fill:before { content: "\ebb2"; } +.ri-database-line:before { content: "\ebb3"; } +.ri-delete-back-2-fill:before { content: "\ebb4"; } +.ri-delete-back-2-line:before { content: "\ebb5"; } +.ri-delete-back-fill:before { content: "\ebb6"; } +.ri-delete-back-line:before { content: "\ebb7"; } +.ri-delete-bin-2-fill:before { content: "\ebb8"; } +.ri-delete-bin-2-line:before { content: "\ebb9"; } +.ri-delete-bin-3-fill:before { content: "\ebba"; } +.ri-delete-bin-3-line:before { content: "\ebbb"; } +.ri-delete-bin-4-fill:before { content: "\ebbc"; } +.ri-delete-bin-4-line:before { content: "\ebbd"; } +.ri-delete-bin-5-fill:before { content: "\ebbe"; } +.ri-delete-bin-5-line:before { content: "\ebbf"; } +.ri-delete-bin-6-fill:before { content: "\ebc0"; } +.ri-delete-bin-6-line:before { content: "\ebc1"; } +.ri-delete-bin-7-fill:before { content: "\ebc2"; } +.ri-delete-bin-7-line:before { content: "\ebc3"; } +.ri-delete-bin-fill:before { content: "\ebc4"; } +.ri-delete-bin-line:before { content: "\ebc5"; } +.ri-device-fill:before { content: "\ebc6"; } +.ri-device-line:before { content: "\ebc7"; } +.ri-dingding-fill:before { content: "\ebc8"; } +.ri-dingding-line:before { content: "\ebc9"; } +.ri-direction-fill:before { content: "\ebca"; } +.ri-direction-line:before { content: "\ebcb"; } +.ri-disc-fill:before { content: "\ebcc"; } +.ri-disc-line:before { content: "\ebcd"; } +.ri-discord-fill:before { content: "\ebce"; } +.ri-discord-line:before { content: "\ebcf"; } +.ri-discuss-fill:before { content: "\ebd0"; } +.ri-discuss-line:before { content: "\ebd1"; } +.ri-divide-fill:before { content: "\ebd2"; } +.ri-divide-line:before { content: "\ebd3"; } +.ri-door-lock-box-fill:before { content: "\ebd4"; } +.ri-door-lock-box-line:before { content: "\ebd5"; } +.ri-door-lock-fill:before { content: "\ebd6"; } +.ri-door-lock-line:before { content: "\ebd7"; } +.ri-douban-fill:before { content: "\ebd8"; } +.ri-douban-line:before { content: "\ebd9"; } +.ri-double-quotes-l:before { content: "\ebda"; } +.ri-double-quotes-r:before { content: "\ebdb"; } +.ri-download-2-fill:before { content: "\ebdc"; } +.ri-download-2-line:before { content: "\ebdd"; } +.ri-download-cloud-2-fill:before { content: "\ebde"; } +.ri-download-cloud-2-line:before { content: "\ebdf"; } +.ri-download-cloud-fill:before { content: "\ebe0"; } +.ri-download-cloud-line:before { content: "\ebe1"; } +.ri-download-fill:before { content: "\ebe2"; } +.ri-download-line:before { content: "\ebe3"; } +.ri-drag-move-2-fill:before { content: "\ebe4"; } +.ri-drag-move-2-line:before { content: "\ebe5"; } +.ri-drag-move-fill:before { content: "\ebe6"; } +.ri-drag-move-line:before { content: "\ebe7"; } +.ri-dribbble-fill:before { content: "\ebe8"; } +.ri-dribbble-line:before { content: "\ebe9"; } +.ri-drive-fill:before { content: "\ebea"; } +.ri-drive-line:before { content: "\ebeb"; } +.ri-drizzle-fill:before { content: "\ebec"; } +.ri-drizzle-line:before { content: "\ebed"; } +.ri-drop-fill:before { content: "\ebee"; } +.ri-drop-line:before { content: "\ebef"; } +.ri-dropbox-fill:before { content: "\ebf0"; } +.ri-dropbox-line:before { content: "\ebf1"; } +.ri-dv-fill:before { content: "\ebf2"; } +.ri-dv-line:before { content: "\ebf3"; } +.ri-dvd-fill:before { content: "\ebf4"; } +.ri-dvd-line:before { content: "\ebf5"; } +.ri-e-bike-2-fill:before { content: "\ebf6"; } +.ri-e-bike-2-line:before { content: "\ebf7"; } +.ri-e-bike-fill:before { content: "\ebf8"; } +.ri-e-bike-line:before { content: "\ebf9"; } +.ri-earth-fill:before { content: "\ebfa"; } +.ri-earth-line:before { content: "\ebfb"; } +.ri-edge-fill:before { content: "\ebfc"; } +.ri-edge-line:before { content: "\ebfd"; } +.ri-edit-2-fill:before { content: "\ebfe"; } +.ri-edit-2-line:before { content: "\ebff"; } +.ri-edit-box-fill:before { content: "\ec00"; } +.ri-edit-box-line:before { content: "\ec01"; } +.ri-edit-circle-fill:before { content: "\ec02"; } +.ri-edit-circle-line:before { content: "\ec03"; } +.ri-edit-fill:before { content: "\ec04"; } +.ri-edit-line:before { content: "\ec05"; } +.ri-eject-fill:before { content: "\ec06"; } +.ri-eject-line:before { content: "\ec07"; } +.ri-emotion-2-fill:before { content: "\ec08"; } +.ri-emotion-2-line:before { content: "\ec09"; } +.ri-emotion-fill:before { content: "\ec0a"; } +.ri-emotion-happy-fill:before { content: "\ec0b"; } +.ri-emotion-happy-line:before { content: "\ec0c"; } +.ri-emotion-line:before { content: "\ec0d"; } +.ri-emotion-normal-fill:before { content: "\ec0e"; } +.ri-emotion-normal-line:before { content: "\ec0f"; } +.ri-emotion-unhappy-fill:before { content: "\ec10"; } +.ri-emotion-unhappy-line:before { content: "\ec11"; } +.ri-emphasis:before { content: "\ec12"; } +.ri-equalizer-fill:before { content: "\ec13"; } +.ri-equalizer-line:before { content: "\ec14"; } +.ri-eraser-fill:before { content: "\ec15"; } +.ri-eraser-line:before { content: "\ec16"; } +.ri-error-warning-fill:before { content: "\ec17"; } +.ri-error-warning-line:before { content: "\ec18"; } +.ri-evernote-fill:before { content: "\ec19"; } +.ri-evernote-line:before { content: "\ec1a"; } +.ri-exchange-box-fill:before { content: "\ec1b"; } +.ri-exchange-box-line:before { content: "\ec1c"; } +.ri-exchange-cny-fill:before { content: "\ec1d"; } +.ri-exchange-cny-line:before { content: "\ec1e"; } +.ri-exchange-dollar-fill:before { content: "\ec1f"; } +.ri-exchange-dollar-line:before { content: "\ec20"; } +.ri-exchange-fill:before { content: "\ec21"; } +.ri-exchange-funds-fill:before { content: "\ec22"; } +.ri-exchange-funds-line:before { content: "\ec23"; } +.ri-exchange-line:before { content: "\ec24"; } +.ri-external-link-fill:before { content: "\ec25"; } +.ri-external-link-line:before { content: "\ec26"; } +.ri-eye-close-fill:before { content: "\ec27"; } +.ri-eye-close-line:before { content: "\ec28"; } +.ri-eye-fill:before { content: "\ec29"; } +.ri-eye-line:before { content: "\ec2a"; } +.ri-eye-off-fill:before { content: "\ec2b"; } +.ri-eye-off-line:before { content: "\ec2c"; } +.ri-facebook-box-fill:before { content: "\ec2d"; } +.ri-facebook-box-line:before { content: "\ec2e"; } +.ri-facebook-circle-fill:before { content: "\ec2f"; } +.ri-facebook-circle-line:before { content: "\ec30"; } +.ri-facebook-fill:before { content: "\ec31"; } +.ri-facebook-line:before { content: "\ec32"; } +.ri-fahrenheit-fill:before { content: "\ec33"; } +.ri-fahrenheit-line:before { content: "\ec34"; } +.ri-feedback-fill:before { content: "\ec35"; } +.ri-feedback-line:before { content: "\ec36"; } +.ri-file-2-fill:before { content: "\ec37"; } +.ri-file-2-line:before { content: "\ec38"; } +.ri-file-3-fill:before { content: "\ec39"; } +.ri-file-3-line:before { content: "\ec3a"; } +.ri-file-4-fill:before { content: "\ec3b"; } +.ri-file-4-line:before { content: "\ec3c"; } +.ri-file-add-fill:before { content: "\ec3d"; } +.ri-file-add-line:before { content: "\ec3e"; } +.ri-file-chart-2-fill:before { content: "\ec3f"; } +.ri-file-chart-2-line:before { content: "\ec40"; } +.ri-file-chart-fill:before { content: "\ec41"; } +.ri-file-chart-line:before { content: "\ec42"; } +.ri-file-code-fill:before { content: "\ec43"; } +.ri-file-code-line:before { content: "\ec44"; } +.ri-file-copy-2-fill:before { content: "\ec45"; } +.ri-file-copy-2-line:before { content: "\ec46"; } +.ri-file-copy-fill:before { content: "\ec47"; } +.ri-file-copy-line:before { content: "\ec48"; } +.ri-file-damage-fill:before { content: "\ec49"; } +.ri-file-damage-line:before { content: "\ec4a"; } +.ri-file-download-fill:before { content: "\ec4b"; } +.ri-file-download-line:before { content: "\ec4c"; } +.ri-file-edit-fill:before { content: "\ec4d"; } +.ri-file-edit-line:before { content: "\ec4e"; } +.ri-file-excel-2-fill:before { content: "\ec4f"; } +.ri-file-excel-2-line:before { content: "\ec50"; } +.ri-file-excel-fill:before { content: "\ec51"; } +.ri-file-excel-line:before { content: "\ec52"; } +.ri-file-fill:before { content: "\ec53"; } +.ri-file-forbid-fill:before { content: "\ec54"; } +.ri-file-forbid-line:before { content: "\ec55"; } +.ri-file-info-fill:before { content: "\ec56"; } +.ri-file-info-line:before { content: "\ec57"; } +.ri-file-line:before { content: "\ec58"; } +.ri-file-list-2-fill:before { content: "\ec59"; } +.ri-file-list-2-line:before { content: "\ec5a"; } +.ri-file-list-3-fill:before { content: "\ec5b"; } +.ri-file-list-3-line:before { content: "\ec5c"; } +.ri-file-list-fill:before { content: "\ec5d"; } +.ri-file-list-line:before { content: "\ec5e"; } +.ri-file-lock-fill:before { content: "\ec5f"; } +.ri-file-lock-line:before { content: "\ec60"; } +.ri-file-mark-fill:before { content: "\ec61"; } +.ri-file-mark-line:before { content: "\ec62"; } +.ri-file-music-fill:before { content: "\ec63"; } +.ri-file-music-line:before { content: "\ec64"; } +.ri-file-paper-fill:before { content: "\ec65"; } +.ri-file-paper-line:before { content: "\ec66"; } +.ri-file-pdf-fill:before { content: "\ec67"; } +.ri-file-pdf-line:before { content: "\ec68"; } +.ri-file-ppt-2-fill:before { content: "\ec69"; } +.ri-file-ppt-2-line:before { content: "\ec6a"; } +.ri-file-ppt-fill:before { content: "\ec6b"; } +.ri-file-ppt-line:before { content: "\ec6c"; } +.ri-file-reduce-fill:before { content: "\ec6d"; } +.ri-file-reduce-line:before { content: "\ec6e"; } +.ri-file-search-fill:before { content: "\ec6f"; } +.ri-file-search-line:before { content: "\ec70"; } +.ri-file-settings-fill:before { content: "\ec71"; } +.ri-file-settings-line:before { content: "\ec72"; } +.ri-file-shield-2-fill:before { content: "\ec73"; } +.ri-file-shield-2-line:before { content: "\ec74"; } +.ri-file-shield-fill:before { content: "\ec75"; } +.ri-file-shield-line:before { content: "\ec76"; } +.ri-file-shred-fill:before { content: "\ec77"; } +.ri-file-shred-line:before { content: "\ec78"; } +.ri-file-text-fill:before { content: "\ec79"; } +.ri-file-text-line:before { content: "\ec7a"; } +.ri-file-transfer-fill:before { content: "\ec7b"; } +.ri-file-transfer-line:before { content: "\ec7c"; } +.ri-file-unknow-fill:before { content: "\ec7d"; } +.ri-file-unknow-line:before { content: "\ec7e"; } +.ri-file-upload-fill:before { content: "\ec7f"; } +.ri-file-upload-line:before { content: "\ec80"; } +.ri-file-user-fill:before { content: "\ec81"; } +.ri-file-user-line:before { content: "\ec82"; } +.ri-file-warning-fill:before { content: "\ec83"; } +.ri-file-warning-line:before { content: "\ec84"; } +.ri-file-word-2-fill:before { content: "\ec85"; } +.ri-file-word-2-line:before { content: "\ec86"; } +.ri-file-word-fill:before { content: "\ec87"; } +.ri-file-word-line:before { content: "\ec88"; } +.ri-file-zip-fill:before { content: "\ec89"; } +.ri-file-zip-line:before { content: "\ec8a"; } +.ri-film-fill:before { content: "\ec8b"; } +.ri-film-line:before { content: "\ec8c"; } +.ri-filter-2-fill:before { content: "\ec8d"; } +.ri-filter-2-line:before { content: "\ec8e"; } +.ri-filter-3-fill:before { content: "\ec8f"; } +.ri-filter-3-line:before { content: "\ec90"; } +.ri-filter-fill:before { content: "\ec91"; } +.ri-filter-line:before { content: "\ec92"; } +.ri-find-replace-fill:before { content: "\ec93"; } +.ri-find-replace-line:before { content: "\ec94"; } +.ri-fingerprint-2-fill:before { content: "\ec95"; } +.ri-fingerprint-2-line:before { content: "\ec96"; } +.ri-fingerprint-fill:before { content: "\ec97"; } +.ri-fingerprint-line:before { content: "\ec98"; } +.ri-fire-fill:before { content: "\ec99"; } +.ri-fire-line:before { content: "\ec9a"; } +.ri-firefox-fill:before { content: "\ec9b"; } +.ri-firefox-line:before { content: "\ec9c"; } +.ri-flag-2-fill:before { content: "\ec9d"; } +.ri-flag-2-line:before { content: "\ec9e"; } +.ri-flag-fill:before { content: "\ec9f"; } +.ri-flag-line:before { content: "\eca0"; } +.ri-flashlight-fill:before { content: "\eca1"; } +.ri-flashlight-line:before { content: "\eca2"; } +.ri-flight-land-fill:before { content: "\eca3"; } +.ri-flight-land-line:before { content: "\eca4"; } +.ri-flight-takeoff-fill:before { content: "\eca5"; } +.ri-flight-takeoff-line:before { content: "\eca6"; } +.ri-focus-2-fill:before { content: "\eca7"; } +.ri-focus-2-line:before { content: "\eca8"; } +.ri-focus-fill:before { content: "\eca9"; } +.ri-focus-line:before { content: "\ecaa"; } +.ri-foggy-fill:before { content: "\ecab"; } +.ri-foggy-line:before { content: "\ecac"; } +.ri-folder-2-fill:before { content: "\ecad"; } +.ri-folder-2-line:before { content: "\ecae"; } +.ri-folder-3-fill:before { content: "\ecaf"; } +.ri-folder-3-line:before { content: "\ecb0"; } +.ri-folder-4-fill:before { content: "\ecb1"; } +.ri-folder-4-line:before { content: "\ecb2"; } +.ri-folder-5-fill:before { content: "\ecb3"; } +.ri-folder-5-line:before { content: "\ecb4"; } +.ri-folder-add-fill:before { content: "\ecb5"; } +.ri-folder-add-line:before { content: "\ecb6"; } +.ri-folder-chart-2-fill:before { content: "\ecb7"; } +.ri-folder-chart-2-line:before { content: "\ecb8"; } +.ri-folder-chart-fill:before { content: "\ecb9"; } +.ri-folder-chart-line:before { content: "\ecba"; } +.ri-folder-download-fill:before { content: "\ecbb"; } +.ri-folder-download-line:before { content: "\ecbc"; } +.ri-folder-fill:before { content: "\ecbd"; } +.ri-folder-forbid-fill:before { content: "\ecbe"; } +.ri-folder-forbid-line:before { content: "\ecbf"; } +.ri-folder-info-fill:before { content: "\ecc0"; } +.ri-folder-info-line:before { content: "\ecc1"; } +.ri-folder-line:before { content: "\ecc2"; } +.ri-folder-lock-fill:before { content: "\ecc3"; } +.ri-folder-lock-line:before { content: "\ecc4"; } +.ri-folder-music-fill:before { content: "\ecc5"; } +.ri-folder-music-line:before { content: "\ecc6"; } +.ri-folder-open-fill:before { content: "\ecc7"; } +.ri-folder-open-line:before { content: "\ecc8"; } +.ri-folder-received-fill:before { content: "\ecc9"; } +.ri-folder-received-line:before { content: "\ecca"; } +.ri-folder-reduce-fill:before { content: "\eccb"; } +.ri-folder-reduce-line:before { content: "\eccc"; } +.ri-folder-settings-fill:before { content: "\eccd"; } +.ri-folder-settings-line:before { content: "\ecce"; } +.ri-folder-shared-fill:before { content: "\eccf"; } +.ri-folder-shared-line:before { content: "\ecd0"; } +.ri-folder-shield-2-fill:before { content: "\ecd1"; } +.ri-folder-shield-2-line:before { content: "\ecd2"; } +.ri-folder-shield-fill:before { content: "\ecd3"; } +.ri-folder-shield-line:before { content: "\ecd4"; } +.ri-folder-transfer-fill:before { content: "\ecd5"; } +.ri-folder-transfer-line:before { content: "\ecd6"; } +.ri-folder-unknow-fill:before { content: "\ecd7"; } +.ri-folder-unknow-line:before { content: "\ecd8"; } +.ri-folder-upload-fill:before { content: "\ecd9"; } +.ri-folder-upload-line:before { content: "\ecda"; } +.ri-folder-user-fill:before { content: "\ecdb"; } +.ri-folder-user-line:before { content: "\ecdc"; } +.ri-folder-warning-fill:before { content: "\ecdd"; } +.ri-folder-warning-line:before { content: "\ecde"; } +.ri-folders-fill:before { content: "\ecdf"; } +.ri-folders-line:before { content: "\ece0"; } +.ri-font-color:before { content: "\ece1"; } +.ri-font-size-2:before { content: "\ece2"; } +.ri-font-size:before { content: "\ece3"; } +.ri-footprint-fill:before { content: "\ece4"; } +.ri-footprint-line:before { content: "\ece5"; } +.ri-forbid-2-fill:before { content: "\ece6"; } +.ri-forbid-2-line:before { content: "\ece7"; } +.ri-forbid-fill:before { content: "\ece8"; } +.ri-forbid-line:before { content: "\ece9"; } +.ri-format-clear:before { content: "\ecea"; } +.ri-fullscreen-exit-fill:before { content: "\eceb"; } +.ri-fullscreen-exit-line:before { content: "\ecec"; } +.ri-fullscreen-fill:before { content: "\eced"; } +.ri-fullscreen-line:before { content: "\ecee"; } +.ri-function-fill:before { content: "\ecef"; } +.ri-function-line:before { content: "\ecf0"; } +.ri-functions:before { content: "\ecf1"; } +.ri-funds-box-fill:before { content: "\ecf2"; } +.ri-funds-box-line:before { content: "\ecf3"; } +.ri-funds-fill:before { content: "\ecf4"; } +.ri-funds-line:before { content: "\ecf5"; } +.ri-gallery-fill:before { content: "\ecf6"; } +.ri-gallery-line:before { content: "\ecf7"; } +.ri-gas-station-fill:before { content: "\ecf8"; } +.ri-gas-station-line:before { content: "\ecf9"; } +.ri-genderless-fill:before { content: "\ecfa"; } +.ri-genderless-line:before { content: "\ecfb"; } +.ri-git-branch-fill:before { content: "\ecfc"; } +.ri-git-branch-line:before { content: "\ecfd"; } +.ri-git-commit-fill:before { content: "\ecfe"; } +.ri-git-commit-line:before { content: "\ecff"; } +.ri-git-merge-fill:before { content: "\ed00"; } +.ri-git-merge-line:before { content: "\ed01"; } +.ri-git-pull-request-fill:before { content: "\ed02"; } +.ri-git-pull-request-line:before { content: "\ed03"; } +.ri-git-repository-commits-fill:before { content: "\ed04"; } +.ri-git-repository-commits-line:before { content: "\ed05"; } +.ri-git-repository-fill:before { content: "\ed06"; } +.ri-git-repository-line:before { content: "\ed07"; } +.ri-git-repository-private-fill:before { content: "\ed08"; } +.ri-git-repository-private-line:before { content: "\ed09"; } +.ri-github-fill:before { content: "\ed0a"; } +.ri-github-line:before { content: "\ed0b"; } +.ri-gitlab-fill:before { content: "\ed0c"; } +.ri-gitlab-line:before { content: "\ed0d"; } +.ri-global-fill:before { content: "\ed0e"; } +.ri-global-line:before { content: "\ed0f"; } +.ri-globe-fill:before { content: "\ed10"; } +.ri-globe-line:before { content: "\ed11"; } +.ri-goblet-fill:before { content: "\ed12"; } +.ri-goblet-line:before { content: "\ed13"; } +.ri-google-fill:before { content: "\ed14"; } +.ri-google-line:before { content: "\ed15"; } +.ri-government-fill:before { content: "\ed16"; } +.ri-government-line:before { content: "\ed17"; } +.ri-gps-fill:before { content: "\ed18"; } +.ri-gps-line:before { content: "\ed19"; } +.ri-gradienter-fill:before { content: "\ed1a"; } +.ri-gradienter-line:before { content: "\ed1b"; } +.ri-grid-fill:before { content: "\ed1c"; } +.ri-grid-line:before { content: "\ed1d"; } +.ri-group-2-fill:before { content: "\ed1e"; } +.ri-group-2-line:before { content: "\ed1f"; } +.ri-group-fill:before { content: "\ed20"; } +.ri-group-line:before { content: "\ed21"; } +.ri-guide-fill:before { content: "\ed22"; } +.ri-guide-line:before { content: "\ed23"; } +.ri-hail-fill:before { content: "\ed24"; } +.ri-hail-line:before { content: "\ed25"; } +.ri-hammer-fill:before { content: "\ed26"; } +.ri-hammer-line:before { content: "\ed27"; } +.ri-hard-drive-2-fill:before { content: "\ed28"; } +.ri-hard-drive-2-line:before { content: "\ed29"; } +.ri-hard-drive-fill:before { content: "\ed2a"; } +.ri-hard-drive-line:before { content: "\ed2b"; } +.ri-hashtag:before { content: "\ed2c"; } +.ri-haze-fill:before { content: "\ed2d"; } +.ri-haze-line:before { content: "\ed2e"; } +.ri-hd-fill:before { content: "\ed2f"; } +.ri-hd-line:before { content: "\ed30"; } +.ri-heading:before { content: "\ed31"; } +.ri-headphone-fill:before { content: "\ed32"; } +.ri-headphone-line:before { content: "\ed33"; } +.ri-heart-2-fill:before { content: "\ed34"; } +.ri-heart-2-line:before { content: "\ed35"; } +.ri-heart-fill:before { content: "\ed36"; } +.ri-heart-line:before { content: "\ed37"; } +.ri-heavy-showers-fill:before { content: "\ed38"; } +.ri-heavy-showers-line:before { content: "\ed39"; } +.ri-home-2-fill:before { content: "\ed3a"; } +.ri-home-2-line:before { content: "\ed3b"; } +.ri-home-3-fill:before { content: "\ed3c"; } +.ri-home-3-line:before { content: "\ed3d"; } +.ri-home-4-fill:before { content: "\ed3e"; } +.ri-home-4-line:before { content: "\ed3f"; } +.ri-home-5-fill:before { content: "\ed40"; } +.ri-home-5-line:before { content: "\ed41"; } +.ri-home-6-fill:before { content: "\ed42"; } +.ri-home-6-line:before { content: "\ed43"; } +.ri-home-7-fill:before { content: "\ed44"; } +.ri-home-7-line:before { content: "\ed45"; } +.ri-home-8-fill:before { content: "\ed46"; } +.ri-home-8-line:before { content: "\ed47"; } +.ri-home-fill:before { content: "\ed48"; } +.ri-home-gear-fill:before { content: "\ed49"; } +.ri-home-gear-line:before { content: "\ed4a"; } +.ri-home-heart-fill:before { content: "\ed4b"; } +.ri-home-heart-line:before { content: "\ed4c"; } +.ri-home-line:before { content: "\ed4d"; } +.ri-home-smile-2-fill:before { content: "\ed4e"; } +.ri-home-smile-2-line:before { content: "\ed4f"; } +.ri-home-smile-fill:before { content: "\ed50"; } +.ri-home-smile-line:before { content: "\ed51"; } +.ri-home-wifi-fill:before { content: "\ed52"; } +.ri-home-wifi-line:before { content: "\ed53"; } +.ri-honour-fill:before { content: "\ed54"; } +.ri-honour-line:before { content: "\ed55"; } +.ri-hospital-fill:before { content: "\ed56"; } +.ri-hospital-line:before { content: "\ed57"; } +.ri-hotel-bed-fill:before { content: "\ed58"; } +.ri-hotel-bed-line:before { content: "\ed59"; } +.ri-hotel-fill:before { content: "\ed5a"; } +.ri-hotel-line:before { content: "\ed5b"; } +.ri-hq-fill:before { content: "\ed5c"; } +.ri-hq-line:before { content: "\ed5d"; } +.ri-html5-fill:before { content: "\ed5e"; } +.ri-html5-line:before { content: "\ed5f"; } +.ri-ie-fill:before { content: "\ed60"; } +.ri-ie-line:before { content: "\ed61"; } +.ri-image-2-fill:before { content: "\ed62"; } +.ri-image-2-line:before { content: "\ed63"; } +.ri-image-fill:before { content: "\ed64"; } +.ri-image-line:before { content: "\ed65"; } +.ri-inbox-archive-fill:before { content: "\ed66"; } +.ri-inbox-archive-line:before { content: "\ed67"; } +.ri-inbox-fill:before { content: "\ed68"; } +.ri-inbox-line:before { content: "\ed69"; } +.ri-increase-decrease-fill:before { content: "\ed6a"; } +.ri-increase-decrease-line:before { content: "\ed6b"; } +.ri-indent-decrease:before { content: "\ed6c"; } +.ri-indent-increase:before { content: "\ed6d"; } +.ri-indeterminate-circle-fill:before { content: "\ed6e"; } +.ri-indeterminate-circle-line:before { content: "\ed6f"; } +.ri-information-fill:before { content: "\ed70"; } +.ri-information-line:before { content: "\ed71"; } +.ri-input-method-fill:before { content: "\ed72"; } +.ri-input-method-line:before { content: "\ed73"; } +.ri-instagram-fill:before { content: "\ed74"; } +.ri-instagram-line:before { content: "\ed75"; } +.ri-invision-fill:before { content: "\ed76"; } +.ri-invision-line:before { content: "\ed77"; } +.ri-italic:before { content: "\ed78"; } +.ri-kakao-talk-fill:before { content: "\ed79"; } +.ri-kakao-talk-line:before { content: "\ed7a"; } +.ri-key-2-fill:before { content: "\ed7b"; } +.ri-key-2-line:before { content: "\ed7c"; } +.ri-key-fill:before { content: "\ed7d"; } +.ri-key-line:before { content: "\ed7e"; } +.ri-keyboard-box-fill:before { content: "\ed7f"; } +.ri-keyboard-box-line:before { content: "\ed80"; } +.ri-keyboard-fill:before { content: "\ed81"; } +.ri-keyboard-line:before { content: "\ed82"; } +.ri-keynote-fill:before { content: "\ed83"; } +.ri-keynote-line:before { content: "\ed84"; } +.ri-landscape-fill:before { content: "\ed85"; } +.ri-landscape-line:before { content: "\ed86"; } +.ri-layout-column-fill:before { content: "\ed87"; } +.ri-layout-column-line:before { content: "\ed88"; } +.ri-layout-fill:before { content: "\ed89"; } +.ri-layout-line:before { content: "\ed8a"; } +.ri-layout-row-fill:before { content: "\ed8b"; } +.ri-layout-row-line:before { content: "\ed8c"; } +.ri-lightbulb-fill:before { content: "\ed8d"; } +.ri-lightbulb-flash-fill:before { content: "\ed8e"; } +.ri-lightbulb-flash-line:before { content: "\ed8f"; } +.ri-lightbulb-line:before { content: "\ed90"; } +.ri-line-fill:before { content: "\ed91"; } +.ri-line-height:before { content: "\ed92"; } +.ri-line-line:before { content: "\ed93"; } +.ri-link-m:before { content: "\ed94"; } +.ri-link-unlink-m:before { content: "\ed95"; } +.ri-link-unlink:before { content: "\ed96"; } +.ri-link:before { content: "\ed97"; } +.ri-linkedin-box-fill:before { content: "\ed98"; } +.ri-linkedin-box-line:before { content: "\ed99"; } +.ri-linkedin-fill:before { content: "\ed9a"; } +.ri-linkedin-line:before { content: "\ed9b"; } +.ri-links-fill:before { content: "\ed9c"; } +.ri-links-line:before { content: "\ed9d"; } +.ri-list-check-2:before { content: "\ed9e"; } +.ri-list-check:before { content: "\ed9f"; } +.ri-list-ordered:before { content: "\eda0"; } +.ri-list-settings-fill:before { content: "\eda1"; } +.ri-list-settings-line:before { content: "\eda2"; } +.ri-list-unordered:before { content: "\eda3"; } +.ri-loader-2-fill:before { content: "\eda4"; } +.ri-loader-2-line:before { content: "\eda5"; } +.ri-loader-3-fill:before { content: "\eda6"; } +.ri-loader-3-line:before { content: "\eda7"; } +.ri-loader-4-fill:before { content: "\eda8"; } +.ri-loader-4-line:before { content: "\eda9"; } +.ri-loader-5-fill:before { content: "\edaa"; } +.ri-loader-5-line:before { content: "\edab"; } +.ri-loader-fill:before { content: "\edac"; } +.ri-loader-line:before { content: "\edad"; } +.ri-lock-2-fill:before { content: "\edae"; } +.ri-lock-2-line:before { content: "\edaf"; } +.ri-lock-fill:before { content: "\edb0"; } +.ri-lock-line:before { content: "\edb1"; } +.ri-lock-password-fill:before { content: "\edb2"; } +.ri-lock-password-line:before { content: "\edb3"; } +.ri-lock-unlock-fill:before { content: "\edb4"; } +.ri-lock-unlock-line:before { content: "\edb5"; } +.ri-login-box-fill:before { content: "\edb6"; } +.ri-login-box-line:before { content: "\edb7"; } +.ri-login-circle-fill:before { content: "\edb8"; } +.ri-login-circle-line:before { content: "\edb9"; } +.ri-logout-box-fill:before { content: "\edba"; } +.ri-logout-box-line:before { content: "\edbb"; } +.ri-logout-box-r-fill:before { content: "\edbc"; } +.ri-logout-box-r-line:before { content: "\edbd"; } +.ri-logout-circle-fill:before { content: "\edbe"; } +.ri-logout-circle-line:before { content: "\edbf"; } +.ri-logout-circle-r-fill:before { content: "\edc0"; } +.ri-logout-circle-r-line:before { content: "\edc1"; } +.ri-mac-fill:before { content: "\edc2"; } +.ri-mac-line:before { content: "\edc3"; } +.ri-macbook-fill:before { content: "\edc4"; } +.ri-macbook-line:before { content: "\edc5"; } +.ri-magic-fill:before { content: "\edc6"; } +.ri-magic-line:before { content: "\edc7"; } +.ri-mail-add-fill:before { content: "\edc8"; } +.ri-mail-add-line:before { content: "\edc9"; } +.ri-mail-check-fill:before { content: "\edca"; } +.ri-mail-check-line:before { content: "\edcb"; } +.ri-mail-close-fill:before { content: "\edcc"; } +.ri-mail-close-line:before { content: "\edcd"; } +.ri-mail-download-fill:before { content: "\edce"; } +.ri-mail-download-line:before { content: "\edcf"; } +.ri-mail-fill:before { content: "\edd0"; } +.ri-mail-forbid-fill:before { content: "\edd1"; } +.ri-mail-forbid-line:before { content: "\edd2"; } +.ri-mail-line:before { content: "\edd3"; } +.ri-mail-lock-fill:before { content: "\edd4"; } +.ri-mail-lock-line:before { content: "\edd5"; } +.ri-mail-open-fill:before { content: "\edd6"; } +.ri-mail-open-line:before { content: "\edd7"; } +.ri-mail-send-fill:before { content: "\edd8"; } +.ri-mail-send-line:before { content: "\edd9"; } +.ri-mail-settings-fill:before { content: "\edda"; } +.ri-mail-settings-line:before { content: "\eddb"; } +.ri-mail-star-fill:before { content: "\eddc"; } +.ri-mail-star-line:before { content: "\eddd"; } +.ri-mail-unread-fill:before { content: "\edde"; } +.ri-mail-unread-line:before { content: "\eddf"; } +.ri-map-2-fill:before { content: "\ede0"; } +.ri-map-2-line:before { content: "\ede1"; } +.ri-map-fill:before { content: "\ede2"; } +.ri-map-line:before { content: "\ede3"; } +.ri-map-pin-2-fill:before { content: "\ede4"; } +.ri-map-pin-2-line:before { content: "\ede5"; } +.ri-map-pin-3-fill:before { content: "\ede6"; } +.ri-map-pin-3-line:before { content: "\ede7"; } +.ri-map-pin-4-fill:before { content: "\ede8"; } +.ri-map-pin-4-line:before { content: "\ede9"; } +.ri-map-pin-5-fill:before { content: "\edea"; } +.ri-map-pin-5-line:before { content: "\edeb"; } +.ri-map-pin-add-fill:before { content: "\edec"; } +.ri-map-pin-add-line:before { content: "\eded"; } +.ri-map-pin-fill:before { content: "\edee"; } +.ri-map-pin-line:before { content: "\edef"; } +.ri-map-pin-range-fill:before { content: "\edf0"; } +.ri-map-pin-range-line:before { content: "\edf1"; } +.ri-map-pin-time-fill:before { content: "\edf2"; } +.ri-map-pin-time-line:before { content: "\edf3"; } +.ri-map-pin-user-fill:before { content: "\edf4"; } +.ri-map-pin-user-line:before { content: "\edf5"; } +.ri-mark-pen-fill:before { content: "\edf6"; } +.ri-mark-pen-line:before { content: "\edf7"; } +.ri-markdown-fill:before { content: "\edf8"; } +.ri-markdown-line:before { content: "\edf9"; } +.ri-markup-fill:before { content: "\edfa"; } +.ri-markup-line:before { content: "\edfb"; } +.ri-mastercard-fill:before { content: "\edfc"; } +.ri-mastercard-line:before { content: "\edfd"; } +.ri-mastodon-fill:before { content: "\edfe"; } +.ri-mastodon-line:before { content: "\edff"; } +.ri-medium-fill:before { content: "\ee00"; } +.ri-medium-line:before { content: "\ee01"; } +.ri-men-fill:before { content: "\ee02"; } +.ri-men-line:before { content: "\ee03"; } +.ri-menu-2-fill:before { content: "\ee04"; } +.ri-menu-2-line:before { content: "\ee05"; } +.ri-menu-3-fill:before { content: "\ee06"; } +.ri-menu-3-line:before { content: "\ee07"; } +.ri-menu-fill:before { content: "\ee08"; } +.ri-menu-line:before { content: "\ee09"; } +.ri-message-2-fill:before { content: "\ee0a"; } +.ri-message-2-line:before { content: "\ee0b"; } +.ri-message-3-fill:before { content: "\ee0c"; } +.ri-message-3-line:before { content: "\ee0d"; } +.ri-message-fill:before { content: "\ee0e"; } +.ri-message-line:before { content: "\ee0f"; } +.ri-messenger-fill:before { content: "\ee10"; } +.ri-messenger-line:before { content: "\ee11"; } +.ri-mic-2-fill:before { content: "\ee12"; } +.ri-mic-2-line:before { content: "\ee13"; } +.ri-mic-fill:before { content: "\ee14"; } +.ri-mic-line:before { content: "\ee15"; } +.ri-mic-off-fill:before { content: "\ee16"; } +.ri-mic-off-line:before { content: "\ee17"; } +.ri-mini-program-fill:before { content: "\ee18"; } +.ri-mini-program-line:before { content: "\ee19"; } +.ri-mist-fill:before { content: "\ee1a"; } +.ri-mist-line:before { content: "\ee1b"; } +.ri-money-cny-box-fill:before { content: "\ee1c"; } +.ri-money-cny-box-line:before { content: "\ee1d"; } +.ri-money-cny-circle-fill:before { content: "\ee1e"; } +.ri-money-cny-circle-line:before { content: "\ee1f"; } +.ri-money-dollar-box-fill:before { content: "\ee20"; } +.ri-money-dollar-box-line:before { content: "\ee21"; } +.ri-money-dollar-circle-fill:before { content: "\ee22"; } +.ri-money-dollar-circle-line:before { content: "\ee23"; } +.ri-money-euro-box-fill:before { content: "\ee24"; } +.ri-money-euro-box-line:before { content: "\ee25"; } +.ri-money-euro-circle-fill:before { content: "\ee26"; } +.ri-money-euro-circle-line:before { content: "\ee27"; } +.ri-money-pound-box-fill:before { content: "\ee28"; } +.ri-money-pound-box-line:before { content: "\ee29"; } +.ri-money-pound-circle-fill:before { content: "\ee2a"; } +.ri-money-pound-circle-line:before { content: "\ee2b"; } +.ri-moon-clear-fill:before { content: "\ee2c"; } +.ri-moon-clear-line:before { content: "\ee2d"; } +.ri-moon-cloudy-fill:before { content: "\ee2e"; } +.ri-moon-cloudy-line:before { content: "\ee2f"; } +.ri-moon-fill:before { content: "\ee30"; } +.ri-moon-foggy-fill:before { content: "\ee31"; } +.ri-moon-foggy-line:before { content: "\ee32"; } +.ri-moon-line:before { content: "\ee33"; } +.ri-more-2-fill:before { content: "\ee34"; } +.ri-more-2-line:before { content: "\ee35"; } +.ri-more-fill:before { content: "\ee36"; } +.ri-more-line:before { content: "\ee37"; } +.ri-motorbike-fill:before { content: "\ee38"; } +.ri-motorbike-line:before { content: "\ee39"; } +.ri-mouse-fill:before { content: "\ee3a"; } +.ri-mouse-line:before { content: "\ee3b"; } +.ri-movie-2-fill:before { content: "\ee3c"; } +.ri-movie-2-line:before { content: "\ee3d"; } +.ri-movie-fill:before { content: "\ee3e"; } +.ri-movie-line:before { content: "\ee3f"; } +.ri-music-2-fill:before { content: "\ee40"; } +.ri-music-2-line:before { content: "\ee41"; } +.ri-music-fill:before { content: "\ee42"; } +.ri-music-line:before { content: "\ee43"; } +.ri-mv-fill:before { content: "\ee44"; } +.ri-mv-line:before { content: "\ee45"; } +.ri-navigation-fill:before { content: "\ee46"; } +.ri-navigation-line:before { content: "\ee47"; } +.ri-netease-cloud-music-fill:before { content: "\ee48"; } +.ri-netease-cloud-music-line:before { content: "\ee49"; } +.ri-netflix-fill:before { content: "\ee4a"; } +.ri-netflix-line:before { content: "\ee4b"; } +.ri-newspaper-fill:before { content: "\ee4c"; } +.ri-newspaper-line:before { content: "\ee4d"; } +.ri-notification-2-fill:before { content: "\ee4e"; } +.ri-notification-2-line:before { content: "\ee4f"; } +.ri-notification-3-fill:before { content: "\ee50"; } +.ri-notification-3-line:before { content: "\ee51"; } +.ri-notification-4-fill:before { content: "\ee52"; } +.ri-notification-4-line:before { content: "\ee53"; } +.ri-notification-badge-fill:before { content: "\ee54"; } +.ri-notification-badge-line:before { content: "\ee55"; } +.ri-notification-fill:before { content: "\ee56"; } +.ri-notification-line:before { content: "\ee57"; } +.ri-notification-off-fill:before { content: "\ee58"; } +.ri-notification-off-line:before { content: "\ee59"; } +.ri-number-0:before { content: "\ee5a"; } +.ri-number-1:before { content: "\ee5b"; } +.ri-number-2:before { content: "\ee5c"; } +.ri-number-3:before { content: "\ee5d"; } +.ri-number-4:before { content: "\ee5e"; } +.ri-number-5:before { content: "\ee5f"; } +.ri-number-6:before { content: "\ee60"; } +.ri-number-7:before { content: "\ee61"; } +.ri-number-8:before { content: "\ee62"; } +.ri-number-9:before { content: "\ee63"; } +.ri-numbers-fill:before { content: "\ee64"; } +.ri-numbers-line:before { content: "\ee65"; } +.ri-oil-fill:before { content: "\ee66"; } +.ri-oil-line:before { content: "\ee67"; } +.ri-omega:before { content: "\ee68"; } +.ri-open-arm-fill:before { content: "\ee69"; } +.ri-open-arm-line:before { content: "\ee6a"; } +.ri-opera-fill:before { content: "\ee6b"; } +.ri-opera-line:before { content: "\ee6c"; } +.ri-order-play-fill:before { content: "\ee6d"; } +.ri-order-play-line:before { content: "\ee6e"; } +.ri-outlet-2-fill:before { content: "\ee6f"; } +.ri-outlet-2-line:before { content: "\ee70"; } +.ri-outlet-fill:before { content: "\ee71"; } +.ri-outlet-line:before { content: "\ee72"; } +.ri-page-separator:before { content: "\ee73"; } +.ri-pages-fill:before { content: "\ee74"; } +.ri-pages-line:before { content: "\ee75"; } +.ri-paint-brush-fill:before { content: "\ee76"; } +.ri-paint-brush-line:before { content: "\ee77"; } +.ri-paint-fill:before { content: "\ee78"; } +.ri-paint-line:before { content: "\ee79"; } +.ri-palette-fill:before { content: "\ee7a"; } +.ri-palette-line:before { content: "\ee7b"; } +.ri-pantone-fill:before { content: "\ee7c"; } +.ri-pantone-line:before { content: "\ee7d"; } +.ri-paragraph:before { content: "\ee7e"; } +.ri-parent-fill:before { content: "\ee7f"; } +.ri-parent-line:before { content: "\ee80"; } +.ri-parentheses-fill:before { content: "\ee81"; } +.ri-parentheses-line:before { content: "\ee82"; } +.ri-parking-box-fill:before { content: "\ee83"; } +.ri-parking-box-line:before { content: "\ee84"; } +.ri-parking-fill:before { content: "\ee85"; } +.ri-parking-line:before { content: "\ee86"; } +.ri-patreon-fill:before { content: "\ee87"; } +.ri-patreon-line:before { content: "\ee88"; } +.ri-pause-circle-fill:before { content: "\ee89"; } +.ri-pause-circle-line:before { content: "\ee8a"; } +.ri-pause-fill:before { content: "\ee8b"; } +.ri-pause-line:before { content: "\ee8c"; } +.ri-pause-mini-fill:before { content: "\ee8d"; } +.ri-pause-mini-line:before { content: "\ee8e"; } +.ri-paypal-fill:before { content: "\ee8f"; } +.ri-paypal-line:before { content: "\ee90"; } +.ri-pen-nib-fill:before { content: "\ee91"; } +.ri-pen-nib-line:before { content: "\ee92"; } +.ri-pencil-fill:before { content: "\ee93"; } +.ri-pencil-line:before { content: "\ee94"; } +.ri-pencil-ruler-2-fill:before { content: "\ee95"; } +.ri-pencil-ruler-2-line:before { content: "\ee96"; } +.ri-pencil-ruler-fill:before { content: "\ee97"; } +.ri-pencil-ruler-line:before { content: "\ee98"; } +.ri-percent-fill:before { content: "\ee99"; } +.ri-percent-line:before { content: "\ee9a"; } +.ri-phone-camera-fill:before { content: "\ee9b"; } +.ri-phone-camera-line:before { content: "\ee9c"; } +.ri-phone-fill:before { content: "\ee9d"; } +.ri-phone-line:before { content: "\ee9e"; } +.ri-pie-chart-2-fill:before { content: "\ee9f"; } +.ri-pie-chart-2-line:before { content: "\eea0"; } +.ri-pie-chart-box-fill:before { content: "\eea1"; } +.ri-pie-chart-box-line:before { content: "\eea2"; } +.ri-pie-chart-fill:before { content: "\eea3"; } +.ri-pie-chart-line:before { content: "\eea4"; } +.ri-pin-distance-fill:before { content: "\eea5"; } +.ri-pin-distance-line:before { content: "\eea6"; } +.ri-pinterest-fill:before { content: "\eea7"; } +.ri-pinterest-line:before { content: "\eea8"; } +.ri-plane-fill:before { content: "\eea9"; } +.ri-plane-line:before { content: "\eeaa"; } +.ri-play-circle-fill:before { content: "\eeab"; } +.ri-play-circle-line:before { content: "\eeac"; } +.ri-play-fill:before { content: "\eead"; } +.ri-play-line:before { content: "\eeae"; } +.ri-play-list-add-fill:before { content: "\eeaf"; } +.ri-play-list-add-line:before { content: "\eeb0"; } +.ri-play-list-fill:before { content: "\eeb1"; } +.ri-play-list-line:before { content: "\eeb2"; } +.ri-play-mini-fill:before { content: "\eeb3"; } +.ri-play-mini-line:before { content: "\eeb4"; } +.ri-playstation-fill:before { content: "\eeb5"; } +.ri-playstation-line:before { content: "\eeb6"; } +.ri-plug-2-fill:before { content: "\eeb7"; } +.ri-plug-2-line:before { content: "\eeb8"; } +.ri-plug-fill:before { content: "\eeb9"; } +.ri-plug-line:before { content: "\eeba"; } +.ri-polaroid-2-fill:before { content: "\eebb"; } +.ri-polaroid-2-line:before { content: "\eebc"; } +.ri-polaroid-fill:before { content: "\eebd"; } +.ri-polaroid-line:before { content: "\eebe"; } +.ri-police-car-fill:before { content: "\eebf"; } +.ri-police-car-line:before { content: "\eec0"; } +.ri-price-tag-2-fill:before { content: "\eec1"; } +.ri-price-tag-2-line:before { content: "\eec2"; } +.ri-price-tag-3-fill:before { content: "\eec3"; } +.ri-price-tag-3-line:before { content: "\eec4"; } +.ri-price-tag-fill:before { content: "\eec5"; } +.ri-price-tag-line:before { content: "\eec6"; } +.ri-printer-fill:before { content: "\eec7"; } +.ri-printer-line:before { content: "\eec8"; } +.ri-product-hunt-fill:before { content: "\eec9"; } +.ri-product-hunt-line:before { content: "\eeca"; } +.ri-profile-fill:before { content: "\eecb"; } +.ri-profile-line:before { content: "\eecc"; } +.ri-projector-2-fill:before { content: "\eecd"; } +.ri-projector-2-line:before { content: "\eece"; } +.ri-projector-fill:before { content: "\eecf"; } +.ri-projector-line:before { content: "\eed0"; } +.ri-push-pin-2-fill:before { content: "\eed1"; } +.ri-push-pin-2-line:before { content: "\eed2"; } +.ri-push-pin-fill:before { content: "\eed3"; } +.ri-push-pin-line:before { content: "\eed4"; } +.ri-qq-fill:before { content: "\eed5"; } +.ri-qq-line:before { content: "\eed6"; } +.ri-qr-code-fill:before { content: "\eed7"; } +.ri-qr-code-line:before { content: "\eed8"; } +.ri-qr-scan-2-fill:before { content: "\eed9"; } +.ri-qr-scan-2-line:before { content: "\eeda"; } +.ri-qr-scan-fill:before { content: "\eedb"; } +.ri-qr-scan-line:before { content: "\eedc"; } +.ri-question-answer-fill:before { content: "\eedd"; } +.ri-question-answer-line:before { content: "\eede"; } +.ri-question-fill:before { content: "\eedf"; } +.ri-question-line:before { content: "\eee0"; } +.ri-questionnaire-fill:before { content: "\eee1"; } +.ri-questionnaire-line:before { content: "\eee2"; } +.ri-quill-pen-fill:before { content: "\eee3"; } +.ri-quill-pen-line:before { content: "\eee4"; } +.ri-radar-fill:before { content: "\eee5"; } +.ri-radar-line:before { content: "\eee6"; } +.ri-radio-2-fill:before { content: "\eee7"; } +.ri-radio-2-line:before { content: "\eee8"; } +.ri-radio-button-fill:before { content: "\eee9"; } +.ri-radio-button-line:before { content: "\eeea"; } +.ri-radio-fill:before { content: "\eeeb"; } +.ri-radio-line:before { content: "\eeec"; } +.ri-rainy-fill:before { content: "\eeed"; } +.ri-rainy-line:before { content: "\eeee"; } +.ri-reactjs-fill:before { content: "\eeef"; } +.ri-reactjs-line:before { content: "\eef0"; } +.ri-record-circle-fill:before { content: "\eef1"; } +.ri-record-circle-line:before { content: "\eef2"; } +.ri-record-mail-fill:before { content: "\eef3"; } +.ri-record-mail-line:before { content: "\eef4"; } +.ri-red-packet-fill:before { content: "\eef5"; } +.ri-red-packet-line:before { content: "\eef6"; } +.ri-reddit-fill:before { content: "\eef7"; } +.ri-reddit-line:before { content: "\eef8"; } +.ri-refresh-fill:before { content: "\eef9"; } +.ri-refresh-line:before { content: "\eefa"; } +.ri-refund-fill:before { content: "\eefb"; } +.ri-refund-line:before { content: "\eefc"; } +.ri-remixicon-fill:before { content: "\eefd"; } +.ri-remixicon-line:before { content: "\eefe"; } +.ri-repeat-2-fill:before { content: "\eeff"; } +.ri-repeat-2-line:before { content: "\ef00"; } +.ri-repeat-fill:before { content: "\ef01"; } +.ri-repeat-line:before { content: "\ef02"; } +.ri-repeat-one-fill:before { content: "\ef03"; } +.ri-repeat-one-line:before { content: "\ef04"; } +.ri-reply-fill:before { content: "\ef05"; } +.ri-reply-line:before { content: "\ef06"; } +.ri-reserved-fill:before { content: "\ef07"; } +.ri-reserved-line:before { content: "\ef08"; } +.ri-restart-fill:before { content: "\ef09"; } +.ri-restart-line:before { content: "\ef0a"; } +.ri-restaurant-2-fill:before { content: "\ef0b"; } +.ri-restaurant-2-line:before { content: "\ef0c"; } +.ri-restaurant-fill:before { content: "\ef0d"; } +.ri-restaurant-line:before { content: "\ef0e"; } +.ri-rewind-fill:before { content: "\ef0f"; } +.ri-rewind-line:before { content: "\ef10"; } +.ri-rewind-mini-fill:before { content: "\ef11"; } +.ri-rewind-mini-line:before { content: "\ef12"; } +.ri-rhythm-fill:before { content: "\ef13"; } +.ri-rhythm-line:before { content: "\ef14"; } +.ri-riding-fill:before { content: "\ef15"; } +.ri-riding-line:before { content: "\ef16"; } +.ri-road-map-fill:before { content: "\ef17"; } +.ri-road-map-line:before { content: "\ef18"; } +.ri-roadster-fill:before { content: "\ef19"; } +.ri-roadster-line:before { content: "\ef1a"; } +.ri-robot-fill:before { content: "\ef1b"; } +.ri-robot-line:before { content: "\ef1c"; } +.ri-rocket-2-fill:before { content: "\ef1d"; } +.ri-rocket-2-line:before { content: "\ef1e"; } +.ri-rocket-fill:before { content: "\ef1f"; } +.ri-rocket-line:before { content: "\ef20"; } +.ri-route-fill:before { content: "\ef21"; } +.ri-route-line:before { content: "\ef22"; } +.ri-router-fill:before { content: "\ef23"; } +.ri-router-line:before { content: "\ef24"; } +.ri-rss-fill:before { content: "\ef25"; } +.ri-rss-line:before { content: "\ef26"; } +.ri-ruler-2-fill:before { content: "\ef27"; } +.ri-ruler-2-line:before { content: "\ef28"; } +.ri-ruler-fill:before { content: "\ef29"; } +.ri-ruler-line:before { content: "\ef2a"; } +.ri-run-fill:before { content: "\ef2b"; } +.ri-run-line:before { content: "\ef2c"; } +.ri-safari-fill:before { content: "\ef2d"; } +.ri-safari-line:before { content: "\ef2e"; } +.ri-safe-2-fill:before { content: "\ef2f"; } +.ri-safe-2-line:before { content: "\ef30"; } +.ri-safe-fill:before { content: "\ef31"; } +.ri-safe-line:before { content: "\ef32"; } +.ri-sailboat-fill:before { content: "\ef33"; } +.ri-sailboat-line:before { content: "\ef34"; } +.ri-save-2-fill:before { content: "\ef35"; } +.ri-save-2-line:before { content: "\ef36"; } +.ri-save-3-fill:before { content: "\ef37"; } +.ri-save-3-line:before { content: "\ef38"; } +.ri-save-fill:before { content: "\ef39"; } +.ri-save-line:before { content: "\ef3a"; } +.ri-scan-2-fill:before { content: "\ef3b"; } +.ri-scan-2-line:before { content: "\ef3c"; } +.ri-scan-fill:before { content: "\ef3d"; } +.ri-scan-line:before { content: "\ef3e"; } +.ri-scissors-2-fill:before { content: "\ef3f"; } +.ri-scissors-2-line:before { content: "\ef40"; } +.ri-scissors-cut-fill:before { content: "\ef41"; } +.ri-scissors-cut-line:before { content: "\ef42"; } +.ri-scissors-fill:before { content: "\ef43"; } +.ri-scissors-line:before { content: "\ef44"; } +.ri-screenshot-2-fill:before { content: "\ef45"; } +.ri-screenshot-2-line:before { content: "\ef46"; } +.ri-screenshot-fill:before { content: "\ef47"; } +.ri-screenshot-line:before { content: "\ef48"; } +.ri-sd-card-fill:before { content: "\ef49"; } +.ri-sd-card-line:before { content: "\ef4a"; } +.ri-sd-card-mini-fill:before { content: "\ef4b"; } +.ri-sd-card-mini-line:before { content: "\ef4c"; } +.ri-search-2-fill:before { content: "\ef4d"; } +.ri-search-2-line:before { content: "\ef4e"; } +.ri-search-eye-fill:before { content: "\ef4f"; } +.ri-search-eye-line:before { content: "\ef50"; } +.ri-search-fill:before { content: "\ef51"; } +.ri-search-line:before { content: "\ef52"; } +.ri-send-plane-2-fill:before { content: "\ef53"; } +.ri-send-plane-2-line:before { content: "\ef54"; } +.ri-send-plane-fill:before { content: "\ef55"; } +.ri-send-plane-line:before { content: "\ef56"; } +.ri-sensor-fill:before { content: "\ef57"; } +.ri-sensor-line:before { content: "\ef58"; } +.ri-separator:before { content: "\ef59"; } +.ri-server-fill:before { content: "\ef5a"; } +.ri-server-line:before { content: "\ef5b"; } +.ri-settings-2-fill:before { content: "\ef5c"; } +.ri-settings-2-line:before { content: "\ef5d"; } +.ri-settings-3-fill:before { content: "\ef5e"; } +.ri-settings-3-line:before { content: "\ef5f"; } +.ri-settings-4-fill:before { content: "\ef60"; } +.ri-settings-4-line:before { content: "\ef61"; } +.ri-settings-5-fill:before { content: "\ef62"; } +.ri-settings-5-line:before { content: "\ef63"; } +.ri-settings-6-fill:before { content: "\ef64"; } +.ri-settings-6-line:before { content: "\ef65"; } +.ri-settings-fill:before { content: "\ef66"; } +.ri-settings-line:before { content: "\ef67"; } +.ri-shape-2-fill:before { content: "\ef68"; } +.ri-shape-2-line:before { content: "\ef69"; } +.ri-shape-fill:before { content: "\ef6a"; } +.ri-shape-line:before { content: "\ef6b"; } +.ri-share-box-fill:before { content: "\ef6c"; } +.ri-share-box-line:before { content: "\ef6d"; } +.ri-share-circle-fill:before { content: "\ef6e"; } +.ri-share-circle-line:before { content: "\ef6f"; } +.ri-share-fill:before { content: "\ef70"; } +.ri-share-forward-2-fill:before { content: "\ef71"; } +.ri-share-forward-2-line:before { content: "\ef72"; } +.ri-share-forward-box-fill:before { content: "\ef73"; } +.ri-share-forward-box-line:before { content: "\ef74"; } +.ri-share-forward-fill:before { content: "\ef75"; } +.ri-share-forward-line:before { content: "\ef76"; } +.ri-share-line:before { content: "\ef77"; } +.ri-share-stack-fill:before { content: "\ef78"; } +.ri-share-stack-line:before { content: "\ef79"; } +.ri-shield-cross-fill:before { content: "\ef7a"; } +.ri-shield-cross-line:before { content: "\ef7b"; } +.ri-shield-fill:before { content: "\ef7c"; } +.ri-shield-flash-fill:before { content: "\ef7d"; } +.ri-shield-flash-line:before { content: "\ef7e"; } +.ri-shield-keyhole-fill:before { content: "\ef7f"; } +.ri-shield-keyhole-line:before { content: "\ef80"; } +.ri-shield-line:before { content: "\ef81"; } +.ri-shield-star-fill:before { content: "\ef82"; } +.ri-shield-star-line:before { content: "\ef83"; } +.ri-shield-user-fill:before { content: "\ef84"; } +.ri-shield-user-line:before { content: "\ef85"; } +.ri-ship-2-fill:before { content: "\ef86"; } +.ri-ship-2-line:before { content: "\ef87"; } +.ri-ship-fill:before { content: "\ef88"; } +.ri-ship-line:before { content: "\ef89"; } +.ri-shirt-fill:before { content: "\ef8a"; } +.ri-shirt-line:before { content: "\ef8b"; } +.ri-shopping-bag-2-fill:before { content: "\ef8c"; } +.ri-shopping-bag-2-line:before { content: "\ef8d"; } +.ri-shopping-bag-3-fill:before { content: "\ef8e"; } +.ri-shopping-bag-3-line:before { content: "\ef8f"; } +.ri-shopping-bag-fill:before { content: "\ef90"; } +.ri-shopping-bag-line:before { content: "\ef91"; } +.ri-shopping-cart-2-fill:before { content: "\ef92"; } +.ri-shopping-cart-2-line:before { content: "\ef93"; } +.ri-shopping-cart-fill:before { content: "\ef94"; } +.ri-shopping-cart-line:before { content: "\ef95"; } +.ri-showers-fill:before { content: "\ef96"; } +.ri-showers-line:before { content: "\ef97"; } +.ri-shuffle-fill:before { content: "\ef98"; } +.ri-shuffle-line:before { content: "\ef99"; } +.ri-shut-down-fill:before { content: "\ef9a"; } +.ri-shut-down-line:before { content: "\ef9b"; } +.ri-side-bar-fill:before { content: "\ef9c"; } +.ri-side-bar-line:before { content: "\ef9d"; } +.ri-signal-tower-fill:before { content: "\ef9e"; } +.ri-signal-tower-line:before { content: "\ef9f"; } +.ri-sim-card-2-fill:before { content: "\efa0"; } +.ri-sim-card-2-line:before { content: "\efa1"; } +.ri-sim-card-fill:before { content: "\efa2"; } +.ri-sim-card-line:before { content: "\efa3"; } +.ri-single-quotes-l:before { content: "\efa4"; } +.ri-single-quotes-r:before { content: "\efa5"; } +.ri-sip-fill:before { content: "\efa6"; } +.ri-sip-line:before { content: "\efa7"; } +.ri-skip-back-fill:before { content: "\efa8"; } +.ri-skip-back-line:before { content: "\efa9"; } +.ri-skip-back-mini-fill:before { content: "\efaa"; } +.ri-skip-back-mini-line:before { content: "\efab"; } +.ri-skip-forward-fill:before { content: "\efac"; } +.ri-skip-forward-line:before { content: "\efad"; } +.ri-skip-forward-mini-fill:before { content: "\efae"; } +.ri-skip-forward-mini-line:before { content: "\efaf"; } +.ri-skull-fill:before { content: "\efb0"; } +.ri-skull-line:before { content: "\efb1"; } +.ri-skype-fill:before { content: "\efb2"; } +.ri-skype-line:before { content: "\efb3"; } +.ri-slack-fill:before { content: "\efb4"; } +.ri-slack-line:before { content: "\efb5"; } +.ri-slice-fill:before { content: "\efb6"; } +.ri-slice-line:before { content: "\efb7"; } +.ri-slideshow-2-fill:before { content: "\efb8"; } +.ri-slideshow-2-line:before { content: "\efb9"; } +.ri-slideshow-3-fill:before { content: "\efba"; } +.ri-slideshow-3-line:before { content: "\efbb"; } +.ri-slideshow-4-fill:before { content: "\efbc"; } +.ri-slideshow-4-line:before { content: "\efbd"; } +.ri-slideshow-fill:before { content: "\efbe"; } +.ri-slideshow-line:before { content: "\efbf"; } +.ri-smartphone-fill:before { content: "\efc0"; } +.ri-smartphone-line:before { content: "\efc1"; } +.ri-snapchat-fill:before { content: "\efc2"; } +.ri-snapchat-line:before { content: "\efc3"; } +.ri-snowy-fill:before { content: "\efc4"; } +.ri-snowy-line:before { content: "\efc5"; } +.ri-sound-module-fill:before { content: "\efc6"; } +.ri-sound-module-line:before { content: "\efc7"; } +.ri-space-ship-fill:before { content: "\efc8"; } +.ri-space-ship-line:before { content: "\efc9"; } +.ri-space:before { content: "\efca"; } +.ri-spam-2-fill:before { content: "\efcb"; } +.ri-spam-2-line:before { content: "\efcc"; } +.ri-spam-3-fill:before { content: "\efcd"; } +.ri-spam-3-line:before { content: "\efce"; } +.ri-spam-fill:before { content: "\efcf"; } +.ri-spam-line:before { content: "\efd0"; } +.ri-speaker-2-fill:before { content: "\efd1"; } +.ri-speaker-2-line:before { content: "\efd2"; } +.ri-speaker-3-fill:before { content: "\efd3"; } +.ri-speaker-3-line:before { content: "\efd4"; } +.ri-speaker-fill:before { content: "\efd5"; } +.ri-speaker-line:before { content: "\efd6"; } +.ri-speed-fill:before { content: "\efd7"; } +.ri-speed-line:before { content: "\efd8"; } +.ri-speed-mini-fill:before { content: "\efd9"; } +.ri-speed-mini-line:before { content: "\efda"; } +.ri-spotify-fill:before { content: "\efdb"; } +.ri-spotify-line:before { content: "\efdc"; } +.ri-stack-fill:before { content: "\efdd"; } +.ri-stack-line:before { content: "\efde"; } +.ri-stack-overflow-fill:before { content: "\efdf"; } +.ri-stack-overflow-line:before { content: "\efe0"; } +.ri-star-fill:before { content: "\efe1"; } +.ri-star-half-fill:before { content: "\efe2"; } +.ri-star-half-line:before { content: "\efe3"; } +.ri-star-half-s-fill:before { content: "\efe4"; } +.ri-star-half-s-line:before { content: "\efe5"; } +.ri-star-line:before { content: "\efe6"; } +.ri-star-s-fill:before { content: "\efe7"; } +.ri-star-s-line:before { content: "\efe8"; } +.ri-steering-2-fill:before { content: "\efe9"; } +.ri-steering-2-line:before { content: "\efea"; } +.ri-steering-fill:before { content: "\efeb"; } +.ri-steering-line:before { content: "\efec"; } +.ri-sticky-note-2-fill:before { content: "\efed"; } +.ri-sticky-note-2-line:before { content: "\efee"; } +.ri-sticky-note-fill:before { content: "\efef"; } +.ri-sticky-note-line:before { content: "\eff0"; } +.ri-stock-fill:before { content: "\eff1"; } +.ri-stock-line:before { content: "\eff2"; } +.ri-stop-circle-fill:before { content: "\eff3"; } +.ri-stop-circle-line:before { content: "\eff4"; } +.ri-stop-fill:before { content: "\eff5"; } +.ri-stop-line:before { content: "\eff6"; } +.ri-stop-mini-fill:before { content: "\eff7"; } +.ri-stop-mini-line:before { content: "\eff8"; } +.ri-store-2-fill:before { content: "\eff9"; } +.ri-store-2-line:before { content: "\effa"; } +.ri-store-3-fill:before { content: "\effb"; } +.ri-store-3-line:before { content: "\effc"; } +.ri-store-fill:before { content: "\effd"; } +.ri-store-line:before { content: "\effe"; } +.ri-strikethrough-2:before { content: "\efff"; } +.ri-strikethrough:before { content: "\f000"; } +.ri-subscript-2:before { content: "\f001"; } +.ri-subscript:before { content: "\f002"; } +.ri-subtract-fill:before { content: "\f003"; } +.ri-subtract-line:before { content: "\f004"; } +.ri-subway-fill:before { content: "\f005"; } +.ri-subway-line:before { content: "\f006"; } +.ri-sun-cloudy-fill:before { content: "\f007"; } +.ri-sun-cloudy-line:before { content: "\f008"; } +.ri-sun-fill:before { content: "\f009"; } +.ri-sun-foggy-fill:before { content: "\f00a"; } +.ri-sun-foggy-line:before { content: "\f00b"; } +.ri-sun-line:before { content: "\f00c"; } +.ri-superscript-2:before { content: "\f00d"; } +.ri-superscript:before { content: "\f00e"; } +.ri-surround-sound-fill:before { content: "\f00f"; } +.ri-surround-sound-line:before { content: "\f010"; } +.ri-swap-box-fill:before { content: "\f011"; } +.ri-swap-box-line:before { content: "\f012"; } +.ri-swap-fill:before { content: "\f013"; } +.ri-swap-line:before { content: "\f014"; } +.ri-switch-fill:before { content: "\f015"; } +.ri-switch-line:before { content: "\f016"; } +.ri-t-box-fill:before { content: "\f017"; } +.ri-t-box-line:before { content: "\f018"; } +.ri-t-shirt-fill:before { content: "\f019"; } +.ri-t-shirt-line:before { content: "\f01a"; } +.ri-table-2:before { content: "\f01b"; } +.ri-table-fill:before { content: "\f01c"; } +.ri-table-line:before { content: "\f01d"; } +.ri-tablet-fill:before { content: "\f01e"; } +.ri-tablet-line:before { content: "\f01f"; } +.ri-taobao-fill:before { content: "\f020"; } +.ri-taobao-line:before { content: "\f021"; } +.ri-tape-fill:before { content: "\f022"; } +.ri-tape-line:before { content: "\f023"; } +.ri-task-fill:before { content: "\f024"; } +.ri-task-line:before { content: "\f025"; } +.ri-taxi-fill:before { content: "\f026"; } +.ri-taxi-line:before { content: "\f027"; } +.ri-telegram-fill:before { content: "\f028"; } +.ri-telegram-line:before { content: "\f029"; } +.ri-temp-cold-fill:before { content: "\f02a"; } +.ri-temp-cold-line:before { content: "\f02b"; } +.ri-temp-hot-fill:before { content: "\f02c"; } +.ri-temp-hot-line:before { content: "\f02d"; } +.ri-terminal-box-fill:before { content: "\f02e"; } +.ri-terminal-box-line:before { content: "\f02f"; } +.ri-terminal-fill:before { content: "\f030"; } +.ri-terminal-line:before { content: "\f031"; } +.ri-terminal-window-fill:before { content: "\f032"; } +.ri-terminal-window-line:before { content: "\f033"; } +.ri-text-direction-l:before { content: "\f034"; } +.ri-text-direction-r:before { content: "\f035"; } +.ri-text-spacing:before { content: "\f036"; } +.ri-text-wrap:before { content: "\f037"; } +.ri-text:before { content: "\f038"; } +.ri-thumb-down-fill:before { content: "\f039"; } +.ri-thumb-down-line:before { content: "\f03a"; } +.ri-thumb-up-fill:before { content: "\f03b"; } +.ri-thumb-up-line:before { content: "\f03c"; } +.ri-thunderstorms-fill:before { content: "\f03d"; } +.ri-thunderstorms-line:before { content: "\f03e"; } +.ri-time-fill:before { content: "\f03f"; } +.ri-time-line:before { content: "\f040"; } +.ri-timer-2-fill:before { content: "\f041"; } +.ri-timer-2-line:before { content: "\f042"; } +.ri-timer-fill:before { content: "\f043"; } +.ri-timer-flash-fill:before { content: "\f044"; } +.ri-timer-flash-line:before { content: "\f045"; } +.ri-timer-line:before { content: "\f046"; } +.ri-todo-fill:before { content: "\f047"; } +.ri-todo-line:before { content: "\f048"; } +.ri-toggle-fill:before { content: "\f049"; } +.ri-toggle-line:before { content: "\f04a"; } +.ri-tools-fill:before { content: "\f04b"; } +.ri-tools-line:before { content: "\f04c"; } +.ri-tornado-fill:before { content: "\f04d"; } +.ri-tornado-line:before { content: "\f04e"; } +.ri-traffic-light-fill:before { content: "\f04f"; } +.ri-traffic-light-line:before { content: "\f050"; } +.ri-train-fill:before { content: "\f051"; } +.ri-train-line:before { content: "\f052"; } +.ri-translate-2:before { content: "\f053"; } +.ri-translate:before { content: "\f054"; } +.ri-travesti-fill:before { content: "\f055"; } +.ri-travesti-line:before { content: "\f056"; } +.ri-treasure-map-fill:before { content: "\f057"; } +.ri-treasure-map-line:before { content: "\f058"; } +.ri-trello-fill:before { content: "\f059"; } +.ri-trello-line:before { content: "\f05a"; } +.ri-trophy-fill:before { content: "\f05b"; } +.ri-trophy-line:before { content: "\f05c"; } +.ri-truck-fill:before { content: "\f05d"; } +.ri-truck-line:before { content: "\f05e"; } +.ri-tumblr-fill:before { content: "\f05f"; } +.ri-tumblr-line:before { content: "\f060"; } +.ri-tv-2-fill:before { content: "\f061"; } +.ri-tv-2-line:before { content: "\f062"; } +.ri-tv-fill:before { content: "\f063"; } +.ri-tv-line:before { content: "\f064"; } +.ri-twitch-fill:before { content: "\f065"; } +.ri-twitch-line:before { content: "\f066"; } +.ri-twitter-fill:before { content: "\f067"; } +.ri-twitter-line:before { content: "\f068"; } +.ri-u-disk-fill:before { content: "\f069"; } +.ri-u-disk-line:before { content: "\f06a"; } +.ri-ubuntu-fill:before { content: "\f06b"; } +.ri-ubuntu-line:before { content: "\f06c"; } +.ri-umbrella-fill:before { content: "\f06d"; } +.ri-umbrella-line:before { content: "\f06e"; } +.ri-underline:before { content: "\f06f"; } +.ri-upload-2-fill:before { content: "\f070"; } +.ri-upload-2-line:before { content: "\f071"; } +.ri-upload-cloud-2-fill:before { content: "\f072"; } +.ri-upload-cloud-2-line:before { content: "\f073"; } +.ri-upload-cloud-fill:before { content: "\f074"; } +.ri-upload-cloud-line:before { content: "\f075"; } +.ri-upload-fill:before { content: "\f076"; } +.ri-upload-line:before { content: "\f077"; } +.ri-user-2-fill:before { content: "\f078"; } +.ri-user-2-line:before { content: "\f079"; } +.ri-user-3-fill:before { content: "\f07a"; } +.ri-user-3-line:before { content: "\f07b"; } +.ri-user-4-fill:before { content: "\f07c"; } +.ri-user-4-line:before { content: "\f07d"; } +.ri-user-5-fill:before { content: "\f07e"; } +.ri-user-5-line:before { content: "\f07f"; } +.ri-user-add-fill:before { content: "\f080"; } +.ri-user-add-line:before { content: "\f081"; } +.ri-user-fill:before { content: "\f082"; } +.ri-user-follow-fill:before { content: "\f083"; } +.ri-user-follow-line:before { content: "\f084"; } +.ri-user-line:before { content: "\f085"; } +.ri-user-location-fill:before { content: "\f086"; } +.ri-user-location-line:before { content: "\f087"; } +.ri-user-received-2-fill:before { content: "\f088"; } +.ri-user-received-2-line:before { content: "\f089"; } +.ri-user-received-fill:before { content: "\f08a"; } +.ri-user-received-line:before { content: "\f08b"; } +.ri-user-search-fill:before { content: "\f08c"; } +.ri-user-search-line:before { content: "\f08d"; } +.ri-user-settings-fill:before { content: "\f08e"; } +.ri-user-settings-line:before { content: "\f08f"; } +.ri-user-shared-2-fill:before { content: "\f090"; } +.ri-user-shared-2-line:before { content: "\f091"; } +.ri-user-shared-fill:before { content: "\f092"; } +.ri-user-shared-line:before { content: "\f093"; } +.ri-user-smile-fill:before { content: "\f094"; } +.ri-user-smile-line:before { content: "\f095"; } +.ri-user-star-fill:before { content: "\f096"; } +.ri-user-star-line:before { content: "\f097"; } +.ri-user-unfollow-fill:before { content: "\f098"; } +.ri-user-unfollow-line:before { content: "\f099"; } +.ri-user-voice-fill:before { content: "\f09a"; } +.ri-user-voice-line:before { content: "\f09b"; } +.ri-video-chat-fill:before { content: "\f09c"; } +.ri-video-chat-line:before { content: "\f09d"; } +.ri-video-fill:before { content: "\f09e"; } +.ri-video-line:before { content: "\f09f"; } +.ri-vidicon-2-fill:before { content: "\f0a0"; } +.ri-vidicon-2-line:before { content: "\f0a1"; } +.ri-vidicon-fill:before { content: "\f0a2"; } +.ri-vidicon-line:before { content: "\f0a3"; } +.ri-vip-crown-2-fill:before { content: "\f0a4"; } +.ri-vip-crown-2-line:before { content: "\f0a5"; } +.ri-vip-crown-fill:before { content: "\f0a6"; } +.ri-vip-crown-line:before { content: "\f0a7"; } +.ri-vip-diamond-fill:before { content: "\f0a8"; } +.ri-vip-diamond-line:before { content: "\f0a9"; } +.ri-vip-fill:before { content: "\f0aa"; } +.ri-vip-line:before { content: "\f0ab"; } +.ri-visa-fill:before { content: "\f0ac"; } +.ri-visa-line:before { content: "\f0ad"; } +.ri-voiceprint-fill:before { content: "\f0ae"; } +.ri-voiceprint-line:before { content: "\f0af"; } +.ri-volume-down-fill:before { content: "\f0b0"; } +.ri-volume-down-line:before { content: "\f0b1"; } +.ri-volume-mute-fill:before { content: "\f0b2"; } +.ri-volume-mute-line:before { content: "\f0b3"; } +.ri-volume-up-fill:before { content: "\f0b4"; } +.ri-volume-up-line:before { content: "\f0b5"; } +.ri-vuejs-fill:before { content: "\f0b6"; } +.ri-vuejs-line:before { content: "\f0b7"; } +.ri-walk-fill:before { content: "\f0b8"; } +.ri-walk-line:before { content: "\f0b9"; } +.ri-wallet-2-fill:before { content: "\f0ba"; } +.ri-wallet-2-line:before { content: "\f0bb"; } +.ri-wallet-3-fill:before { content: "\f0bc"; } +.ri-wallet-3-line:before { content: "\f0bd"; } +.ri-wallet-fill:before { content: "\f0be"; } +.ri-wallet-line:before { content: "\f0bf"; } +.ri-water-flash-fill:before { content: "\f0c0"; } +.ri-water-flash-line:before { content: "\f0c1"; } +.ri-webcam-fill:before { content: "\f0c2"; } +.ri-webcam-line:before { content: "\f0c3"; } +.ri-wechat-2-fill:before { content: "\f0c4"; } +.ri-wechat-2-line:before { content: "\f0c5"; } +.ri-wechat-fill:before { content: "\f0c6"; } +.ri-wechat-line:before { content: "\f0c7"; } +.ri-wechat-pay-fill:before { content: "\f0c8"; } +.ri-wechat-pay-line:before { content: "\f0c9"; } +.ri-weibo-fill:before { content: "\f0ca"; } +.ri-weibo-line:before { content: "\f0cb"; } +.ri-whatsapp-fill:before { content: "\f0cc"; } +.ri-whatsapp-line:before { content: "\f0cd"; } +.ri-wifi-fill:before { content: "\f0ce"; } +.ri-wifi-line:before { content: "\f0cf"; } +.ri-wifi-off-fill:before { content: "\f0d0"; } +.ri-wifi-off-line:before { content: "\f0d1"; } +.ri-window-2-fill:before { content: "\f0d2"; } +.ri-window-2-line:before { content: "\f0d3"; } +.ri-window-fill:before { content: "\f0d4"; } +.ri-window-line:before { content: "\f0d5"; } +.ri-windows-fill:before { content: "\f0d6"; } +.ri-windows-line:before { content: "\f0d7"; } +.ri-windy-fill:before { content: "\f0d8"; } +.ri-windy-line:before { content: "\f0d9"; } +.ri-women-fill:before { content: "\f0da"; } +.ri-women-line:before { content: "\f0db"; } +.ri-xbox-fill:before { content: "\f0dc"; } +.ri-xbox-line:before { content: "\f0dd"; } +.ri-xing-fill:before { content: "\f0de"; } +.ri-xing-line:before { content: "\f0df"; } +.ri-youtube-fill:before { content: "\f0e0"; } +.ri-youtube-line:before { content: "\f0e1"; } +.ri-zcool-fill:before { content: "\f0e2"; } +.ri-zcool-line:before { content: "\f0e3"; } +.ri-zhihu-fill:before { content: "\f0e4"; } +.ri-zhihu-line:before { content: "\f0e5"; } +.ri-zoom-in-fill:before { content: "\f0e6"; } +.ri-zoom-in-line:before { content: "\f0e7"; } +.ri-zoom-out-fill:before { content: "\f0e8"; } +.ri-zoom-out-line:before { content: "\f0e9"; } + diff --git a/source/css/_variables.styl b/source/css/_variables.styl new file mode 100644 index 0000000..adbc47f --- /dev/null +++ b/source/css/_variables.styl @@ -0,0 +1,76 @@ +// Config +support-for-ie = false +vendor-prefixes = webkit moz ms official + +// Fonts +font-size-browser = 62.5% +font-size-base = 1.4rem +font-family-base = "Helvetica Neue", Helvetica, "PingFang SC", "Hiragino Sans GB", "Microsoft YaHei", "微软雅黑", Arial, sans-serif +font-line-height = 1.7 + +// Colors +black = #000000 +water = #cce5ff +water-green = #9c9 +sea-blue = #3d85c6 +sea-dark = #172d3e +sea = #1e3e3f +sea-light = #253145 +sea-lighter = #5c6b72 +gray = #adb5bd +froth-light = #f4f4f4 +froth = #999 +white = #ffffff +sand-light = #9c8079 +sand = #9e6a4d +sand-dark = #5c5858 +sand-gray = #bbb +red = #ea434a + +// Share Colors +twitter-color = #00aced +facebook-color = #3b5998 +pinterest-color = #cb2027 +google-color = #dd4b39 + +// Link Colors +link-color = darken(water,20%) +link-hover-color = lighten(link-color, 20%) +link-active-color = darken(link-color, 5%) +disabled-color = gray + +// Body Colors +body-background = white +body-color = darken(sand-dark,30%) +main-color = darken(water,20%) +tag-color = lighten(body-color,15%) + +// Border +border-radius = 0.4rem +border-width = 0.1rem +border-color = froth + +// Lyout +aside-width = 7rem +wrap-width = 70rem +years-width = 6rem +logo-size = 4.2rem +cover-logo-size = 6rem + +gutter-width = 1.5rem + +// Breakpoints +breakpoints = ( + xs = 0, + sm = 576px, + md = 768px, + lg = 992px, + xl = 1200px +) + +// Transition +transition-slow = all .7s ease-in-out 0s +transition-fast = all .1s ease-in-out 0s +transition-base = all .3s ease-in-out +transition-fade = opacity .15s linear +transition-collapse = height .35s ease diff --git a/source/css/remixicon/remixicon.eot b/source/css/remixicon/remixicon.eot new file mode 100644 index 0000000..717505b Binary files /dev/null and b/source/css/remixicon/remixicon.eot differ diff --git a/source/css/remixicon/remixicon.svg b/source/css/remixicon/remixicon.svg new file mode 100644 index 0000000..3a0640e --- /dev/null +++ b/source/css/remixicon/remixicon.svg @@ -0,0 +1,5329 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/source/css/remixicon/remixicon.symbol.svg b/source/css/remixicon/remixicon.symbol.svg new file mode 100644 index 0000000..66c2e82 --- /dev/null +++ b/source/css/remixicon/remixicon.symbol.svg @@ -0,0 +1,8856 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/source/css/remixicon/remixicon.ttf b/source/css/remixicon/remixicon.ttf new file mode 100644 index 0000000..cea152f Binary files /dev/null and b/source/css/remixicon/remixicon.ttf differ diff --git a/source/css/remixicon/remixicon.woff b/source/css/remixicon/remixicon.woff new file mode 100644 index 0000000..86e7006 Binary files /dev/null and b/source/css/remixicon/remixicon.woff differ diff --git a/source/css/remixicon/remixicon.woff2 b/source/css/remixicon/remixicon.woff2 new file mode 100644 index 0000000..ee9bb0b Binary files /dev/null and b/source/css/remixicon/remixicon.woff2 differ diff --git a/source/css/style.styl b/source/css/style.styl new file mode 100644 index 0000000..d2b8447 --- /dev/null +++ b/source/css/style.styl @@ -0,0 +1,77 @@ +@import "_variables" +@import "_mixins" +@import "_remixicon" +@import "_normalize" + +*, +*::before +*::after + box-sizing border-box + +html, body + height: 100% + +html + font-size font-size-browser + -webkit-text-size-adjust 100% + -ms-text-size-adjust 100% + -ms-overflow-style scrollbar + -webkit-tap-highlight-color transparent + +body + position relative + background-color body-background + font-family font-family-base + font-size font-size-base + line-height font-line-height + color body-color + padding 0 + margin 0 + overflow-x hidden + text-size-adjust: 100% + ::selection + background sea-lighter + color froth +a + color link-color + &:hover + color link-hover-color + &:active + color link-active-color + &.disabled + color disabled-color +ul, menu, dir + margin 0 + padding 0 +img + max-width 100% + +button + outline: none + cursor pointer + +@import "_extend" +@import "_partial/layout" +@import "_partial/lists" +@import "_partial/categories" +@import "_partial/tag" +@import "_partial/ayer" +@import "_partial/search" +@import "_partial/article" +@import "_partial/articles" +@import "_partial/archive" +@import "_partial/footer" +@import "_partial/float" +@import "_partial/highlight" +@import "_partial/mobile" +@import "_partial/pace" +@import "_partial/gitalk" +@import "_partial/apple" + +if sidebar + @import "_partial/sidebar" + +// Media Query +@media (max-width: 768px) + html + font-size: 60% \ No newline at end of file diff --git a/source/fancybox/jquery.fancybox.min.css b/source/fancybox/jquery.fancybox.min.css new file mode 100644 index 0000000..5f943d6 --- /dev/null +++ b/source/fancybox/jquery.fancybox.min.css @@ -0,0 +1 @@ +body.compensate-for-scrollbar{overflow:hidden}.fancybox-active{height:auto}.fancybox-is-hidden{left:-9999px;margin:0;position:absolute!important;top:-9999px;visibility:hidden}.fancybox-container{-webkit-backface-visibility:hidden;height:100%;left:0;outline:none;position:fixed;-webkit-tap-highlight-color:transparent;top:0;-ms-touch-action:manipulation;touch-action:manipulation;-webkit-transform:translateZ(0);transform:translateZ(0);width:100%;z-index:99992}.fancybox-container *{box-sizing:border-box}.fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-stage{bottom:0;left:0;position:absolute;right:0;top:0}.fancybox-outer{-webkit-overflow-scrolling:touch;overflow-y:auto}.fancybox-bg{background:#1e1e1e;opacity:0;transition-duration:inherit;transition-property:opacity;transition-timing-function:cubic-bezier(.47,0,.74,.71)}.fancybox-is-open .fancybox-bg{opacity:.9;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-caption,.fancybox-infobar,.fancybox-navigation .fancybox-button,.fancybox-toolbar{direction:ltr;opacity:0;position:absolute;transition:opacity .25s ease,visibility 0s ease .25s;visibility:hidden;z-index:99997}.fancybox-show-caption .fancybox-caption,.fancybox-show-infobar .fancybox-infobar,.fancybox-show-nav .fancybox-navigation .fancybox-button,.fancybox-show-toolbar .fancybox-toolbar{opacity:1;transition:opacity .25s ease 0s,visibility 0s ease 0s;visibility:visible}.fancybox-infobar{color:#ccc;font-size:13px;-webkit-font-smoothing:subpixel-antialiased;height:44px;left:0;line-height:44px;min-width:44px;mix-blend-mode:difference;padding:0 10px;pointer-events:none;top:0;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-toolbar{right:0;top:0}.fancybox-stage{direction:ltr;overflow:visible;-webkit-transform:translateZ(0);transform:translateZ(0);z-index:99994}.fancybox-is-open .fancybox-stage{overflow:hidden}.fancybox-slide{-webkit-backface-visibility:hidden;display:none;height:100%;left:0;outline:none;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:absolute;text-align:center;top:0;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform;white-space:normal;width:100%;z-index:99994}.fancybox-slide:before{content:"";display:inline-block;font-size:0;height:100%;vertical-align:middle;width:0}.fancybox-is-sliding .fancybox-slide,.fancybox-slide--current,.fancybox-slide--next,.fancybox-slide--previous{display:block}.fancybox-slide--image{overflow:hidden;padding:44px 0}.fancybox-slide--image:before{display:none}.fancybox-slide--html{padding:6px}.fancybox-content{background:#fff;display:inline-block;margin:0;max-width:100%;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:relative;text-align:left;vertical-align:middle}.fancybox-slide--image .fancybox-content{-webkit-animation-timing-function:cubic-bezier(.5,0,.14,1);animation-timing-function:cubic-bezier(.5,0,.14,1);-webkit-backface-visibility:hidden;background:transparent;background-repeat:no-repeat;background-size:100% 100%;left:0;max-width:none;overflow:visible;padding:0;position:absolute;top:0;-webkit-transform-origin:top left;transform-origin:top left;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;z-index:99995}.fancybox-can-zoomOut .fancybox-content{cursor:zoom-out}.fancybox-can-zoomIn .fancybox-content{cursor:zoom-in}.fancybox-can-pan .fancybox-content,.fancybox-can-swipe .fancybox-content{cursor:-webkit-grab;cursor:grab}.fancybox-is-grabbing .fancybox-content{cursor:-webkit-grabbing;cursor:grabbing}.fancybox-container [data-selectable=true]{cursor:text}.fancybox-image,.fancybox-spaceball{background:transparent;border:0;height:100%;left:0;margin:0;max-height:none;max-width:none;padding:0;position:absolute;top:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.fancybox-spaceball{z-index:1}.fancybox-slide--iframe .fancybox-content,.fancybox-slide--map .fancybox-content,.fancybox-slide--pdf .fancybox-content,.fancybox-slide--video .fancybox-content{height:100%;overflow:visible;padding:0;width:100%}.fancybox-slide--video .fancybox-content{background:#000}.fancybox-slide--map .fancybox-content{background:#e5e3df}.fancybox-slide--iframe .fancybox-content{background:#fff}.fancybox-iframe,.fancybox-video{background:transparent;border:0;display:block;height:100%;margin:0;overflow:hidden;padding:0;width:100%}.fancybox-iframe{left:0;position:absolute;top:0}.fancybox-error{background:#fff;cursor:default;max-width:400px;padding:40px;width:100%}.fancybox-error p{color:#444;font-size:16px;line-height:20px;margin:0;padding:0}.fancybox-button{background:rgba(30,30,30,.6);border:0;border-radius:0;box-shadow:none;cursor:pointer;display:inline-block;height:44px;margin:0;padding:10px;position:relative;transition:color .2s;vertical-align:top;visibility:inherit;width:44px}.fancybox-button,.fancybox-button:link,.fancybox-button:visited{color:#ccc}.fancybox-button:hover{color:#fff}.fancybox-button:focus{outline:none}.fancybox-button.fancybox-focus{outline:1px dotted}.fancybox-button[disabled],.fancybox-button[disabled]:hover{color:#888;cursor:default;outline:none}.fancybox-button div{height:100%}.fancybox-button svg{display:block;height:100%;overflow:visible;position:relative;width:100%}.fancybox-button svg path{fill:currentColor;stroke-width:0}.fancybox-button--fsenter svg:nth-child(2),.fancybox-button--fsexit svg:nth-child(1),.fancybox-button--pause svg:nth-child(1),.fancybox-button--play svg:nth-child(2){display:none}.fancybox-progress{background:#ff5268;height:2px;left:0;position:absolute;right:0;top:0;-webkit-transform:scaleX(0);transform:scaleX(0);-webkit-transform-origin:0;transform-origin:0;transition-property:-webkit-transform;transition-property:transform;transition-property:transform,-webkit-transform;transition-timing-function:linear;z-index:99998}.fancybox-close-small{background:transparent;border:0;border-radius:0;color:#ccc;cursor:pointer;opacity:.8;padding:8px;position:absolute;right:-12px;top:-44px;z-index:401}.fancybox-close-small:hover{color:#fff;opacity:1}.fancybox-slide--html .fancybox-close-small{color:currentColor;padding:10px;right:0;top:0}.fancybox-slide--image.fancybox-is-scaling .fancybox-content{overflow:hidden}.fancybox-is-scaling .fancybox-close-small,.fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small{display:none}.fancybox-navigation .fancybox-button{background-clip:content-box;height:100px;opacity:0;position:absolute;top:calc(50% - 50px);width:70px}.fancybox-navigation .fancybox-button div{padding:7px}.fancybox-navigation .fancybox-button--arrow_left{left:0;padding:31px 26px 31px 6px}.fancybox-navigation .fancybox-button--arrow_right{padding:31px 6px 31px 26px;right:0}.fancybox-caption{bottom:0;color:#eee;font-size:14px;font-weight:400;left:0;line-height:1.5;padding:25px 44px;right:0;text-align:center;z-index:99996}.fancybox-caption:before{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAD6CAQAAADKSeXYAAAAYklEQVQoz42RwQ3AMAgDjfcfup8WoRykfBAK5mQHKSz5rbXJPis1hjiV3CIqgG0hLZPkVkA4p4x5oR1bVeDrdCLrW2Q0D5bcwY3TGMHbdw3mPRuOtaspYP1w//G1OIcW148H0DMCqI/3mMMAAAAASUVORK5CYII=);background-repeat:repeat-x;background-size:contain;bottom:0;content:"";display:block;left:0;pointer-events:none;position:absolute;right:0;top:-44px;z-index:-1}.fancybox-caption a,.fancybox-caption a:link,.fancybox-caption a:visited{color:#ccc;text-decoration:none}.fancybox-caption a:hover{color:#fff;text-decoration:underline}.fancybox-loading{-webkit-animation:a 1s linear infinite;animation:a 1s linear infinite;background:transparent;border:4px solid #888;border-bottom-color:#fff;border-radius:50%;height:50px;left:50%;margin:-25px 0 0 -25px;opacity:.7;padding:0;position:absolute;top:50%;width:50px;z-index:99999}@-webkit-keyframes a{to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}@keyframes a{to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}.fancybox-animated{transition-timing-function:cubic-bezier(0,0,.25,1)}.fancybox-fx-slide.fancybox-slide--previous{opacity:0;-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}.fancybox-fx-slide.fancybox-slide--next{opacity:0;-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}.fancybox-fx-slide.fancybox-slide--current{opacity:1;-webkit-transform:translateZ(0);transform:translateZ(0)}.fancybox-fx-fade.fancybox-slide--next,.fancybox-fx-fade.fancybox-slide--previous{opacity:0;transition-timing-function:cubic-bezier(.19,1,.22,1)}.fancybox-fx-fade.fancybox-slide--current{opacity:1}.fancybox-fx-zoom-in-out.fancybox-slide--previous{opacity:0;-webkit-transform:scale3d(1.5,1.5,1.5);transform:scale3d(1.5,1.5,1.5)}.fancybox-fx-zoom-in-out.fancybox-slide--next{opacity:0;-webkit-transform:scale3d(.5,.5,.5);transform:scale3d(.5,.5,.5)}.fancybox-fx-zoom-in-out.fancybox-slide--current{opacity:1;-webkit-transform:scaleX(1);transform:scaleX(1)}.fancybox-fx-rotate.fancybox-slide--previous{opacity:0;-webkit-transform:rotate(-1turn);transform:rotate(-1turn)}.fancybox-fx-rotate.fancybox-slide--next{opacity:0;-webkit-transform:rotate(1turn);transform:rotate(1turn)}.fancybox-fx-rotate.fancybox-slide--current{opacity:1;-webkit-transform:rotate(0deg);transform:rotate(0deg)}.fancybox-fx-circular.fancybox-slide--previous{opacity:0;-webkit-transform:scale3d(0,0,0) translate3d(-100%,0,0);transform:scale3d(0,0,0) translate3d(-100%,0,0)}.fancybox-fx-circular.fancybox-slide--next{opacity:0;-webkit-transform:scale3d(0,0,0) translate3d(100%,0,0);transform:scale3d(0,0,0) translate3d(100%,0,0)}.fancybox-fx-circular.fancybox-slide--current{opacity:1;-webkit-transform:scaleX(1) translateZ(0);transform:scaleX(1) translateZ(0)}.fancybox-fx-tube.fancybox-slide--previous{-webkit-transform:translate3d(-100%,0,0) scale(.1) skew(-10deg);transform:translate3d(-100%,0,0) scale(.1) skew(-10deg)}.fancybox-fx-tube.fancybox-slide--next{-webkit-transform:translate3d(100%,0,0) scale(.1) skew(10deg);transform:translate3d(100%,0,0) scale(.1) skew(10deg)}.fancybox-fx-tube.fancybox-slide--current{-webkit-transform:translateZ(0) scale(1);transform:translateZ(0) scale(1)}@media (max-height:576px){.fancybox-caption{padding:12px}.fancybox-slide{padding-left:6px;padding-right:6px}.fancybox-slide--image{padding:6px 0}.fancybox-close-small{right:-6px}.fancybox-slide--image .fancybox-close-small{background:#4e4e4e;color:#f2f4f6;height:36px;opacity:1;padding:6px;right:0;top:0;width:36px}}.fancybox-share{background:#f4f4f4;border-radius:3px;max-width:90%;padding:30px;text-align:center}.fancybox-share h1{color:#222;font-size:35px;font-weight:700;margin:0 0 20px}.fancybox-share p{margin:0;padding:0}.fancybox-share__button{border:0;border-radius:3px;display:inline-block;font-size:14px;font-weight:700;line-height:40px;margin:0 5px 10px;min-width:130px;padding:0 15px;text-decoration:none;transition:all .2s;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;white-space:nowrap}.fancybox-share__button:link,.fancybox-share__button:visited{color:#fff}.fancybox-share__button:hover{text-decoration:none}.fancybox-share__button--fb{background:#3b5998}.fancybox-share__button--fb:hover{background:#344e86}.fancybox-share__button--pt{background:#bd081d}.fancybox-share__button--pt:hover{background:#aa0719}.fancybox-share__button--tw{background:#1da1f2}.fancybox-share__button--tw:hover{background:#0d95e8}.fancybox-share__button svg{height:25px;margin-right:7px;position:relative;top:-1px;vertical-align:middle;width:25px}.fancybox-share__button svg path{fill:#fff}.fancybox-share__input{background:transparent;border:0;border-bottom:1px solid #d7d7d7;border-radius:0;color:#5d5b5b;font-size:14px;margin:10px 0 0;outline:none;padding:10px 15px;width:100%}.fancybox-thumbs{background:#ddd;bottom:0;display:none;margin:0;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar;padding:2px 2px 4px;position:absolute;right:0;-webkit-tap-highlight-color:transparent;top:0;width:212px;z-index:99995}.fancybox-thumbs-x{overflow-x:auto;overflow-y:hidden}.fancybox-show-thumbs .fancybox-thumbs{display:block}.fancybox-show-thumbs .fancybox-inner{right:212px}.fancybox-thumbs__list{font-size:0;height:100%;list-style:none;margin:0;overflow-x:hidden;overflow-y:auto;padding:0;position:absolute;position:relative;white-space:nowrap;width:100%}.fancybox-thumbs-x .fancybox-thumbs__list{overflow:hidden}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar{width:7px}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track{background:#fff;border-radius:10px;box-shadow:inset 0 0 6px rgba(0,0,0,.3)}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb{background:#2a2a2a;border-radius:10px}.fancybox-thumbs__list a{-webkit-backface-visibility:hidden;backface-visibility:hidden;background-color:rgba(0,0,0,.1);background-position:50%;background-repeat:no-repeat;background-size:cover;cursor:pointer;float:left;height:75px;margin:2px;max-height:calc(100% - 8px);max-width:calc(50% - 4px);outline:none;overflow:hidden;padding:0;position:relative;-webkit-tap-highlight-color:transparent;width:100px}.fancybox-thumbs__list a:before{border:6px solid #ff5268;bottom:0;content:"";left:0;opacity:0;position:absolute;right:0;top:0;transition:all .2s cubic-bezier(.25,.46,.45,.94);z-index:99991}.fancybox-thumbs__list a:focus:before{opacity:.5}.fancybox-thumbs__list a.fancybox-thumbs-active:before{opacity:1}@media (max-width:576px){.fancybox-thumbs{width:110px}.fancybox-show-thumbs .fancybox-inner{right:110px}.fancybox-thumbs__list a{max-width:calc(100% - 10px)}} \ No newline at end of file diff --git a/source/fancybox/jquery.fancybox.min.js b/source/fancybox/jquery.fancybox.min.js new file mode 100644 index 0000000..346328e --- /dev/null +++ b/source/fancybox/jquery.fancybox.min.js @@ -0,0 +1,13 @@ +// ================================================== +// fancyBox v3.5.2 +// +// Licensed GPLv3 for open source use +// or fancyBox Commercial License for commercial use +// +// http://fancyapps.com/fancybox/ +// Copyright 2018 fancyApps +// +// ================================================== +!function(t,e,n,o){"use strict";function a(t,e){var o,a,i,s=[],r=0;t&&t.isDefaultPrevented()||(t.preventDefault(),e=e||{},t&&t.data&&(e=h(t.data.options,e)),o=e.$target||n(t.currentTarget).trigger("blur"),i=n.fancybox.getInstance(),i&&i.$trigger&&i.$trigger.is(o)||(e.selector?s=n(e.selector):(a=o.attr("data-fancybox")||"",a?(s=t.data?t.data.items:[],s=s.length?s.filter('[data-fancybox="'+a+'"]'):n('[data-fancybox="'+a+'"]')):s=[o]),r=n(s).index(o),r<0&&(r=0),i=n.fancybox.open(s,e,r),i.$trigger=o))}if(t.console=t.console||{info:function(t){}},n){if(n.fn.fancybox)return void console.info("fancyBox already initialized");var i={closeExisting:!1,loop:!1,gutter:50,keyboard:!0,preventCaptionOverlap:!0,arrows:!0,infobar:!0,smallBtn:"auto",toolbar:"auto",buttons:["zoom","slideShow","thumbs","close"],idleTime:3,protect:!1,modal:!1,image:{preload:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'',preload:!0,css:{},attr:{scrolling:"auto"}},video:{tpl:'',format:"",autoStart:!0},defaultType:"image",animationEffect:"zoom",animationDuration:366,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'',spinnerTpl:'
',errorTpl:'

{{ERROR}}

',btnTpl:{download:'',zoom:'',close:'',arrowLeft:'',arrowRight:'',smallBtn:''},parentEl:"body",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded.
Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schliessen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden.
Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Maßstab"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},d=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),u=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),f=function(){var t,n=e.createElement("fakeelement"),a={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in a)if(n.style[t]!==o)return a[t];return"transitionend"}(),p=function(t){return t&&t.length&&t[0].offsetHeight},h=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,function(t,e){n.isArray(e)&&(o[t]=e)}),o},g=function(t){var o,a;return!(!t||t.ownerDocument!==e)&&(n(".fancybox-container").css("pointer-events","none"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},a=e.elementFromPoint(o.x,o.y)===t,n(".fancybox-container").css("pointer-events",""),a)},b=function(t,e,o){var a=this;a.opts=h({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(a.opts=h(a.opts,e)),n.fancybox.isMobile&&(a.opts=h(a.opts,a.opts.mobile)),a.id=a.opts.id||++c,a.currIndex=parseInt(a.opts.index,10)||0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=!0,a.group=[],a.slides={},a.addContent(t),a.group.length&&a.init()};n.extend(b.prototype,{init:function(){var o,a,i=this,s=i.group[i.currIndex],r=s.opts;r.closeExisting&&n.fancybox.close(!0),n("body").addClass("fancybox-active"),!n.fancybox.getInstance()&&r.hideScrollbar!==!1&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n("head").append('"),n("body").addClass("compensate-for-scrollbar")),a="",n.each(r.buttons,function(t,e){a+=r.btnTpl[e]||""}),o=n(i.translate(i,r.baseTpl.replace("{{buttons}}",a).replace("{{arrows}}",r.btnTpl.arrowLeft+r.btnTpl.arrowRight))).attr("id","fancybox-container-"+i.id).addClass(r.baseClass).data("FancyBox",i).appendTo(r.parentEl),i.$refs={container:o},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){i.$refs[t]=o.find(".fancybox-"+t)}),i.trigger("onInit"),i.activate(),i.jumpTo(i.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]||t.opts.i18n.en;return e.replace(/\{\{(\w+)\}\}/g,function(t,e){var a=n[e];return a===o?t:a})},addContent:function(t){var e,a=this,i=n.makeArray(t);n.each(i,function(t,e){var i,s,r,c,l,d={},u={};n.isPlainObject(e)?(d=e,u=e.opts||e):"object"===n.type(e)&&n(e).length?(i=n(e),u=i.data()||{},u=n.extend(!0,{},u,u.options),u.$orig=i,d.src=a.opts.src||u.src||i.attr("href"),d.type||d.src||(d.type="inline",d.src=e)):d={type:"html",src:e+""},d.opts=n.extend(!0,{},a.opts,u),n.isArray(u.buttons)&&(d.opts.buttons=u.buttons),n.fancybox.isMobile&&d.opts.mobile&&(d.opts=h(d.opts,d.opts.mobile)),s=d.type||d.opts.type,c=d.src||"",!s&&c&&((r=c.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))?(s="video",d.opts.video.format||(d.opts.video.format="video/"+("ogv"===r[1]?"ogg":r[1]))):c.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?s="image":c.match(/\.(pdf)((\?|#).*)?$/i)?(s="iframe",d=n.extend(!0,d,{contentType:"pdf",opts:{iframe:{preload:!1}}})):"#"===c.charAt(0)&&(s="inline")),s?d.type=s:a.trigger("objectNeedsType",d),d.contentType||(d.contentType=n.inArray(d.type,["html","inline","ajax"])>-1?"html":d.type),d.index=a.group.length,"auto"==d.opts.smallBtn&&(d.opts.smallBtn=n.inArray(d.type,["html","inline","ajax"])>-1),"auto"===d.opts.toolbar&&(d.opts.toolbar=!d.opts.smallBtn),d.$thumb=d.opts.$thumb||null,d.opts.$trigger&&d.index===a.opts.index&&(d.$thumb=d.opts.$trigger.find("img:first"),d.$thumb.length&&(d.opts.$orig=d.opts.$trigger)),d.$thumb&&d.$thumb.length||!d.opts.$orig||(d.$thumb=d.opts.$orig.find("img:first")),d.$thumb&&!d.$thumb.length&&(d.$thumb=null),d.thumb=d.opts.thumb||(d.$thumb?d.$thumb[0].src:null),"function"===n.type(d.opts.caption)&&(d.opts.caption=d.opts.caption.apply(e,[a,d])),"function"===n.type(a.opts.caption)&&(d.opts.caption=a.opts.caption.apply(e,[a,d])),d.opts.caption instanceof n||(d.opts.caption=d.opts.caption===o?"":d.opts.caption+""),"ajax"===d.type&&(l=c.split(/\s+/,2),l.length>1&&(d.src=l.shift(),d.opts.filter=l.shift())),d.opts.modal&&(d.opts=n.extend(!0,d.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),a.group.push(d)}),Object.keys(a.slides).length&&(a.updateControls(),e=a.Thumbs,e&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("touchstart.fb-prev click.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("touchstart.fb-next click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}).on("click.fb","[data-fancybox-zoom]",function(t){e[e.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?(e.requestId&&u(e.requestId),e.requestId=d(function(){e.update(t)})):(e.current&&"iframe"===e.current.type&&e.$refs.stage.hide(),setTimeout(function(){e.$refs.stage.show(),e.update(t)},n.fancybox.isMobile?600:250))}),r.on("keydown.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null,a=o.current,i=t.keyCode||t.which;if(9==i)return void(a.opts.trapFocus&&e.focus(t));if(!(!a.opts.keyboard||t.ctrlKey||t.altKey||t.shiftKey||n(t.target).is("input")||n(t.target).is("textarea")))return 8===i||27===i?(t.preventDefault(),void e.close(t)):37===i||38===i?(t.preventDefault(),void e.previous()):39===i||40===i?(t.preventDefault(),void e.next()):void e.trigger("afterKeydown",t,i)}),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1}),e.idleInterval=t.setInterval(function(){e.idleSecondsCounter++,e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var a,i,s,r,c,l,d,u,f,h=this,g=h.group.length;if(!(h.isDragging||h.isClosing||h.isAnimating&&h.firstRun)){if(t=parseInt(t,10),s=h.current?h.current.opts.loop:h.opts.loop,!s&&(t<0||t>=g))return!1;if(a=h.firstRun=!Object.keys(h.slides).length,c=h.current,h.prevIndex=h.currIndex,h.prevPos=h.currPos,r=h.createSlide(t),g>1&&((s||r.index0)&&h.createSlide(t-1)),h.current=r,h.currIndex=r.index,h.currPos=r.pos,h.trigger("beforeShow",a),h.updateControls(),r.forcedDuration=o,n.isNumeric(e)?r.forcedDuration=e:e=r.opts[a?"animationDuration":"transitionDuration"],e=parseInt(e,10),i=h.isMoved(r),r.$slide.addClass("fancybox-slide--current"),a)return r.opts.animationEffect&&e&&h.$refs.container.css("transition-duration",e+"ms"),h.$refs.container.addClass("fancybox-is-open").trigger("focus"),h.loadSlide(r),void h.preload("image");l=n.fancybox.getTranslate(c.$slide),d=n.fancybox.getTranslate(h.$refs.stage),n.each(h.slides,function(t,e){n.fancybox.stop(e.$slide,!0)}),c.pos!==r.pos&&(c.isComplete=!1),c.$slide.removeClass("fancybox-slide--complete fancybox-slide--current"),i?(f=l.left-(c.pos*l.width+c.pos*c.opts.gutter),n.each(h.slides,function(t,o){o.$slide.removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")});var a=o.pos*l.width+o.pos*o.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:a-d.left+f}),o.pos!==r.pos&&o.$slide.addClass("fancybox-slide--"+(o.pos>r.pos?"next":"previous")),p(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-r.pos)*l.width+(o.pos-r.pos)*o.opts.gutter},e,function(){o.$slide.css({transform:"",opacity:""}).removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===h.currPos&&h.complete()})})):e&&r.opts.transitionEffect&&(u="fancybox-animated fancybox-fx-"+r.opts.transitionEffect,c.$slide.addClass("fancybox-slide--"+(c.pos>r.pos?"next":"previous")),n.fancybox.animate(c.$slide,u,e,function(){c.$slide.removeClass(u).removeClass("fancybox-slide--next fancybox-slide--previous")},!1)),r.isLoaded?h.revealContent(r):h.loadSlide(r),h.preload("image")}},createSlide:function(t){var e,o,a=this;return o=t%a.group.length,o=o<0?a.group.length+o:o,!a.slides[t]&&a.group[o]&&(e=n('
').appendTo(a.$refs.stage),a.slides[t]=n.extend(!0,{},a.group[o],{pos:t,$slide:e,isLoaded:!1}),a.updateSlide(a.slides[t])),a.slides[t]},scaleToActual:function(t,e,a){var i,s,r,c,l,d=this,u=d.current,f=u.$content,p=n.fancybox.getTranslate(u.$slide).width,h=n.fancybox.getTranslate(u.$slide).height,g=u.width,b=u.height;d.isAnimating||d.isMoved()||!f||"image"!=u.type||!u.isLoaded||u.hasError||(d.isAnimating=!0,n.fancybox.stop(f),t=t===o?.5*p:t,e=e===o?.5*h:e,i=n.fancybox.getTranslate(f),i.top-=n.fancybox.getTranslate(u.$slide).top,i.left-=n.fancybox.getTranslate(u.$slide).left,c=g/i.width,l=b/i.height,s=.5*p-.5*g,r=.5*h-.5*b,g>p&&(s=i.left*c-(t*c-t),s>0&&(s=0),sh&&(r=i.top*l-(e*l-e),r>0&&(r=0),re-.5&&(l=e),d>o-.5&&(d=o),"image"===t.type?(u.top=Math.floor(.5*(o-d))+parseFloat(c.css("paddingTop")),u.left=Math.floor(.5*(e-l))+parseFloat(c.css("paddingLeft"))):"video"===t.contentType&&(i=t.opts.width&&t.opts.height?l/d:t.opts.ratio||16/9,d>l/i?d=l/i:l>d*i&&(l=d*i)),u.width=l,u.height=d,u)},update:function(t){var e=this;n.each(e.slides,function(n,o){e.updateSlide(o,t)})},updateSlide:function(t,e){var o=this,a=t&&t.$content,i=t.width||t.opts.width,s=t.height||t.opts.height,r=t.$slide;o.adjustCaption(t),a&&(i||s||"video"===t.contentType)&&!t.hasError&&(n.fancybox.stop(a),n.fancybox.setTranslate(a,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger("refresh"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(".fancybox-button--arrow_right")).toggleClass("compensate-for-scrollbar",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger("onUpdate",t,e)},centerSlide:function(t){var e=this,a=e.current,i=a.$slide;!e.isClosing&&a&&(i.siblings().css({transform:"",opacity:""}),i.parent().children().removeClass("fancybox-slide--previous fancybox-slide--next"),n.fancybox.animate(i,{top:0,left:0,opacity:1},t===o?0:t,function(){i.css({transform:"",opacity:""}),a.isComplete||e.complete()},!1))},isMoved:function(t){var e,o,a=t||this.current;return!!a&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(a.$slide),!a.$slide.hasClass("fancybox-animated")&&(Math.abs(e.top-o.top)>.5||Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,a,i=this,s=i.current,r=i.$refs.container;s&&!i.isClosing&&i.Guestures&&(r.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan"),o=i.canPan(t,e),a=!!o||i.isZoomable(),r.toggleClass("fancybox-is-zoomable",a),n("[data-fancybox-zoom]").prop("disabled",!a),o?r.addClass("fancybox-can-pan"):a&&("zoom"===s.opts.clickContent||n.isFunction(s.opts.clickContent)&&"zoom"==s.opts.clickContent(s))?r.addClass("fancybox-can-zoomIn"):s.opts.touch&&(s.opts.touch.vertical||i.group.length>1)&&"video"!==s.contentType&&r.addClass("fancybox-can-swipe"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&"image"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if(t=e.getFitPos(n),t&&(n.width>t.width||n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var a=this,i=!1,s=a.current,r=s.$content;return t!==o&&e!==o?i=t1.5||Math.abs(s.height-r.height)>1.5)),r},loadSlide:function(t){var e,o,a,i=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,i.trigger("beforeLoad",t)===!1)return t.isLoading=!1,!1;switch(e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass(t.opts.slideClass),e){case"image":i.setImage(t);break;case"iframe":i.setIframe(t);break;case"html":i.setContent(t,t.src||t.content);break;case"video":i.setContent(t,t.opts.video.tpl.replace(/\{\{src\}\}/gi,t.src).replace("{{format}}",t.opts.videoFormat||t.opts.video.format||"").replace("{{poster}}",t.thumb||""));break;case"inline":n(t.src).length?i.setContent(t,n(t.src)):i.setError(t);break;case"ajax":i.showLoading(t),a=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&i.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&i.setError(t)}})),o.one("onReset",function(){a.abort()});break;default:i.setError(t)}return!0}},setImage:function(t){var o,a=this;setTimeout(function(){var e=t.$image;a.isClosing||!t.isLoading||e&&e.length&&e[0].complete||t.hasError||a.showLoading(t)},50),a.checkSrcset(t),t.$content=n('
').addClass("fancybox-is-hidden").appendTo(t.$slide.addClass("fancybox-slide--image")),t.opts.preload!==!1&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,o=e.createElement("img"),o.onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){a.afterLoad(t)},t.$ghost=n(o).addClass("fancybox-image").appendTo(t.$content).attr("src",t.thumb)),a.setBigImage(t)},checkSrcset:function(e){var n,o,a,i,s=e.opts.srcset||e.opts.image.srcset;if(s){a=t.devicePixelRatio||1,i=t.innerWidth*a,o=s.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);return 0===n?e.url=t:void(o&&(e.value=o,e.postfix=t[t.length-1]))}),e}),o.sort(function(t,e){return t.value-e.value});for(var r=0;r=i||"x"===c.postfix&&c.value>=a){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&"w"==n.postfix&&(e.height=e.width/e.height*n.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,a=e.createElement("img"),i=n(a);t.$image=i.one("error",function(){o.setError(t)}).one("load",function(){var e;t.$ghost||(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing||(t.opts.srcset&&(e=t.opts.sizes,e&&"auto"!==e||(e=(t.width/t.height>1&&s.width()/s.height()>1?"100":Math.round(t.width/t.height*100))+"vw"),i.attr("sizes",e).attr("srcset",t.opts.srcset)),t.$ghost&&setTimeout(function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(a.complete||"complete"==a.readyState)&&i.naturalWidth&&i.naturalHeight?i.trigger("load"):a.error&&i.trigger("error")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),a=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(o*n/e)),a>0&&(t.width=Math.floor(a*e/n),t.height=a)},setIframe:function(t){var e,a=this,i=t.opts.iframe,s=t.$slide;n.fancybox.isMobile&&(i.css.overflow="scroll"),t.$content=n('
').css(i.css).appendTo(s),s.addClass("fancybox-slide--"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(a.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),a.afterLoad(t)}),s.on("refresh.fb",function(){var n,a,r=t.$content,c=i.css.width,l=i.css.height;if(1===e[0].isReady){try{n=e.contents(),a=n.find("body")}catch(t){}a&&a.length&&a.children().length&&(s.css("overflow","visible"),r.css({width:"100%","max-width":"100%",height:"9999px"}),c===o&&(c=Math.ceil(Math.max(a[0].clientWidth,a.outerWidth(!0)))),r.css("width",c?c:"").css("max-width",""),l===o&&(l=Math.ceil(Math.max(a[0].clientHeight,a.outerHeight(!0)))),r.css("height",l?l:""),s.css("overflow","auto")),r.removeClass("fancybox-is-hidden")}})):a.afterLoad(t),e.attr("src",t.src),s.one("onReset",function(){try{n(this).find("iframe").hide().unbind().attr("src","//about:blank")}catch(t){}n(this).off("refresh.fb").empty(),t.isLoaded=!1,t.isRevealed=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),l(e)&&e.parent().length?((e.hasClass("fancybox-content")||e.parent().hasClass("fancybox-content"))&&e.parents(".fancybox-slide").trigger("onReset"),t.$placeholder=n("
").hide().insertAfter(e),e.css("display","inline-block")):t.hasError||("string"===n.type(e)&&(e=n("
").append(n.trim(e)).contents()),t.opts.filter&&(e=n("
").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.removeClass("fancybox-content").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is("video,audio")&&(n(e).addClass("fancybox-video"),n(e).wrap("
"),t.contentType="video",t.opts.width=t.opts.width||n(e).attr("width"),t.opts.height=t.opts.height||n(e).attr("height")),t.$content=t.$slide.children().filter("div,form,main,video,audio,article,.fancybox-content").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner("
").children().first()),t.$content.addClass("fancybox-content"),t.$slide.addClass("fancybox-slide--"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger("onReset").removeClass("fancybox-slide--"+t.contentType).addClass("fancybox-slide--error"),t.contentType="html",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;t=t||e.current,t&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn("fast"))},hideLoading:function(t){var e=this;t=t||e.current,t&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('
').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e=this,n=t||e.current,o=n.opts.caption,a=e.$refs.caption,i=!1;n.opts.preventCaptionOverlap&&o&&o.length&&(n.pos!==e.currPos?(a=a.clone().empty().appendTo(a.parent()),a.html(o),i=a.outerHeight(!0),a.empty().remove()):e.$caption&&(i=e.$caption.outerHeight(!0)),n.$slide.css("padding-bottom",i||""))},adjustLayout:function(t){var e,n,o,a,i=this,s=t||i.current;s.isLoaded&&s.opts.disableLayoutFix!==!0&&(s.$content.css("margin-bottom",""),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style["padding-bottom"],a=s.$slide.css("padding-bottom"),parseFloat(a)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css("padding-bottom",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=a),s.$slide.css("padding-bottom",o))),s.$content.css("margin-bottom",n))},revealContent:function(t){var e,a,i,s,r=this,c=t.$slide,l=!1,d=!1,u=r.isMoved(t),f=t.isRevealed;return t.isRevealed=!0,e=t.opts[r.firstRun?"animationEffect":"transitionEffect"],i=t.opts[r.firstRun?"animationDuration":"transitionDuration"],i=parseInt(t.forcedDuration===o?i:t.forcedDuration,10),!u&&t.pos===r.currPos&&i||(e=!1),"zoom"===e&&(t.pos===r.currPos&&i&&"image"===t.type&&!t.hasError&&(d=r.getThumbPos(t))?l=r.getFitPos(t):e="fade"),"zoom"===e?(r.isAnimating=!0,l.scaleX=l.width/d.width,l.scaleY=l.height/d.height,s=t.opts.zoomOpacity,"auto"==s&&(s=Math.abs(t.width/t.height-d.width/d.height)>.1),s&&(d.opacity=.1,l.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),d),p(t.$content),void n.fancybox.animate(t.$content,l,i,function(){r.isAnimating=!1,r.complete()})):(r.updateSlide(t),e?(n.fancybox.stop(c),a="fancybox-slide--"+(t.pos>=r.prevPos?"next":"previous")+" fancybox-animated fancybox-fx-"+e,c.addClass(a).removeClass("fancybox-slide--current"),t.$content.removeClass("fancybox-is-hidden"),p(c),"image"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(c,"fancybox-slide--current",i,function(){c.removeClass(a).css({transform:"",opacity:""}),t.pos===r.currPos&&r.complete()},!0)):(t.$content.removeClass("fancybox-is-hidden"),f||!u||"image"!==t.type||t.hasError||t.$content.hide().fadeIn("fast"),void(t.pos===r.currPos&&r.complete())))},getThumbPos:function(t){var e,o,a,i,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css("border-top-width")||0),a=parseFloat(c.css("border-right-width")||0),i=parseFloat(c.css("border-bottom-width")||0),s=parseFloat(c.css("border-left-width")||0),r={top:e.top+o,left:e.left+s,width:e.width-a-s,height:e.height-o-i,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,a={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),e.preload("inline"),p(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?a[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=a),e.isAnimating=!1,e.updateCursor(),e.trigger("afterShow"),o.opts.video.autoStart&&o.$slide.find("video,audio").filter(":visible:first").trigger("play").one("ended",function(){this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&"html"===o.contentType&&(t=o.$content.find("input[autofocus]:enabled:visible:first"),t.length?t.trigger("focus"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var a,i,s=this,r=["a[href]","area[href]",'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',"select:not([disabled]):not([aria-hidden])","textarea:not([disabled]):not([aria-hidden])","button:not([disabled]):not([aria-hidden])","iframe","object","embed","[contenteditable]",'[tabindex]:not([tabindex^="-"])'].join(",");s.isClosing||(a=!t&&s.current&&s.current.isComplete?s.current.$slide.find("*:visible"+(o?":not(.fancybox-close-small)":"")):s.$refs.container.find("*:visible"),a=a.filter(r).filter(function(){return"hidden"!==n(this).css("visibility")&&!n(this).hasClass("disabled")}),a.length?(i=a.index(e.activeElement),t&&t.shiftKey?(i<0||0==i)&&(t.preventDefault(),a.eq(a.length-1).trigger("focus")):(i<0||i==a.length-1)&&(t&&t.preventDefault(),a.eq(0).trigger("focus"))):s.$refs.container.trigger("focus"))},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,a,i,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,u.trigger("beforeClose",t)===!1?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),i=f.$content,o=f.opts.animationEffect,a=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),t!==!0?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger("onReset").remove(),a&&u.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing").css("transition-duration",a+"ms"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),"zoom"!==o||i&&a&&"image"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o="fade"),"zoom"===o?(n.fancybox.stop(i),s=n.fancybox.getTranslate(i),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,"auto"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(i,c),p(i),n.fancybox.animate(i,l,a,h),!0):(o&&a?n.fancybox.animate(f.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),"fancybox-animated fancybox-fx-"+o,a,h):t===!0?setTimeout(h,a):h(), +!0)))},cleanUp:function(e){var o,a,i,s=this,r=s.current.opts.$orig;s.current.$slide.trigger("onReset"),s.$refs.container.empty().remove(),s.trigger("afterClose",e),s.current.opts.backFocus&&(r&&r.length&&r.is(":visible")||(r=s.$trigger),r&&r.length&&(a=t.scrollX,i=t.scrollY,r.trigger("focus"),n("html, body").scrollTop(i).scrollLeft(a))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n("body").removeClass("fancybox-active compensate-for-scrollbar"),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,a=Array.prototype.slice.call(arguments,1),i=this,s=e&&e.opts?e:i.current;return s?a.unshift(s):s=i,a.unshift(i),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,a)),o===!1?o:void("afterClose"!==t&&i.$refs?i.$refs.container.trigger(t+".fb",a):r.trigger(t+".fb",a))},updateControls:function(){var t=this,o=t.current,a=o.index,i=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger("refresh"),t.$caption=r&&r.length?s.html(r):null,t.hasHiddenControls||t.isIdle||t.showControls(),i.find("[data-fancybox-count]").html(t.group.length),i.find("[data-fancybox-index]").html(a+1),i.find("[data-fancybox-prev]").prop("disabled",!o.opts.loop&&a<=0),i.find("[data-fancybox-next]").prop("disabled",!o.opts.loop&&a>=t.group.length-1),"image"===o.type?i.find("[data-fancybox-zoom]").show().end().find("[data-fancybox-download]").attr("href",o.opts.image.src||o.src).show():o.opts.toolbar&&i.find("[data-fancybox-download],[data-fancybox-zoom]").hide(),n(e.activeElement).is(":hidden,[disabled]")&&t.$refs.container.trigger("focus")},hideControls:function(t){var e=this,n=["infobar","toolbar","nav"];!t&&e.current.opts.preventCaptionOverlap||n.push("caption"),this.$refs.container.removeClass(n.map(function(t){return"fancybox-show-"+t}).join(" ")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar||!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-caption",!!t.$caption).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.5.2",defaults:i,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),t===!0&&this.close(t))},destroy:function(){this.close(!0),r.add("body").off("click.fb-start","**")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css("opacity"))})},setTranslate:function(t,e){var n="",a={};if(t&&e)return e.left===o&&e.top===o||(n=(e.left===o?t.position().left:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o?n+=" scale("+e.scaleX+", "+e.scaleY+")":e.scaleX!==o&&(n+=" scaleX("+e.scaleX+")"),n.length&&(a.transform=n),e.opacity!==o&&(a.opacity=e.opacity),e.width!==o&&(a.width=e.width),e.height!==o&&(a.height=e.height),t.css(a)},animate:function(t,e,a,i,s){var r,c=this;n.isFunction(a)&&(i=a,a=null),c.stop(t),r=c.getTranslate(t),t.on(f,function(l){(!l||!l.originalEvent||t.is(l.originalEvent.target)&&"z-index"!=l.originalEvent.propertyName)&&(c.stop(t),n.isNumeric(a)&&t.css("transition-duration",""),n.isPlainObject(e)?e.scaleX!==o&&e.scaleY!==o&&c.setTranslate(t,{top:e.top,left:e.left,width:r.width*e.scaleX,height:r.height*e.scaleY,scaleX:1,scaleY:1}):s!==!0&&t.removeClass(e),n.isFunction(i)&&i(l))}),n.isNumeric(a)&&t.css("transition-duration",a+"ms"),n.isPlainObject(e)?(e.scaleX!==o&&e.scaleY!==o&&(delete e.width,delete e.height,t.parent().hasClass("fancybox-slide--image")&&t.parent().addClass("fancybox-is-scaling")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data("timer",setTimeout(function(){t.trigger(f)},a+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data("timer")),e&&t.trigger(f),t.off(f).css("transition-duration",""),t.parent().removeClass("fancybox-is-scaling"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},a):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},a),this},r.on("click.fb-start","[data-fancybox]",a),r.on("click.fb-start","[data-fancybox-trigger]",function(t){n('[data-fancybox="'+n(this).attr("data-fancybox-trigger")+'"]').eq(n(this).attr("data-fancybox-index")||0).trigger("click.fb-start",{$trigger:n(this)})}),function(){var t=".fancybox-button",e="fancybox-focus",o=null;r.on("mousedown mouseup focus blur",t,function(a){switch(a.type){case"mousedown":o=n(this);break;case"mouseup":o=null;break;case"focusin":n(t).removeClass(e),n(this).is(o)||n(this).is("[disabled]")||n(this).addClass(e);break;case"focusout":n(t).removeClass(e)}})}()}}(window,document,jQuery),function(t){"use strict";var e={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"//www.youtube-nocookie.com/embed/$4",thumb:"//img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12]+"").replace(/\?/,"&")+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}},n=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n||"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e};t(document).on("objectNeedsType.fb",function(o,a,i){var s,r,c,l,d,u,f,p=i.src||"",h=!1;s=t.extend(!0,{},e,i.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],"?"==d[0]&&(d=d.substring(1)),d=d.split("&");for(var a=0;a1&&("youtube"===n.contentSource||"vimeo"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),a=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),i=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,a=o.length;ee.clientHeight,i=("scroll"===o||"auto"===o)&&e.scrollWidth>e.clientWidth;return a||i},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass("fancybox-stage")||t.is("body"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};d.prototype.destroy=function(){var t=this;t.$container.off(".fb.touch"),n(e).off(".fb.touch"),t.requestId&&(a(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var a=this,c=n(o.target),d=a.instance,u=d.current,f=u.$slide,p=u.$content,h="touchstart"==o.type;if(h&&a.$container.off("mousedown.fb.touch"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass("fancybox-animated"))return o.stopPropagation(),void o.preventDefault();a.realPoints=a.startPoints=i(o),a.startPoints.length&&(u.touch&&o.stopPropagation(),a.startEvent=o,a.canTap=!0,a.$target=c,a.$content=p,a.opts=u.opts.touch,a.isPanning=!1,a.isSwiping=!1,a.isZooming=!1,a.isScrolling=!1,a.canPan=d.canPan(),a.startTime=(new Date).getTime(),a.distanceX=a.distanceY=a.distance=0,a.canvasWidth=Math.round(f[0].clientWidth),a.canvasHeight=Math.round(f[0].clientHeight),a.contentLastPos=null,a.contentStartPos=n.fancybox.getTranslate(a.$content)||{top:0,left:0},a.sliderStartPos=n.fancybox.getTranslate(f),a.stagePos=n.fancybox.getTranslate(d.$refs.stage),a.sliderStartPos.top-=a.stagePos.top,a.sliderStartPos.left-=a.stagePos.left,a.contentStartPos.top-=a.stagePos.top,a.contentStartPos.left-=a.stagePos.left,n(e).off(".fb.touch").on(h?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(a,"ontouchend")).on(h?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(a,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",a.onscroll,!0),((a.opts||a.canPan)&&(c.is(a.$stage)||a.$stage.find(c).length)||(c.is(".fancybox-image")&&o.preventDefault(),n.fancybox.isMobile&&c.hasClass("fancybox-caption")))&&(a.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&a.isScrollable||o.preventDefault(),(1===a.startPoints.length||u.hasError)&&(a.canPan?(n.fancybox.stop(a.$content),a.isPanning=!0):a.isSwiping=!0,a.$container.addClass("fancybox-is-grabbing")),2===a.startPoints.length&&"image"===u.type&&(u.isLoaded||u.$ghost)&&(a.canTap=!1,a.isSwiping=!1,a.isPanning=!1,a.isZooming=!0,n.fancybox.stop(a.$content),a.centerPointStartX=.5*(a.startPoints[0].x+a.startPoints[1].x)-n(t).scrollLeft(),a.centerPointStartY=.5*(a.startPoints[0].y+a.startPoints[1].y)-n(t).scrollTop(),a.percentageOfImageAtPinchPointX=(a.centerPointStartX-a.contentStartPos.left)/a.contentStartPos.width,a.percentageOfImageAtPinchPointY=(a.centerPointStartY-a.contentStartPos.top)/a.contentStartPos.height,a.startDistanceBetweenFingers=s(a.startPoints[0],a.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener("scroll",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=i(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&e.isSwiping===!0||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var i,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(c!==!0)"x"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:"x"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(a(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping="y":r.isDragging||s.opts.vertical===!1||"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(i=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=i>45&&i<135?"y":"x"),"y"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,a;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),a=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:"",opacity:"","transition-duration":""}).removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-a.top,s.sliderStartPos.left=o.left-a.left),n.fancybox.setTranslate(e.$slide,{top:o.top-a.top,left:o.left-a.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;return s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5)?void(t.startPoints=t.newPoints):(t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&a(t.requestId),void(t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})))},d.prototype.limitMovement=function(){var t,e,n,o,a,i,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return a=h>r?f+l:f,i=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&a>t&&(a=t-1+Math.pow(-t+f+l,.8)||0),l<0&&a0&&i>e&&(i=e-1+Math.pow(-e+p+d,.8)||0),d<0&&ii?(t=t>0?0:t,t=ts?(e=e>0?0:e,e=e1&&(o.dMs>130&&s>10||s>50),c=300;o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),a=o.instance.close(!0,250)):r&&o.distanceX>0?a=o.instance.previous(c):r&&o.distanceX<0&&(a=o.instance.next(c)),a!==!1||"x"!=t&&"y"!=t||o.instance.centerSlide(200),o.$container.removeClass("fancybox-is-sliding")},d.prototype.endPanning=function(){var t,e,o,a=this;a.contentLastPos&&(a.opts.momentum===!1||a.dMs>350?(t=a.contentLastPos.left,e=a.contentLastPos.top):(t=a.contentLastPos.left+500*a.velocityX,e=a.contentLastPos.top+500*a.velocityY),o=a.limitPosition(t,e,a.contentStartPos.width,a.contentStartPos.height),o.width=a.contentStartPos.width,o.height=a.contentStartPos.height,n.fancybox.animate(a.$content,o,330))},d.prototype.endZooming=function(){var t,e,o,a,i=this,s=i.instance.current,r=i.newWidth,c=i.newHeight;i.contentLastPos&&(t=i.contentLastPos.left,e=i.contentLastPos.top,a={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(i.$content,a),rs.width||c>s.height?i.instance.scaleToActual(i.centerPointStartX,i.centerPointStartY,150):(o=i.limitPosition(t,e,r,c),n.fancybox.animate(i.$content,o,150)))},d.prototype.onTap=function(e){var o,a=this,s=n(e.target),r=a.instance,c=r.current,l=e&&i(e)||a.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-a.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-a.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case"close":r.close(a.startEvent);break;case"toggleControls":r.toggleControls();break;case"next":r.next();break;case"nextOrClose":r.group.length>1?r.next():r.close(a.startEvent);break;case"zoom":"image"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(a.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is("img")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))o="Outside";else if(s.is(".fancybox-slide"))o="Slide";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o="Content"}if(a.tapped){if(clearTimeout(a.tapped),a.tapped=null,Math.abs(d-a.tapX)>50||Math.abs(u-a.tapY)>50)return this;f("dblclick"+o)}else a.tapX=d,a.tapY=u,c.opts["dblclick"+o]&&c.opts["dblclick"+o]!==c.opts["click"+o]?a.tapped=setTimeout(function(){a.tapped=null,r.isAnimating||f("click"+o)},500):f("click"+o);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:''},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('
').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,a=o.current;a&&(t===!0||a.opts.loop||o.currIndex'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.current.$content.css("transition","none"),n.isAnimating=!1,n.update(!0,!0,0)),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t),n.$refs.toolbar.find("[data-fancybox-fullscreen]").toggleClass("fancybox-button--fsenter",!t).toggleClass("fancybox-button--fsexit",t))})}e(t).on({"onInit.fb":function(t,e){var a;return n?void(e&&e.group[e.currIndex].opts.fullScreen?(a=e.$refs.container,a.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&e.opts.fullScreen.autoStart===!0&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()):void e.$refs.toolbar.find("[data-fancybox-fullscreen]").remove()},"afterKeydown.fb":function(t,e,n,o,a){e&&e.FullScreen&&70===a&&(o.preventDefault(),e.FullScreen.toggle())},"beforeClose.fb":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass("fancybox-is-fullscreen")&&o.exit()}})}(document,jQuery),function(t,e){"use strict";var n="fancybox-thumbs",o=n+"-active";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:''},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var a=function(t){this.init(t)};e.extend(a.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]");for(var a=0,i=n.length;a1));a++);o>1&&e.opts?(e.$button.removeAttr("style").on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,a=o.instance,i=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('
').appendTo(a.$refs.container.find(i).addBack().filter(i)),o.$grid.on("click","a",function(){a.jumpTo(e(this).attr("data-index"))})),o.$list||(o.$list=e('
').appendTo(o.$grid)),e.each(a.group,function(e,n){t=n.thumb,t||"image"!==n.type||(t=n.src),s.push('")}),o.$list[0].innerHTML=s.join(""),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"),10)+a.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,a=this,i=a.$list,s=a.$grid;a.instance.current&&(e=i.children().removeClass(o).filter('[data-index="'+a.instance.current.index+'"]').addClass(o),n=e.position(),"y"===a.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===a.opts.axis&&(n.lefts.scrollLeft()+(s.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger("onThumbsShow"),t.focus(0)):t.$grid&&t.instance.trigger("onThumbsHide"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var n;e&&!e.Thumbs&&(n=new a(e),n.isActive&&n.opts.autoStart===!0&&n.show())},"beforeShow.fb":function(t,e,n,o){var a=e&&e.Thumbs;a&&a.isVisible&&a.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,a){var i=e&&e.Thumbs;i&&i.isActive&&71===a&&(o.preventDefault(),i.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&n.opts.hideOnClose!==!1&&n.$grid.hide()}})}(document,jQuery),function(t,e){"use strict";function n(t){var e={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:''},share:{url:function(t,e){return!t.currentHash&&"inline"!==e.type&&"html"!==e.type&&(e.origSrc||e.src)||window.location},tpl:'

{{SHARE}}

FacebookTwitterPinterest

' +}}),e(t).on("click","[data-fancybox-share]",function(){var t,o,a=e.fancybox.getInstance(),i=a.current||null;i&&("function"===e.type(i.opts.share.url)&&(t=i.opts.share.url.apply(i,[a,i])),o=i.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===i.type?encodeURIComponent(i.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,a.$caption?encodeURIComponent(a.$caption.text()):""),e.fancybox.open({src:a.translate(a,o),type:"html",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){a.$refs.container.one("beforeClose.fb",function(){t.close(null,0)}),e.$content.find(".fancybox-share__button").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){"use strict";function o(){var e=t.location.hash.substr(1),n=e.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,a=n.join("-");return{hash:e,index:o<1?1:o,gallery:a}}function a(t){""!==t.gallery&&n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1).focus().trigger("click.fb-start")}function i(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,n=e.hash||(e.$orig?e.$orig.data("fancybox")||e.$orig.data("fancybox-trigger"):""),""!==n&&n)}n.escapeSelector||(n.escapeSelector=function(t){var e=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,n=function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t};return(t+"").replace(e,n)}),n(function(){n.fancybox.defaults.hash!==!1&&(n(e).on({"onInit.fb":function(t,e){var n,a;e.group[e.currIndex].opts.hash!==!1&&(n=o(),a=i(e),a&&n.gallery&&a==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,a,s){var r;a&&a.opts.hash!==!1&&(r=i(o),r&&(o.currentHash=r+(o.group.length>1?"-"+(a.index+1):""),t.location.hash!=="#"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){"replaceState"in t.history?(t.history[s?"pushState":"replaceState"]({},e.title,t.location.pathname+t.location.search+"#"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300))))},"beforeClose.fb":function(n,o,a){a.opts.hash!==!1&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&("replaceState"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||"")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on("hashchange.fb",function(){var t=o(),e=null;n.each(n(".fancybox-container").get().reverse(),function(t,o){var a=n(o).data("FancyBox");if(a&&a.currentHash)return e=a,!1}),e?e.currentHash===t.gallery+"-"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):""!==t.gallery&&a(t)}),setTimeout(function(){n.fancybox.getInstance()||a(o())},50))})}(window,document,jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,a=(new Date).getTime();e.group.length<2||o.opts.wheel===!1||"auto"===o.opts.wheel&&"image"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")||(t=t.originalEvent||t,a-n<250||(n=a,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?"next":"previous"]())))})}})}(document,jQuery); \ No newline at end of file diff --git a/source/favicon.ico b/source/favicon.ico new file mode 100644 index 0000000..aaaca72 Binary files /dev/null and b/source/favicon.ico differ diff --git a/source/images/ayer-side.svg b/source/images/ayer-side.svg new file mode 100644 index 0000000..8442ea9 --- /dev/null +++ b/source/images/ayer-side.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/source/images/ayer.svg b/source/images/ayer.svg new file mode 100644 index 0000000..697a746 --- /dev/null +++ b/source/images/ayer.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/source/images/cover1.jpg b/source/images/cover1.jpg new file mode 100644 index 0000000..b78d86f Binary files /dev/null and b/source/images/cover1.jpg differ diff --git a/source/images/cover2.jpg b/source/images/cover2.jpg new file mode 100644 index 0000000..85133de Binary files /dev/null and b/source/images/cover2.jpg differ diff --git a/source/images/cover3.jpg b/source/images/cover3.jpg new file mode 100644 index 0000000..e753d23 Binary files /dev/null and b/source/images/cover3.jpg differ diff --git a/source/images/cover4.jpg b/source/images/cover4.jpg new file mode 100644 index 0000000..b46cca3 Binary files /dev/null and b/source/images/cover4.jpg differ diff --git a/source/images/cover5.jpg b/source/images/cover5.jpg new file mode 100644 index 0000000..55b0243 Binary files /dev/null and b/source/images/cover5.jpg differ diff --git a/source/images/cover6.jpg b/source/images/cover6.jpg new file mode 100644 index 0000000..772deff Binary files /dev/null and b/source/images/cover6.jpg differ diff --git a/source/images/cover7.jpg b/source/images/cover7.jpg new file mode 100644 index 0000000..b80e482 Binary files /dev/null and b/source/images/cover7.jpg differ diff --git a/source/images/forrestgump.png b/source/images/forrestgump.png new file mode 100644 index 0000000..1870f41 Binary files /dev/null and b/source/images/forrestgump.png differ diff --git a/source/js/ayer.js b/source/js/ayer.js new file mode 100644 index 0000000..603cc6a --- /dev/null +++ b/source/js/ayer.js @@ -0,0 +1,209 @@ +(function ($) { + // + // Search ------------ + var $searchWrap = $('.search-form-wrap'), + isSearchAnim = false, + searchAnimDuration = 200; + + var startSearchAnim = function () { + isSearchAnim = true; + }; + + var stopSearchAnim = function (callback) { + setTimeout(function () { + isSearchAnim = false; + callback && callback(); + }, searchAnimDuration); + }; + + $('.nav-item-search').on('click', function () { + if (isSearchAnim) return; + startSearchAnim(); + $searchWrap.addClass('on'); + stopSearchAnim(function () { + $('.local-search-input').focus(); + }); + }); + + $(document).mouseup(function (e) { + var _con = $('.local-search'); + if (!_con.is(e.target) && _con.has(e.target).length === 0) { + $searchWrap.removeClass('on'); + } + }); + + // + // 移动设备侦测 + var isMobile = { + Android: function () { + return navigator.userAgent.match(/Android/i); + }, + BlackBerry: function () { + return navigator.userAgent.match(/BlackBerry/i); + }, + iOS: function () { + return navigator.userAgent.match(/iPhone|iPad|iPod/i); + }, + Opera: function () { + return navigator.userAgent.match(/Opera Mini/i); + }, + Windows: function () { + return navigator.userAgent.match(/IEMobile/i); + }, + any: function () { + return (isMobile.Android() || isMobile.BlackBerry() || isMobile.iOS() || isMobile.Opera() || isMobile.Windows()); + } + }; + + // + // 建议在移动端不初始化，其实 /search.xml 文件还挺大的， + if ($('.local-search').size() && !isMobile.any()) { + $.getScript('/js/search.js', function () { + searchFunc("/search.xml", 'local-search-input', 'local-search-result'); + }); + } + + // + // Share + $('body').on('click', function () { + $('.article-share-box.on').removeClass('on'); + }).on('click', '.article-share-link', function (e) { + e.stopPropagation(); + + var $this = $(this), + url = $this.attr('data-url'), + encodedUrl = encodeURIComponent(url), + id = 'article-share-box-' + $this.attr('data-id'), + offset = $this.offset(); + + if ($('#' + id).length) { + var box = $('#' + id); + + if (box.hasClass('on')) { + box.removeClass('on'); + return; + } + } else { + var html = [ + '
', + '', + '
', + '', + '', + '', + '', + '
', + '
' + ].join(''); + + var box = $(html); + $('body').append(box); + } + $('.article-share-box.on').hide(); + + box.css({ + top: offset.top + 25, + left: offset.left + }).addClass('on'); + }).on('click', '.article-share-box', function (e) { + e.stopPropagation(); + }).on('click', '.article-share-box-input', function () { + $(this).select(); + }).on('click', '.article-share-box-link', function (e) { + e.preventDefault(); + e.stopPropagation(); + + window.open(this.href, 'article-share-box-window-' + Date.now(), 'width=500,height=450'); + }); + + // + // fancybox + if ($.fancybox) { + $('[data-fancybox]').fancybox({ + protect: true + }); + } + + // + // lazyload + $("img.lazy").lazyload({ + effect : "fadeIn" + }); + + // + // justifiedGallery + $('#gallery').justifiedGallery({ + rowHeight : 200, + margins : 5 + }); + + // + $(document).ready(function ($) { + $('.anchor').click(function (event) { + event.preventDefault(); + $('main').animate({scrollTop: $(this.hash).offset().top}, 'smooth'); + }); + }); + + // To top + (function($) { + // When to show the scroll link + // higher number = scroll link appears further down the page + var upperLimit = 1000; + + // Our scroll link element + var scrollElem = $('#totop'); + + // Scroll to top speed + var scrollSpeed = 1600; + + // Show and hide the scroll to top link based on scroll position + scrollElem.hide(); + $('.content').scroll(function () { + var scrollTop = $('.content').scrollTop(); + if ( scrollTop > upperLimit ) { + $(scrollElem).stop().fadeTo(300, 1); // fade back in + }else{ + $(scrollElem).stop().fadeTo(300, 0); // fade out + } + }); + + // Scroll to top animation on click + $(scrollElem).click(function(){ + $('.content').animate({scrollTop:0}, scrollSpeed); return false; + }); + })(jQuery); + + // Mobile nav + var $content = $('.content'), + $sidebar = $('.sidebar'), + isMobileNavAnim = false, + mobileNavAnimDuration = 200; + + var startMobileNavAnim = function () { + isMobileNavAnim = true; + }; + + var stopMobileNavAnim = function () { + setTimeout(function () { + isMobileNavAnim = false; + }, mobileNavAnimDuration); + }; + + $('.navbar-toggle').on('click', function () { + if (isMobileNavAnim) return; + startMobileNavAnim(); + $content.toggleClass('on'); + $sidebar.toggleClass('on'); + stopMobileNavAnim(); + }); + + $($content).on('click', function () { + if (isMobileNavAnim || !$content.hasClass('on')) return; + $content.removeClass('on'); + $sidebar.removeClass('on'); + }); + +})(jQuery); + + diff --git a/source/js/busuanzi-2.3.pure.min.js b/source/js/busuanzi-2.3.pure.min.js new file mode 100644 index 0000000..25cd681 --- /dev/null +++ b/source/js/busuanzi-2.3.pure.min.js @@ -0,0 +1 @@ +var bszCaller,bszTag;!function(){var c,d,e,a=!1,b=[];ready=function(c){return a||"interactive"===document.readyState||"complete"===document.readyState?c.call(document):b.push(function(){return c.call(this)}),this},d=function(){for(var a=0,c=b.length;c>a;a++)b[a].apply(document);b=[]},e=function(){a||(a=!0,d.call(window),document.removeEventListener?document.removeEventListener("DOMContentLoaded",e,!1):document.attachEvent&&(document.detachEvent("onreadystatechange",e),window==window.top&&(clearInterval(c),c=null)))},document.addEventListener?document.addEventListener("DOMContentLoaded",e,!1):document.attachEvent&&(document.attachEvent("onreadystatechange",function(){/loaded|complete/.test(document.readyState)&&e()}),window==window.top&&(c=setInterval(function(){try{a||document.documentElement.doScroll("left")}catch(b){return}e()},5)))}(),bszCaller={fetch:function(a,b){var c="BusuanziCallback_"+Math.floor(1099511627776*Math.random());window[c]=this.evalCall(b),a=a.replace("=BusuanziCallback","="+c),scriptTag=document.createElement("SCRIPT"),scriptTag.type="text/javascript",scriptTag.defer=!0,scriptTag.src=a,document.getElementsByTagName("HEAD")[0].appendChild(scriptTag)},evalCall:function(a){return function(b){ready(function(){try{a(b),scriptTag.parentElement.removeChild(scriptTag)}catch(c){bszTag.hides()}})}}},bszCaller.fetch("//busuanzi.ibruce.info/busuanzi?jsonpCallback=BusuanziCallback",function(a){bszTag.texts(a),bszTag.shows()}),bszTag={bszs:["site_pv","page_pv","site_uv"],texts:function(a){this.bszs.map(function(b){var c=document.getElementById("busuanzi_value_"+b);c&&(c.innerHTML=a[b])})},hides:function(){this.bszs.map(function(a){var b=document.getElementById("busuanzi_container_"+a);b&&(b.style.display="none")})},shows:function(){this.bszs.map(function(a){var b=document.getElementById("busuanzi_container_"+a);b&&(b.style.display="inline")})}}; \ No newline at end of file diff --git a/source/js/jquery-2.0.3.min.js b/source/js/jquery-2.0.3.min.js new file mode 100644 index 0000000..70bf492 --- /dev/null +++ b/source/js/jquery-2.0.3.min.js @@ -0,0 +1,6 @@ +/*! jQuery v2.0.3 | (c) 2005, 2013 jQuery Foundation, Inc. | jquery.org/license +//@ sourceMappingURL=jquery.min.map +*/ +(function(e,undefined){var t,n,r=typeof undefined,i=e.location,o=e.document,s=o.documentElement,a=e.jQuery,u=e.$,l={},c=[],p="2.0.3",f=c.concat,h=c.push,d=c.slice,g=c.indexOf,m=l.toString,y=l.hasOwnProperty,v=p.trim,x=function(e,n){return new x.fn.init(e,n,t)},b=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,w=/\S+/g,T=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,C=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,k=/^-ms-/,N=/-([\da-z])/gi,E=function(e,t){return t.toUpperCase()},S=function(){o.removeEventListener("DOMContentLoaded",S,!1),e.removeEventListener("load",S,!1),x.ready()};x.fn=x.prototype={jquery:p,constructor:x,init:function(e,t,n){var r,i;if(!e)return this;if("string"==typeof e){if(r="<"===e.charAt(0)&&">"===e.charAt(e.length-1)&&e.length>=3?[null,e,null]:T.exec(e),!r||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof x?t[0]:t,x.merge(this,x.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:o,!0)),C.test(r[1])&&x.isPlainObject(t))for(r in t)x.isFunction(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return i=o.getElementById(r[2]),i&&i.parentNode&&(this.length=1,this[0]=i),this.context=o,this.selector=e,this}return e.nodeType?(this.context=this[0]=e,this.length=1,this):x.isFunction(e)?n.ready(e):(e.selector!==undefined&&(this.selector=e.selector,this.context=e.context),x.makeArray(e,this))},selector:"",length:0,toArray:function(){return d.call(this)},get:function(e){return null==e?this.toArray():0>e?this[this.length+e]:this[e]},pushStack:function(e){var t=x.merge(this.constructor(),e);return t.prevObject=this,t.context=this.context,t},each:function(e,t){return x.each(this,e,t)},ready:function(e){return x.ready.promise().done(e),this},slice:function(){return this.pushStack(d.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(0>e?t:0);return this.pushStack(n>=0&&t>n?[this[n]]:[])},map:function(e){return this.pushStack(x.map(this,function(t,n){return e.call(t,n,t)}))},end:function(){return this.prevObject||this.constructor(null)},push:h,sort:[].sort,splice:[].splice},x.fn.init.prototype=x.fn,x.extend=x.fn.extend=function(){var e,t,n,r,i,o,s=arguments[0]||{},a=1,u=arguments.length,l=!1;for("boolean"==typeof s&&(l=s,s=arguments[1]||{},a=2),"object"==typeof s||x.isFunction(s)||(s={}),u===a&&(s=this,--a);u>a;a++)if(null!=(e=arguments[a]))for(t in e)n=s[t],r=e[t],s!==r&&(l&&r&&(x.isPlainObject(r)||(i=x.isArray(r)))?(i?(i=!1,o=n&&x.isArray(n)?n:[]):o=n&&x.isPlainObject(n)?n:{},s[t]=x.extend(l,o,r)):r!==undefined&&(s[t]=r));return s},x.extend({expando:"jQuery"+(p+Math.random()).replace(/\D/g,""),noConflict:function(t){return e.$===x&&(e.$=u),t&&e.jQuery===x&&(e.jQuery=a),x},isReady:!1,readyWait:1,holdReady:function(e){e?x.readyWait++:x.ready(!0)},ready:function(e){(e===!0?--x.readyWait:x.isReady)||(x.isReady=!0,e!==!0&&--x.readyWait>0||(n.resolveWith(o,[x]),x.fn.trigger&&x(o).trigger("ready").off("ready")))},isFunction:function(e){return"function"===x.type(e)},isArray:Array.isArray,isWindow:function(e){return null!=e&&e===e.window},isNumeric:function(e){return!isNaN(parseFloat(e))&&isFinite(e)},type:function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?l[m.call(e)]||"object":typeof e},isPlainObject:function(e){if("object"!==x.type(e)||e.nodeType||x.isWindow(e))return!1;try{if(e.constructor&&!y.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}return!0},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},error:function(e){throw Error(e)},parseHTML:function(e,t,n){if(!e||"string"!=typeof e)return null;"boolean"==typeof t&&(n=t,t=!1),t=t||o;var r=C.exec(e),i=!n&&[];return r?[t.createElement(r[1])]:(r=x.buildFragment([e],t,i),i&&x(i).remove(),x.merge([],r.childNodes))},parseJSON:JSON.parse,parseXML:function(e){var t,n;if(!e||"string"!=typeof e)return null;try{n=new DOMParser,t=n.parseFromString(e,"text/xml")}catch(r){t=undefined}return(!t||t.getElementsByTagName("parsererror").length)&&x.error("Invalid XML: "+e),t},noop:function(){},globalEval:function(e){var t,n=eval;e=x.trim(e),e&&(1===e.indexOf("use strict")?(t=o.createElement("script"),t.text=e,o.head.appendChild(t).parentNode.removeChild(t)):n(e))},camelCase:function(e){return e.replace(k,"ms-").replace(N,E)},nodeName:function(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()},each:function(e,t,n){var r,i=0,o=e.length,s=j(e);if(n){if(s){for(;o>i;i++)if(r=t.apply(e[i],n),r===!1)break}else for(i in e)if(r=t.apply(e[i],n),r===!1)break}else if(s){for(;o>i;i++)if(r=t.call(e[i],i,e[i]),r===!1)break}else for(i in e)if(r=t.call(e[i],i,e[i]),r===!1)break;return e},trim:function(e){return null==e?"":v.call(e)},makeArray:function(e,t){var n=t||[];return null!=e&&(j(Object(e))?x.merge(n,"string"==typeof e?[e]:e):h.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:g.call(t,e,n)},merge:function(e,t){var n=t.length,r=e.length,i=0;if("number"==typeof n)for(;n>i;i++)e[r++]=t[i];else while(t[i]!==undefined)e[r++]=t[i++];return e.length=r,e},grep:function(e,t,n){var r,i=[],o=0,s=e.length;for(n=!!n;s>o;o++)r=!!t(e[o],o),n!==r&&i.push(e[o]);return i},map:function(e,t,n){var r,i=0,o=e.length,s=j(e),a=[];if(s)for(;o>i;i++)r=t(e[i],i,n),null!=r&&(a[a.length]=r);else for(i in e)r=t(e[i],i,n),null!=r&&(a[a.length]=r);return f.apply([],a)},guid:1,proxy:function(e,t){var n,r,i;return"string"==typeof t&&(n=e[t],t=e,e=n),x.isFunction(e)?(r=d.call(arguments,2),i=function(){return e.apply(t||this,r.concat(d.call(arguments)))},i.guid=e.guid=e.guid||x.guid++,i):undefined},access:function(e,t,n,r,i,o,s){var a=0,u=e.length,l=null==n;if("object"===x.type(n)){i=!0;for(a in n)x.access(e,t,a,n[a],!0,o,s)}else if(r!==undefined&&(i=!0,x.isFunction(r)||(s=!0),l&&(s?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(x(e),n)})),t))for(;u>a;a++)t(e[a],n,s?r:r.call(e[a],a,t(e[a],n)));return i?e:l?t.call(e):u?t(e[0],n):o},now:Date.now,swap:function(e,t,n,r){var i,o,s={};for(o in t)s[o]=e.style[o],e.style[o]=t[o];i=n.apply(e,r||[]);for(o in t)e.style[o]=s[o];return i}}),x.ready.promise=function(t){return n||(n=x.Deferred(),"complete"===o.readyState?setTimeout(x.ready):(o.addEventListener("DOMContentLoaded",S,!1),e.addEventListener("load",S,!1))),n.promise(t)},x.each("Boolean Number String Function Array Date RegExp Object Error".split(" "),function(e,t){l["[object "+t+"]"]=t.toLowerCase()});function j(e){var t=e.length,n=x.type(e);return x.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===n||"function"!==n&&(0===t||"number"==typeof t&&t>0&&t-1 in e)}t=x(o),function(e,undefined){var t,n,r,i,o,s,a,u,l,c,p,f,h,d,g,m,y,v="sizzle"+-new Date,b=e.document,w=0,T=0,C=st(),k=st(),N=st(),E=!1,S=function(e,t){return e===t?(E=!0,0):0},j=typeof undefined,D=1<<31,A={}.hasOwnProperty,L=[],q=L.pop,H=L.push,O=L.push,F=L.slice,P=L.indexOf||function(e){var t=0,n=this.length;for(;n>t;t++)if(this[t]===e)return t;return-1},R="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",M="[\\x20\\t\\r\\n\\f]",W="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",$=W.replace("w","w#"),B="\\["+M+"*("+W+")"+M+"*(?:([*^$|!~]?=)"+M+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+$+")|)|)"+M+"*\\]",I=":("+W+")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|"+B.replace(3,8)+")*)|.*)\\)|)",z=RegExp("^"+M+"+|((?:^|[^\\\\])(?:\\\\.)*)"+M+"+$","g"),_=RegExp("^"+M+"*,"+M+"*"),X=RegExp("^"+M+"*([>+~]|"+M+")"+M+"*"),U=RegExp(M+"*[+~]"),Y=RegExp("="+M+"*([^\\]'\"]*)"+M+"*\\]","g"),V=RegExp(I),G=RegExp("^"+$+"$"),J={ID:RegExp("^#("+W+")"),CLASS:RegExp("^\\.("+W+")"),TAG:RegExp("^("+W.replace("w","w*")+")"),ATTR:RegExp("^"+B),PSEUDO:RegExp("^"+I),CHILD:RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:RegExp("^(?:"+R+")$","i"),needsContext:RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},Q=/^[^{]+\{\s*\[native \w/,K=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,Z=/^(?:input|select|textarea|button)$/i,et=/^h\d$/i,tt=/'|\\/g,nt=RegExp("\\\\([\\da-f]{1,6}"+M+"?|("+M+")|.)","ig"),rt=function(e,t,n){var r="0x"+t-65536;return r!==r||n?t:0>r?String.fromCharCode(r+65536):String.fromCharCode(55296|r>>10,56320|1023&r)};try{O.apply(L=F.call(b.childNodes),b.childNodes),L[b.childNodes.length].nodeType}catch(it){O={apply:L.length?function(e,t){H.apply(e,F.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function ot(e,t,r,i){var o,s,a,u,l,f,g,m,x,w;if((t?t.ownerDocument||t:b)!==p&&c(t),t=t||p,r=r||[],!e||"string"!=typeof e)return r;if(1!==(u=t.nodeType)&&9!==u)return[];if(h&&!i){if(o=K.exec(e))if(a=o[1]){if(9===u){if(s=t.getElementById(a),!s||!s.parentNode)return r;if(s.id===a)return r.push(s),r}else if(t.ownerDocument&&(s=t.ownerDocument.getElementById(a))&&y(t,s)&&s.id===a)return r.push(s),r}else{if(o[2])return O.apply(r,t.getElementsByTagName(e)),r;if((a=o[3])&&n.getElementsByClassName&&t.getElementsByClassName)return O.apply(r,t.getElementsByClassName(a)),r}if(n.qsa&&(!d||!d.test(e))){if(m=g=v,x=t,w=9===u&&e,1===u&&"object"!==t.nodeName.toLowerCase()){f=gt(e),(g=t.getAttribute("id"))?m=g.replace(tt,"\\$&"):t.setAttribute("id",m),m="[id='"+m+"'] ",l=f.length;while(l--)f[l]=m+mt(f[l]);x=U.test(e)&&t.parentNode||t,w=f.join(",")}if(w)try{return O.apply(r,x.querySelectorAll(w)),r}catch(T){}finally{g||t.removeAttribute("id")}}}return kt(e.replace(z,"$1"),t,r,i)}function st(){var e=[];function t(n,r){return e.push(n+=" ")>i.cacheLength&&delete t[e.shift()],t[n]=r}return t}function at(e){return e[v]=!0,e}function ut(e){var t=p.createElement("div");try{return!!e(t)}catch(n){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function lt(e,t){var n=e.split("|"),r=e.length;while(r--)i.attrHandle[n[r]]=t}function ct(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&(~t.sourceIndex||D)-(~e.sourceIndex||D);if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function pt(e){return function(t){var n=t.nodeName.toLowerCase();return"input"===n&&t.type===e}}function ft(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function ht(e){return at(function(t){return t=+t,at(function(n,r){var i,o=e([],n.length,t),s=o.length;while(s--)n[i=o[s]]&&(n[i]=!(r[i]=n[i]))})})}s=ot.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return t?"HTML"!==t.nodeName:!1},n=ot.support={},c=ot.setDocument=function(e){var t=e?e.ownerDocument||e:b,r=t.defaultView;return t!==p&&9===t.nodeType&&t.documentElement?(p=t,f=t.documentElement,h=!s(t),r&&r.attachEvent&&r!==r.top&&r.attachEvent("onbeforeunload",function(){c()}),n.attributes=ut(function(e){return e.className="i",!e.getAttribute("className")}),n.getElementsByTagName=ut(function(e){return e.appendChild(t.createComment("")),!e.getElementsByTagName("*").length}),n.getElementsByClassName=ut(function(e){return e.innerHTML="
",e.firstChild.className="i",2===e.getElementsByClassName("i").length}),n.getById=ut(function(e){return f.appendChild(e).id=v,!t.getElementsByName||!t.getElementsByName(v).length}),n.getById?(i.find.ID=function(e,t){if(typeof t.getElementById!==j&&h){var n=t.getElementById(e);return n&&n.parentNode?[n]:[]}},i.filter.ID=function(e){var t=e.replace(nt,rt);return function(e){return e.getAttribute("id")===t}}):(delete i.find.ID,i.filter.ID=function(e){var t=e.replace(nt,rt);return function(e){var n=typeof e.getAttributeNode!==j&&e.getAttributeNode("id");return n&&n.value===t}}),i.find.TAG=n.getElementsByTagName?function(e,t){return typeof t.getElementsByTagName!==j?t.getElementsByTagName(e):undefined}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},i.find.CLASS=n.getElementsByClassName&&function(e,t){return typeof t.getElementsByClassName!==j&&h?t.getElementsByClassName(e):undefined},g=[],d=[],(n.qsa=Q.test(t.querySelectorAll))&&(ut(function(e){e.innerHTML="",e.querySelectorAll("[selected]").length||d.push("\\["+M+"*(?:value|"+R+")"),e.querySelectorAll(":checked").length||d.push(":checked")}),ut(function(e){var n=t.createElement("input");n.setAttribute("type","hidden"),e.appendChild(n).setAttribute("t",""),e.querySelectorAll("[t^='']").length&&d.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll(":enabled").length||d.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),d.push(",.*:")})),(n.matchesSelector=Q.test(m=f.webkitMatchesSelector||f.mozMatchesSelector||f.oMatchesSelector||f.msMatchesSelector))&&ut(function(e){n.disconnectedMatch=m.call(e,"div"),m.call(e,"[s!='']:x"),g.push("!=",I)}),d=d.length&&RegExp(d.join("|")),g=g.length&&RegExp(g.join("|")),y=Q.test(f.contains)||f.compareDocumentPosition?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},S=f.compareDocumentPosition?function(e,r){if(e===r)return E=!0,0;var i=r.compareDocumentPosition&&e.compareDocumentPosition&&e.compareDocumentPosition(r);return i?1&i||!n.sortDetached&&r.compareDocumentPosition(e)===i?e===t||y(b,e)?-1:r===t||y(b,r)?1:l?P.call(l,e)-P.call(l,r):0:4&i?-1:1:e.compareDocumentPosition?-1:1}:function(e,n){var r,i=0,o=e.parentNode,s=n.parentNode,a=[e],u=[n];if(e===n)return E=!0,0;if(!o||!s)return e===t?-1:n===t?1:o?-1:s?1:l?P.call(l,e)-P.call(l,n):0;if(o===s)return ct(e,n);r=e;while(r=r.parentNode)a.unshift(r);r=n;while(r=r.parentNode)u.unshift(r);while(a[i]===u[i])i++;return i?ct(a[i],u[i]):a[i]===b?-1:u[i]===b?1:0},t):p},ot.matches=function(e,t){return ot(e,null,null,t)},ot.matchesSelector=function(e,t){if((e.ownerDocument||e)!==p&&c(e),t=t.replace(Y,"='$1']"),!(!n.matchesSelector||!h||g&&g.test(t)||d&&d.test(t)))try{var r=m.call(e,t);if(r||n.disconnectedMatch||e.document&&11!==e.document.nodeType)return r}catch(i){}return ot(t,p,null,[e]).length>0},ot.contains=function(e,t){return(e.ownerDocument||e)!==p&&c(e),y(e,t)},ot.attr=function(e,t){(e.ownerDocument||e)!==p&&c(e);var r=i.attrHandle[t.toLowerCase()],o=r&&A.call(i.attrHandle,t.toLowerCase())?r(e,t,!h):undefined;return o===undefined?n.attributes||!h?e.getAttribute(t):(o=e.getAttributeNode(t))&&o.specified?o.value:null:o},ot.error=function(e){throw Error("Syntax error, unrecognized expression: "+e)},ot.uniqueSort=function(e){var t,r=[],i=0,o=0;if(E=!n.detectDuplicates,l=!n.sortStable&&e.slice(0),e.sort(S),E){while(t=e[o++])t===e[o]&&(i=r.push(o));while(i--)e.splice(r[i],1)}return e},o=ot.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=o(e)}else if(3===i||4===i)return e.nodeValue}else for(;t=e[r];r++)n+=o(t);return n},i=ot.selectors={cacheLength:50,createPseudo:at,match:J,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(nt,rt),e[3]=(e[4]||e[5]||"").replace(nt,rt),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||ot.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&ot.error(e[0]),e},PSEUDO:function(e){var t,n=!e[5]&&e[2];return J.CHILD.test(e[0])?null:(e[3]&&e[4]!==undefined?e[2]=e[4]:n&&V.test(n)&&(t=gt(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(nt,rt).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=C[e+" "];return t||(t=RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&C(e,function(e){return t.test("string"==typeof e.className&&e.className||typeof e.getAttribute!==j&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=ot.attr(r,e);return null==i?"!="===t:t?(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i+" ").indexOf(n)>-1:"|="===t?i===n||i.slice(0,n.length+1)===n+"-":!1):!0}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),s="last"!==e.slice(-4),a="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,u){var l,c,p,f,h,d,g=o!==s?"nextSibling":"previousSibling",m=t.parentNode,y=a&&t.nodeName.toLowerCase(),x=!u&&!a;if(m){if(o){while(g){p=t;while(p=p[g])if(a?p.nodeName.toLowerCase()===y:1===p.nodeType)return!1;d=g="only"===e&&!d&&"nextSibling"}return!0}if(d=[s?m.firstChild:m.lastChild],s&&x){c=m[v]||(m[v]={}),l=c[e]||[],h=l[0]===w&&l[1],f=l[0]===w&&l[2],p=h&&m.childNodes[h];while(p=++h&&p&&p[g]||(f=h=0)||d.pop())if(1===p.nodeType&&++f&&p===t){c[e]=[w,h,f];break}}else if(x&&(l=(t[v]||(t[v]={}))[e])&&l[0]===w)f=l[1];else while(p=++h&&p&&p[g]||(f=h=0)||d.pop())if((a?p.nodeName.toLowerCase()===y:1===p.nodeType)&&++f&&(x&&((p[v]||(p[v]={}))[e]=[w,f]),p===t))break;return f-=i,f===r||0===f%r&&f/r>=0}}},PSEUDO:function(e,t){var n,r=i.pseudos[e]||i.setFilters[e.toLowerCase()]||ot.error("unsupported pseudo: "+e);return r[v]?r(t):r.length>1?(n=[e,e,"",t],i.setFilters.hasOwnProperty(e.toLowerCase())?at(function(e,n){var i,o=r(e,t),s=o.length;while(s--)i=P.call(e,o[s]),e[i]=!(n[i]=o[s])}):function(e){return r(e,0,n)}):r}},pseudos:{not:at(function(e){var t=[],n=[],r=a(e.replace(z,"$1"));return r[v]?at(function(e,t,n,i){var o,s=r(e,null,i,[]),a=e.length;while(a--)(o=s[a])&&(e[a]=!(t[a]=o))}):function(e,i,o){return t[0]=e,r(t,null,o,n),!n.pop()}}),has:at(function(e){return function(t){return ot(e,t).length>0}}),contains:at(function(e){return function(t){return(t.textContent||t.innerText||o(t)).indexOf(e)>-1}}),lang:at(function(e){return G.test(e||"")||ot.error("unsupported lang: "+e),e=e.replace(nt,rt).toLowerCase(),function(t){var n;do if(n=h?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return n=n.toLowerCase(),n===e||0===n.indexOf(e+"-");while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var n=e.location&&e.location.hash;return n&&n.slice(1)===t.id},root:function(e){return e===f},focus:function(e){return e===p.activeElement&&(!p.hasFocus||p.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:function(e){return e.disabled===!1},disabled:function(e){return e.disabled===!0},checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,e.selected===!0},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeName>"@"||3===e.nodeType||4===e.nodeType)return!1;return!0},parent:function(e){return!i.pseudos.empty(e)},header:function(e){return et.test(e.nodeName)},input:function(e){return Z.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||t.toLowerCase()===e.type)},first:ht(function(){return[0]}),last:ht(function(e,t){return[t-1]}),eq:ht(function(e,t,n){return[0>n?n+t:n]}),even:ht(function(e,t){var n=0;for(;t>n;n+=2)e.push(n);return e}),odd:ht(function(e,t){var n=1;for(;t>n;n+=2)e.push(n);return e}),lt:ht(function(e,t,n){var r=0>n?n+t:n;for(;--r>=0;)e.push(r);return e}),gt:ht(function(e,t,n){var r=0>n?n+t:n;for(;t>++r;)e.push(r);return e})}},i.pseudos.nth=i.pseudos.eq;for(t in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})i.pseudos[t]=pt(t);for(t in{submit:!0,reset:!0})i.pseudos[t]=ft(t);function dt(){}dt.prototype=i.filters=i.pseudos,i.setFilters=new dt;function gt(e,t){var n,r,o,s,a,u,l,c=k[e+" "];if(c)return t?0:c.slice(0);a=e,u=[],l=i.preFilter;while(a){(!n||(r=_.exec(a)))&&(r&&(a=a.slice(r[0].length)||a),u.push(o=[])),n=!1,(r=X.exec(a))&&(n=r.shift(),o.push({value:n,type:r[0].replace(z," ")}),a=a.slice(n.length));for(s in i.filter)!(r=J[s].exec(a))||l[s]&&!(r=l[s](r))||(n=r.shift(),o.push({value:n,type:s,matches:r}),a=a.slice(n.length));if(!n)break}return t?a.length:a?ot.error(e):k(e,u).slice(0)}function mt(e){var t=0,n=e.length,r="";for(;n>t;t++)r+=e[t].value;return r}function yt(e,t,n){var i=t.dir,o=n&&"parentNode"===i,s=T++;return t.first?function(t,n,r){while(t=t[i])if(1===t.nodeType||o)return e(t,n,r)}:function(t,n,a){var u,l,c,p=w+" "+s;if(a){while(t=t[i])if((1===t.nodeType||o)&&e(t,n,a))return!0}else while(t=t[i])if(1===t.nodeType||o)if(c=t[v]||(t[v]={}),(l=c[i])&&l[0]===p){if((u=l[1])===!0||u===r)return u===!0}else if(l=c[i]=[p],l[1]=e(t,n,a)||r,l[1]===!0)return!0}}function vt(e){return e.length>1?function(t,n,r){var i=e.length;while(i--)if(!e[i](t,n,r))return!1;return!0}:e[0]}function xt(e,t,n,r,i){var o,s=[],a=0,u=e.length,l=null!=t;for(;u>a;a++)(o=e[a])&&(!n||n(o,r,i))&&(s.push(o),l&&t.push(a));return s}function bt(e,t,n,r,i,o){return r&&!r[v]&&(r=bt(r)),i&&!i[v]&&(i=bt(i,o)),at(function(o,s,a,u){var l,c,p,f=[],h=[],d=s.length,g=o||Ct(t||"*",a.nodeType?[a]:a,[]),m=!e||!o&&t?g:xt(g,f,e,a,u),y=n?i||(o?e:d||r)?[]:s:m;if(n&&n(m,y,a,u),r){l=xt(y,h),r(l,[],a,u),c=l.length;while(c--)(p=l[c])&&(y[h[c]]=!(m[h[c]]=p))}if(o){if(i||e){if(i){l=[],c=y.length;while(c--)(p=y[c])&&l.push(m[c]=p);i(null,y=[],l,u)}c=y.length;while(c--)(p=y[c])&&(l=i?P.call(o,p):f[c])>-1&&(o[l]=!(s[l]=p))}}else y=xt(y===s?y.splice(d,y.length):y),i?i(null,s,y,u):O.apply(s,y)})}function wt(e){var t,n,r,o=e.length,s=i.relative[e[0].type],a=s||i.relative[" "],l=s?1:0,c=yt(function(e){return e===t},a,!0),p=yt(function(e){return P.call(t,e)>-1},a,!0),f=[function(e,n,r){return!s&&(r||n!==u)||((t=n).nodeType?c(e,n,r):p(e,n,r))}];for(;o>l;l++)if(n=i.relative[e[l].type])f=[yt(vt(f),n)];else{if(n=i.filter[e[l].type].apply(null,e[l].matches),n[v]){for(r=++l;o>r;r++)if(i.relative[e[r].type])break;return bt(l>1&&vt(f),l>1&&mt(e.slice(0,l-1).concat({value:" "===e[l-2].type?"*":""})).replace(z,"$1"),n,r>l&&wt(e.slice(l,r)),o>r&&wt(e=e.slice(r)),o>r&&mt(e))}f.push(n)}return vt(f)}function Tt(e,t){var n=0,o=t.length>0,s=e.length>0,a=function(a,l,c,f,h){var d,g,m,y=[],v=0,x="0",b=a&&[],T=null!=h,C=u,k=a||s&&i.find.TAG("*",h&&l.parentNode||l),N=w+=null==C?1:Math.random()||.1;for(T&&(u=l!==p&&l,r=n);null!=(d=k[x]);x++){if(s&&d){g=0;while(m=e[g++])if(m(d,l,c)){f.push(d);break}T&&(w=N,r=++n)}o&&((d=!m&&d)&&v--,a&&b.push(d))}if(v+=x,o&&x!==v){g=0;while(m=t[g++])m(b,y,l,c);if(a){if(v>0)while(x--)b[x]||y[x]||(y[x]=q.call(f));y=xt(y)}O.apply(f,y),T&&!a&&y.length>0&&v+t.length>1&&ot.uniqueSort(f)}return T&&(w=N,u=C),b};return o?at(a):a}a=ot.compile=function(e,t){var n,r=[],i=[],o=N[e+" "];if(!o){t||(t=gt(e)),n=t.length;while(n--)o=wt(t[n]),o[v]?r.push(o):i.push(o);o=N(e,Tt(i,r))}return o};function Ct(e,t,n){var r=0,i=t.length;for(;i>r;r++)ot(e,t[r],n);return n}function kt(e,t,r,o){var s,u,l,c,p,f=gt(e);if(!o&&1===f.length){if(u=f[0]=f[0].slice(0),u.length>2&&"ID"===(l=u[0]).type&&n.getById&&9===t.nodeType&&h&&i.relative[u[1].type]){if(t=(i.find.ID(l.matches[0].replace(nt,rt),t)||[])[0],!t)return r;e=e.slice(u.shift().value.length)}s=J.needsContext.test(e)?0:u.length;while(s--){if(l=u[s],i.relative[c=l.type])break;if((p=i.find[c])&&(o=p(l.matches[0].replace(nt,rt),U.test(u[0].type)&&t.parentNode||t))){if(u.splice(s,1),e=o.length&&mt(u),!e)return O.apply(r,o),r;break}}}return a(e,f)(o,t,!h,r,U.test(e)),r}n.sortStable=v.split("").sort(S).join("")===v,n.detectDuplicates=E,c(),n.sortDetached=ut(function(e){return 1&e.compareDocumentPosition(p.createElement("div"))}),ut(function(e){return e.innerHTML="","#"===e.firstChild.getAttribute("href")})||lt("type|href|height|width",function(e,t,n){return n?undefined:e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),n.attributes&&ut(function(e){return e.innerHTML="",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||lt("value",function(e,t,n){return n||"input"!==e.nodeName.toLowerCase()?undefined:e.defaultValue}),ut(function(e){return null==e.getAttribute("disabled")})||lt(R,function(e,t,n){var r;return n?undefined:(r=e.getAttributeNode(t))&&r.specified?r.value:e[t]===!0?t.toLowerCase():null}),x.find=ot,x.expr=ot.selectors,x.expr[":"]=x.expr.pseudos,x.unique=ot.uniqueSort,x.text=ot.getText,x.isXMLDoc=ot.isXML,x.contains=ot.contains}(e);var D={};function A(e){var t=D[e]={};return x.each(e.match(w)||[],function(e,n){t[n]=!0}),t}x.Callbacks=function(e){e="string"==typeof e?D[e]||A(e):x.extend({},e);var t,n,r,i,o,s,a=[],u=!e.once&&[],l=function(p){for(t=e.memory&&p,n=!0,s=i||0,i=0,o=a.length,r=!0;a&&o>s;s++)if(a[s].apply(p[0],p[1])===!1&&e.stopOnFalse){t=!1;break}r=!1,a&&(u?u.length&&l(u.shift()):t?a=[]:c.disable())},c={add:function(){if(a){var n=a.length;(function s(t){x.each(t,function(t,n){var r=x.type(n);"function"===r?e.unique&&c.has(n)||a.push(n):n&&n.length&&"string"!==r&&s(n)})})(arguments),r?o=a.length:t&&(i=n,l(t))}return this},remove:function(){return a&&x.each(arguments,function(e,t){var n;while((n=x.inArray(t,a,n))>-1)a.splice(n,1),r&&(o>=n&&o--,s>=n&&s--)}),this},has:function(e){return e?x.inArray(e,a)>-1:!(!a||!a.length)},empty:function(){return a=[],o=0,this},disable:function(){return a=u=t=undefined,this},disabled:function(){return!a},lock:function(){return u=undefined,t||c.disable(),this},locked:function(){return!u},fireWith:function(e,t){return!a||n&&!u||(t=t||[],t=[e,t.slice?t.slice():t],r?u.push(t):l(t)),this},fire:function(){return c.fireWith(this,arguments),this},fired:function(){return!!n}};return c},x.extend({Deferred:function(e){var t=[["resolve","done",x.Callbacks("once memory"),"resolved"],["reject","fail",x.Callbacks("once memory"),"rejected"],["notify","progress",x.Callbacks("memory")]],n="pending",r={state:function(){return n},always:function(){return i.done(arguments).fail(arguments),this},then:function(){var e=arguments;return x.Deferred(function(n){x.each(t,function(t,o){var s=o[0],a=x.isFunction(e[t])&&e[t];i[o[1]](function(){var e=a&&a.apply(this,arguments);e&&x.isFunction(e.promise)?e.promise().done(n.resolve).fail(n.reject).progress(n.notify):n[s+"With"](this===r?n.promise():this,a?[e]:arguments)})}),e=null}).promise()},promise:function(e){return null!=e?x.extend(e,r):r}},i={};return r.pipe=r.then,x.each(t,function(e,o){var s=o[2],a=o[3];r[o[1]]=s.add,a&&s.add(function(){n=a},t[1^e][2].disable,t[2][2].lock),i[o[0]]=function(){return i[o[0]+"With"](this===i?r:this,arguments),this},i[o[0]+"With"]=s.fireWith}),r.promise(i),e&&e.call(i,i),i},when:function(e){var t=0,n=d.call(arguments),r=n.length,i=1!==r||e&&x.isFunction(e.promise)?r:0,o=1===i?e:x.Deferred(),s=function(e,t,n){return function(r){t[e]=this,n[e]=arguments.length>1?d.call(arguments):r,n===a?o.notifyWith(t,n):--i||o.resolveWith(t,n)}},a,u,l;if(r>1)for(a=Array(r),u=Array(r),l=Array(r);r>t;t++)n[t]&&x.isFunction(n[t].promise)?n[t].promise().done(s(t,l,n)).fail(o.reject).progress(s(t,u,a)):--i;return i||o.resolveWith(l,n),o.promise()}}),x.support=function(t){var n=o.createElement("input"),r=o.createDocumentFragment(),i=o.createElement("div"),s=o.createElement("select"),a=s.appendChild(o.createElement("option"));return n.type?(n.type="checkbox",t.checkOn=""!==n.value,t.optSelected=a.selected,t.reliableMarginRight=!0,t.boxSizingReliable=!0,t.pixelPosition=!1,n.checked=!0,t.noCloneChecked=n.cloneNode(!0).checked,s.disabled=!0,t.optDisabled=!a.disabled,n=o.createElement("input"),n.value="t",n.type="radio",t.radioValue="t"===n.value,n.setAttribute("checked","t"),n.setAttribute("name","t"),r.appendChild(n),t.checkClone=r.cloneNode(!0).cloneNode(!0).lastChild.checked,t.focusinBubbles="onfocusin"in e,i.style.backgroundClip="content-box",i.cloneNode(!0).style.backgroundClip="",t.clearCloneStyle="content-box"===i.style.backgroundClip,x(function(){var n,r,s="padding:0;margin:0;border:0;display:block;-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box",a=o.getElementsByTagName("body")[0];a&&(n=o.createElement("div"),n.style.cssText="border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px",a.appendChild(n).appendChild(i),i.innerHTML="",i.style.cssText="-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%",x.swap(a,null!=a.style.zoom?{zoom:1}:{},function(){t.boxSizing=4===i.offsetWidth}),e.getComputedStyle&&(t.pixelPosition="1%"!==(e.getComputedStyle(i,null)||{}).top,t.boxSizingReliable="4px"===(e.getComputedStyle(i,null)||{width:"4px"}).width,r=i.appendChild(o.createElement("div")),r.style.cssText=i.style.cssText=s,r.style.marginRight=r.style.width="0",i.style.width="1px",t.reliableMarginRight=!parseFloat((e.getComputedStyle(r,null)||{}).marginRight)),a.removeChild(n))}),t):t}({});var L,q,H=/(?:\{[\s\S]*\}|\[[\s\S]*\])$/,O=/([A-Z])/g;function F(){Object.defineProperty(this.cache={},0,{get:function(){return{}}}),this.expando=x.expando+Math.random()}F.uid=1,F.accepts=function(e){return e.nodeType?1===e.nodeType||9===e.nodeType:!0},F.prototype={key:function(e){if(!F.accepts(e))return 0;var t={},n=e[this.expando];if(!n){n=F.uid++;try{t[this.expando]={value:n},Object.defineProperties(e,t)}catch(r){t[this.expando]=n,x.extend(e,t)}}return this.cache[n]||(this.cache[n]={}),n},set:function(e,t,n){var r,i=this.key(e),o=this.cache[i];if("string"==typeof t)o[t]=n;else if(x.isEmptyObject(o))x.extend(this.cache[i],t);else for(r in t)o[r]=t[r];return o},get:function(e,t){var n=this.cache[this.key(e)];return t===undefined?n:n[t]},access:function(e,t,n){var r;return t===undefined||t&&"string"==typeof t&&n===undefined?(r=this.get(e,t),r!==undefined?r:this.get(e,x.camelCase(t))):(this.set(e,t,n),n!==undefined?n:t)},remove:function(e,t){var n,r,i,o=this.key(e),s=this.cache[o];if(t===undefined)this.cache[o]={};else{x.isArray(t)?r=t.concat(t.map(x.camelCase)):(i=x.camelCase(t),t in s?r=[t,i]:(r=i,r=r in s?[r]:r.match(w)||[])),n=r.length;while(n--)delete s[r[n]]}},hasData:function(e){return!x.isEmptyObject(this.cache[e[this.expando]]||{})},discard:function(e){e[this.expando]&&delete this.cache[e[this.expando]]}},L=new F,q=new F,x.extend({acceptData:F.accepts,hasData:function(e){return L.hasData(e)||q.hasData(e)},data:function(e,t,n){return L.access(e,t,n)},removeData:function(e,t){L.remove(e,t)},_data:function(e,t,n){return q.access(e,t,n)},_removeData:function(e,t){q.remove(e,t)}}),x.fn.extend({data:function(e,t){var n,r,i=this[0],o=0,s=null;if(e===undefined){if(this.length&&(s=L.get(i),1===i.nodeType&&!q.get(i,"hasDataAttrs"))){for(n=i.attributes;n.length>o;o++)r=n[o].name,0===r.indexOf("data-")&&(r=x.camelCase(r.slice(5)),P(i,r,s[r]));q.set(i,"hasDataAttrs",!0)}return s}return"object"==typeof e?this.each(function(){L.set(this,e)}):x.access(this,function(t){var n,r=x.camelCase(e);if(i&&t===undefined){if(n=L.get(i,e),n!==undefined)return n;if(n=L.get(i,r),n!==undefined)return n;if(n=P(i,r,undefined),n!==undefined)return n}else this.each(function(){var n=L.get(this,r);L.set(this,r,t),-1!==e.indexOf("-")&&n!==undefined&&L.set(this,e,t)})},null,t,arguments.length>1,null,!0)},removeData:function(e){return this.each(function(){L.remove(this,e)})}});function P(e,t,n){var r;if(n===undefined&&1===e.nodeType)if(r="data-"+t.replace(O,"-$1").toLowerCase(),n=e.getAttribute(r),"string"==typeof n){try{n="true"===n?!0:"false"===n?!1:"null"===n?null:+n+""===n?+n:H.test(n)?JSON.parse(n):n}catch(i){}L.set(e,t,n)}else n=undefined;return n}x.extend({queue:function(e,t,n){var r;return e?(t=(t||"fx")+"queue",r=q.get(e,t),n&&(!r||x.isArray(n)?r=q.access(e,t,x.makeArray(n)):r.push(n)),r||[]):undefined},dequeue:function(e,t){t=t||"fx";var n=x.queue(e,t),r=n.length,i=n.shift(),o=x._queueHooks(e,t),s=function(){x.dequeue(e,t) + };"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,s,o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return q.get(e,n)||q.access(e,n,{empty:x.Callbacks("once memory").add(function(){q.remove(e,[t+"queue",n])})})}}),x.fn.extend({queue:function(e,t){var n=2;return"string"!=typeof e&&(t=e,e="fx",n--),n>arguments.length?x.queue(this[0],e):t===undefined?this:this.each(function(){var n=x.queue(this,e,t);x._queueHooks(this,e),"fx"===e&&"inprogress"!==n[0]&&x.dequeue(this,e)})},dequeue:function(e){return this.each(function(){x.dequeue(this,e)})},delay:function(e,t){return e=x.fx?x.fx.speeds[e]||e:e,t=t||"fx",this.queue(t,function(t,n){var r=setTimeout(t,e);n.stop=function(){clearTimeout(r)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=x.Deferred(),o=this,s=this.length,a=function(){--r||i.resolveWith(o,[o])};"string"!=typeof e&&(t=e,e=undefined),e=e||"fx";while(s--)n=q.get(o[s],e+"queueHooks"),n&&n.empty&&(r++,n.empty.add(a));return a(),i.promise(t)}});var R,M,W=/[\t\r\n\f]/g,$=/\r/g,B=/^(?:input|select|textarea|button)$/i;x.fn.extend({attr:function(e,t){return x.access(this,x.attr,e,t,arguments.length>1)},removeAttr:function(e){return this.each(function(){x.removeAttr(this,e)})},prop:function(e,t){return x.access(this,x.prop,e,t,arguments.length>1)},removeProp:function(e){return this.each(function(){delete this[x.propFix[e]||e]})},addClass:function(e){var t,n,r,i,o,s=0,a=this.length,u="string"==typeof e&&e;if(x.isFunction(e))return this.each(function(t){x(this).addClass(e.call(this,t,this.className))});if(u)for(t=(e||"").match(w)||[];a>s;s++)if(n=this[s],r=1===n.nodeType&&(n.className?(" "+n.className+" ").replace(W," "):" ")){o=0;while(i=t[o++])0>r.indexOf(" "+i+" ")&&(r+=i+" ");n.className=x.trim(r)}return this},removeClass:function(e){var t,n,r,i,o,s=0,a=this.length,u=0===arguments.length||"string"==typeof e&&e;if(x.isFunction(e))return this.each(function(t){x(this).removeClass(e.call(this,t,this.className))});if(u)for(t=(e||"").match(w)||[];a>s;s++)if(n=this[s],r=1===n.nodeType&&(n.className?(" "+n.className+" ").replace(W," "):"")){o=0;while(i=t[o++])while(r.indexOf(" "+i+" ")>=0)r=r.replace(" "+i+" "," ");n.className=e?x.trim(r):""}return this},toggleClass:function(e,t){var n=typeof e;return"boolean"==typeof t&&"string"===n?t?this.addClass(e):this.removeClass(e):x.isFunction(e)?this.each(function(n){x(this).toggleClass(e.call(this,n,this.className,t),t)}):this.each(function(){if("string"===n){var t,i=0,o=x(this),s=e.match(w)||[];while(t=s[i++])o.hasClass(t)?o.removeClass(t):o.addClass(t)}else(n===r||"boolean"===n)&&(this.className&&q.set(this,"__className__",this.className),this.className=this.className||e===!1?"":q.get(this,"__className__")||"")})},hasClass:function(e){var t=" "+e+" ",n=0,r=this.length;for(;r>n;n++)if(1===this[n].nodeType&&(" "+this[n].className+" ").replace(W," ").indexOf(t)>=0)return!0;return!1},val:function(e){var t,n,r,i=this[0];{if(arguments.length)return r=x.isFunction(e),this.each(function(n){var i;1===this.nodeType&&(i=r?e.call(this,n,x(this).val()):e,null==i?i="":"number"==typeof i?i+="":x.isArray(i)&&(i=x.map(i,function(e){return null==e?"":e+""})),t=x.valHooks[this.type]||x.valHooks[this.nodeName.toLowerCase()],t&&"set"in t&&t.set(this,i,"value")!==undefined||(this.value=i))});if(i)return t=x.valHooks[i.type]||x.valHooks[i.nodeName.toLowerCase()],t&&"get"in t&&(n=t.get(i,"value"))!==undefined?n:(n=i.value,"string"==typeof n?n.replace($,""):null==n?"":n)}}}),x.extend({valHooks:{option:{get:function(e){var t=e.attributes.value;return!t||t.specified?e.value:e.text}},select:{get:function(e){var t,n,r=e.options,i=e.selectedIndex,o="select-one"===e.type||0>i,s=o?null:[],a=o?i+1:r.length,u=0>i?a:o?i:0;for(;a>u;u++)if(n=r[u],!(!n.selected&&u!==i||(x.support.optDisabled?n.disabled:null!==n.getAttribute("disabled"))||n.parentNode.disabled&&x.nodeName(n.parentNode,"optgroup"))){if(t=x(n).val(),o)return t;s.push(t)}return s},set:function(e,t){var n,r,i=e.options,o=x.makeArray(t),s=i.length;while(s--)r=i[s],(r.selected=x.inArray(x(r).val(),o)>=0)&&(n=!0);return n||(e.selectedIndex=-1),o}}},attr:function(e,t,n){var i,o,s=e.nodeType;if(e&&3!==s&&8!==s&&2!==s)return typeof e.getAttribute===r?x.prop(e,t,n):(1===s&&x.isXMLDoc(e)||(t=t.toLowerCase(),i=x.attrHooks[t]||(x.expr.match.bool.test(t)?M:R)),n===undefined?i&&"get"in i&&null!==(o=i.get(e,t))?o:(o=x.find.attr(e,t),null==o?undefined:o):null!==n?i&&"set"in i&&(o=i.set(e,n,t))!==undefined?o:(e.setAttribute(t,n+""),n):(x.removeAttr(e,t),undefined))},removeAttr:function(e,t){var n,r,i=0,o=t&&t.match(w);if(o&&1===e.nodeType)while(n=o[i++])r=x.propFix[n]||n,x.expr.match.bool.test(n)&&(e[r]=!1),e.removeAttribute(n)},attrHooks:{type:{set:function(e,t){if(!x.support.radioValue&&"radio"===t&&x.nodeName(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},propFix:{"for":"htmlFor","class":"className"},prop:function(e,t,n){var r,i,o,s=e.nodeType;if(e&&3!==s&&8!==s&&2!==s)return o=1!==s||!x.isXMLDoc(e),o&&(t=x.propFix[t]||t,i=x.propHooks[t]),n!==undefined?i&&"set"in i&&(r=i.set(e,n,t))!==undefined?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){return e.hasAttribute("tabindex")||B.test(e.nodeName)||e.href?e.tabIndex:-1}}}}),M={set:function(e,t,n){return t===!1?x.removeAttr(e,n):e.setAttribute(n,n),n}},x.each(x.expr.match.bool.source.match(/\w+/g),function(e,t){var n=x.expr.attrHandle[t]||x.find.attr;x.expr.attrHandle[t]=function(e,t,r){var i=x.expr.attrHandle[t],o=r?undefined:(x.expr.attrHandle[t]=undefined)!=n(e,t,r)?t.toLowerCase():null;return x.expr.attrHandle[t]=i,o}}),x.support.optSelected||(x.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null}}),x.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){x.propFix[this.toLowerCase()]=this}),x.each(["radio","checkbox"],function(){x.valHooks[this]={set:function(e,t){return x.isArray(t)?e.checked=x.inArray(x(e).val(),t)>=0:undefined}},x.support.checkOn||(x.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})});var I=/^key/,z=/^(?:mouse|contextmenu)|click/,_=/^(?:focusinfocus|focusoutblur)$/,X=/^([^.]*)(?:\.(.+)|)$/;function U(){return!0}function Y(){return!1}function V(){try{return o.activeElement}catch(e){}}x.event={global:{},add:function(e,t,n,i,o){var s,a,u,l,c,p,f,h,d,g,m,y=q.get(e);if(y){n.handler&&(s=n,n=s.handler,o=s.selector),n.guid||(n.guid=x.guid++),(l=y.events)||(l=y.events={}),(a=y.handle)||(a=y.handle=function(e){return typeof x===r||e&&x.event.triggered===e.type?undefined:x.event.dispatch.apply(a.elem,arguments)},a.elem=e),t=(t||"").match(w)||[""],c=t.length;while(c--)u=X.exec(t[c])||[],d=m=u[1],g=(u[2]||"").split(".").sort(),d&&(f=x.event.special[d]||{},d=(o?f.delegateType:f.bindType)||d,f=x.event.special[d]||{},p=x.extend({type:d,origType:m,data:i,handler:n,guid:n.guid,selector:o,needsContext:o&&x.expr.match.needsContext.test(o),namespace:g.join(".")},s),(h=l[d])||(h=l[d]=[],h.delegateCount=0,f.setup&&f.setup.call(e,i,g,a)!==!1||e.addEventListener&&e.addEventListener(d,a,!1)),f.add&&(f.add.call(e,p),p.handler.guid||(p.handler.guid=n.guid)),o?h.splice(h.delegateCount++,0,p):h.push(p),x.event.global[d]=!0);e=null}},remove:function(e,t,n,r,i){var o,s,a,u,l,c,p,f,h,d,g,m=q.hasData(e)&&q.get(e);if(m&&(u=m.events)){t=(t||"").match(w)||[""],l=t.length;while(l--)if(a=X.exec(t[l])||[],h=g=a[1],d=(a[2]||"").split(".").sort(),h){p=x.event.special[h]||{},h=(r?p.delegateType:p.bindType)||h,f=u[h]||[],a=a[2]&&RegExp("(^|\\.)"+d.join("\\.(?:.*\\.|)")+"(\\.|$)"),s=o=f.length;while(o--)c=f[o],!i&&g!==c.origType||n&&n.guid!==c.guid||a&&!a.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(f.splice(o,1),c.selector&&f.delegateCount--,p.remove&&p.remove.call(e,c));s&&!f.length&&(p.teardown&&p.teardown.call(e,d,m.handle)!==!1||x.removeEvent(e,h,m.handle),delete u[h])}else for(h in u)x.event.remove(e,h+t[l],n,r,!0);x.isEmptyObject(u)&&(delete m.handle,q.remove(e,"events"))}},trigger:function(t,n,r,i){var s,a,u,l,c,p,f,h=[r||o],d=y.call(t,"type")?t.type:t,g=y.call(t,"namespace")?t.namespace.split("."):[];if(a=u=r=r||o,3!==r.nodeType&&8!==r.nodeType&&!_.test(d+x.event.triggered)&&(d.indexOf(".")>=0&&(g=d.split("."),d=g.shift(),g.sort()),c=0>d.indexOf(":")&&"on"+d,t=t[x.expando]?t:new x.Event(d,"object"==typeof t&&t),t.isTrigger=i?2:3,t.namespace=g.join("."),t.namespace_re=t.namespace?RegExp("(^|\\.)"+g.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,t.result=undefined,t.target||(t.target=r),n=null==n?[t]:x.makeArray(n,[t]),f=x.event.special[d]||{},i||!f.trigger||f.trigger.apply(r,n)!==!1)){if(!i&&!f.noBubble&&!x.isWindow(r)){for(l=f.delegateType||d,_.test(l+d)||(a=a.parentNode);a;a=a.parentNode)h.push(a),u=a;u===(r.ownerDocument||o)&&h.push(u.defaultView||u.parentWindow||e)}s=0;while((a=h[s++])&&!t.isPropagationStopped())t.type=s>1?l:f.bindType||d,p=(q.get(a,"events")||{})[t.type]&&q.get(a,"handle"),p&&p.apply(a,n),p=c&&a[c],p&&x.acceptData(a)&&p.apply&&p.apply(a,n)===!1&&t.preventDefault();return t.type=d,i||t.isDefaultPrevented()||f._default&&f._default.apply(h.pop(),n)!==!1||!x.acceptData(r)||c&&x.isFunction(r[d])&&!x.isWindow(r)&&(u=r[c],u&&(r[c]=null),x.event.triggered=d,r[d](),x.event.triggered=undefined,u&&(r[c]=u)),t.result}},dispatch:function(e){e=x.event.fix(e);var t,n,r,i,o,s=[],a=d.call(arguments),u=(q.get(this,"events")||{})[e.type]||[],l=x.event.special[e.type]||{};if(a[0]=e,e.delegateTarget=this,!l.preDispatch||l.preDispatch.call(this,e)!==!1){s=x.event.handlers.call(this,e,u),t=0;while((i=s[t++])&&!e.isPropagationStopped()){e.currentTarget=i.elem,n=0;while((o=i.handlers[n++])&&!e.isImmediatePropagationStopped())(!e.namespace_re||e.namespace_re.test(o.namespace))&&(e.handleObj=o,e.data=o.data,r=((x.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,a),r!==undefined&&(e.result=r)===!1&&(e.preventDefault(),e.stopPropagation()))}return l.postDispatch&&l.postDispatch.call(this,e),e.result}},handlers:function(e,t){var n,r,i,o,s=[],a=t.delegateCount,u=e.target;if(a&&u.nodeType&&(!e.button||"click"!==e.type))for(;u!==this;u=u.parentNode||this)if(u.disabled!==!0||"click"!==e.type){for(r=[],n=0;a>n;n++)o=t[n],i=o.selector+" ",r[i]===undefined&&(r[i]=o.needsContext?x(i,this).index(u)>=0:x.find(i,this,null,[u]).length),r[i]&&r.push(o);r.length&&s.push({elem:u,handlers:r})}return t.length>a&&s.push({elem:this,handlers:t.slice(a)}),s},props:"altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(e,t){return null==e.which&&(e.which=null!=t.charCode?t.charCode:t.keyCode),e}},mouseHooks:{props:"button buttons clientX clientY offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(e,t){var n,r,i,s=t.button;return null==e.pageX&&null!=t.clientX&&(n=e.target.ownerDocument||o,r=n.documentElement,i=n.body,e.pageX=t.clientX+(r&&r.scrollLeft||i&&i.scrollLeft||0)-(r&&r.clientLeft||i&&i.clientLeft||0),e.pageY=t.clientY+(r&&r.scrollTop||i&&i.scrollTop||0)-(r&&r.clientTop||i&&i.clientTop||0)),e.which||s===undefined||(e.which=1&s?1:2&s?3:4&s?2:0),e}},fix:function(e){if(e[x.expando])return e;var t,n,r,i=e.type,s=e,a=this.fixHooks[i];a||(this.fixHooks[i]=a=z.test(i)?this.mouseHooks:I.test(i)?this.keyHooks:{}),r=a.props?this.props.concat(a.props):this.props,e=new x.Event(s),t=r.length;while(t--)n=r[t],e[n]=s[n];return e.target||(e.target=o),3===e.target.nodeType&&(e.target=e.target.parentNode),a.filter?a.filter(e,s):e},special:{load:{noBubble:!0},focus:{trigger:function(){return this!==V()&&this.focus?(this.focus(),!1):undefined},delegateType:"focusin"},blur:{trigger:function(){return this===V()&&this.blur?(this.blur(),!1):undefined},delegateType:"focusout"},click:{trigger:function(){return"checkbox"===this.type&&this.click&&x.nodeName(this,"input")?(this.click(),!1):undefined},_default:function(e){return x.nodeName(e.target,"a")}},beforeunload:{postDispatch:function(e){e.result!==undefined&&(e.originalEvent.returnValue=e.result)}}},simulate:function(e,t,n,r){var i=x.extend(new x.Event,n,{type:e,isSimulated:!0,originalEvent:{}});r?x.event.trigger(i,null,t):x.event.dispatch.call(t,i),i.isDefaultPrevented()&&n.preventDefault()}},x.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n,!1)},x.Event=function(e,t){return this instanceof x.Event?(e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||e.getPreventDefault&&e.getPreventDefault()?U:Y):this.type=e,t&&x.extend(this,t),this.timeStamp=e&&e.timeStamp||x.now(),this[x.expando]=!0,undefined):new x.Event(e,t)},x.Event.prototype={isDefaultPrevented:Y,isPropagationStopped:Y,isImmediatePropagationStopped:Y,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=U,e&&e.preventDefault&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=U,e&&e.stopPropagation&&e.stopPropagation()},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=U,this.stopPropagation()}},x.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(e,t){x.event.special[e]={delegateType:t,bindType:t,handle:function(e){var n,r=this,i=e.relatedTarget,o=e.handleObj;return(!i||i!==r&&!x.contains(r,i))&&(e.type=o.origType,n=o.handler.apply(this,arguments),e.type=t),n}}}),x.support.focusinBubbles||x.each({focus:"focusin",blur:"focusout"},function(e,t){var n=0,r=function(e){x.event.simulate(t,e.target,x.event.fix(e),!0)};x.event.special[t]={setup:function(){0===n++&&o.addEventListener(e,r,!0)},teardown:function(){0===--n&&o.removeEventListener(e,r,!0)}}}),x.fn.extend({on:function(e,t,n,r,i){var o,s;if("object"==typeof e){"string"!=typeof t&&(n=n||t,t=undefined);for(s in e)this.on(s,t,n,e[s],i);return this}if(null==n&&null==r?(r=t,n=t=undefined):null==r&&("string"==typeof t?(r=n,n=undefined):(r=n,n=t,t=undefined)),r===!1)r=Y;else if(!r)return this;return 1===i&&(o=r,r=function(e){return x().off(e),o.apply(this,arguments)},r.guid=o.guid||(o.guid=x.guid++)),this.each(function(){x.event.add(this,e,r,n,t)})},one:function(e,t,n,r){return this.on(e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,x(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return(t===!1||"function"==typeof t)&&(n=t,t=undefined),n===!1&&(n=Y),this.each(function(){x.event.remove(this,e,n,t)})},trigger:function(e,t){return this.each(function(){x.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];return n?x.event.trigger(e,t,n,!0):undefined}});var G=/^.[^:#\[\.,]*$/,J=/^(?:parents|prev(?:Until|All))/,Q=x.expr.match.needsContext,K={children:!0,contents:!0,next:!0,prev:!0};x.fn.extend({find:function(e){var t,n=[],r=this,i=r.length;if("string"!=typeof e)return this.pushStack(x(e).filter(function(){for(t=0;i>t;t++)if(x.contains(r[t],this))return!0}));for(t=0;i>t;t++)x.find(e,r[t],n);return n=this.pushStack(i>1?x.unique(n):n),n.selector=this.selector?this.selector+" "+e:e,n},has:function(e){var t=x(e,this),n=t.length;return this.filter(function(){var e=0;for(;n>e;e++)if(x.contains(this,t[e]))return!0})},not:function(e){return this.pushStack(et(this,e||[],!0))},filter:function(e){return this.pushStack(et(this,e||[],!1))},is:function(e){return!!et(this,"string"==typeof e&&Q.test(e)?x(e):e||[],!1).length},closest:function(e,t){var n,r=0,i=this.length,o=[],s=Q.test(e)||"string"!=typeof e?x(e,t||this.context):0;for(;i>r;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(11>n.nodeType&&(s?s.index(n)>-1:1===n.nodeType&&x.find.matchesSelector(n,e))){n=o.push(n);break}return this.pushStack(o.length>1?x.unique(o):o)},index:function(e){return e?"string"==typeof e?g.call(x(e),this[0]):g.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){var n="string"==typeof e?x(e,t):x.makeArray(e&&e.nodeType?[e]:e),r=x.merge(this.get(),n);return this.pushStack(x.unique(r))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}});function Z(e,t){while((e=e[t])&&1!==e.nodeType);return e}x.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return x.dir(e,"parentNode")},parentsUntil:function(e,t,n){return x.dir(e,"parentNode",n)},next:function(e){return Z(e,"nextSibling")},prev:function(e){return Z(e,"previousSibling")},nextAll:function(e){return x.dir(e,"nextSibling")},prevAll:function(e){return x.dir(e,"previousSibling")},nextUntil:function(e,t,n){return x.dir(e,"nextSibling",n)},prevUntil:function(e,t,n){return x.dir(e,"previousSibling",n)},siblings:function(e){return x.sibling((e.parentNode||{}).firstChild,e)},children:function(e){return x.sibling(e.firstChild)},contents:function(e){return e.contentDocument||x.merge([],e.childNodes)}},function(e,t){x.fn[e]=function(n,r){var i=x.map(this,t,n);return"Until"!==e.slice(-5)&&(r=n),r&&"string"==typeof r&&(i=x.filter(r,i)),this.length>1&&(K[e]||x.unique(i),J.test(e)&&i.reverse()),this.pushStack(i)}}),x.extend({filter:function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?x.find.matchesSelector(r,e)?[r]:[]:x.find.matches(e,x.grep(t,function(e){return 1===e.nodeType}))},dir:function(e,t,n){var r=[],i=n!==undefined;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&x(e).is(n))break;r.push(e)}return r},sibling:function(e,t){var n=[];for(;e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n}});function et(e,t,n){if(x.isFunction(t))return x.grep(e,function(e,r){return!!t.call(e,r,e)!==n});if(t.nodeType)return x.grep(e,function(e){return e===t!==n});if("string"==typeof t){if(G.test(t))return x.filter(t,e,n);t=x.filter(t,e)}return x.grep(e,function(e){return g.call(t,e)>=0!==n})}var tt=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,nt=/<([\w:]+)/,rt=/<|&#?\w+;/,it=/<(?:script|style|link)/i,ot=/^(?:checkbox|radio)$/i,st=/checked\s*(?:[^=]|=\s*.checked.)/i,at=/^$|\/(?:java|ecma)script/i,ut=/^true\/(.*)/,lt=/^\s*\s*$/g,ct={option:[1,""],thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};ct.optgroup=ct.option,ct.tbody=ct.tfoot=ct.colgroup=ct.caption=ct.thead,ct.th=ct.td,x.fn.extend({text:function(e){return x.access(this,function(e){return e===undefined?x.text(this):this.empty().append((this[0]&&this[0].ownerDocument||o).createTextNode(e))},null,e,arguments.length)},append:function(){return this.domManip(arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=pt(this,e);t.appendChild(e)}})},prepend:function(){return this.domManip(arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=pt(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return this.domManip(arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return this.domManip(arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},remove:function(e,t){var n,r=e?x.filter(e,this):this,i=0;for(;null!=(n=r[i]);i++)t||1!==n.nodeType||x.cleanData(mt(n)),n.parentNode&&(t&&x.contains(n.ownerDocument,n)&&dt(mt(n,"script")),n.parentNode.removeChild(n));return this},empty:function(){var e,t=0;for(;null!=(e=this[t]);t++)1===e.nodeType&&(x.cleanData(mt(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null==e?!1:e,t=null==t?e:t,this.map(function(){return x.clone(this,e,t)})},html:function(e){return x.access(this,function(e){var t=this[0]||{},n=0,r=this.length;if(e===undefined&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!it.test(e)&&!ct[(nt.exec(e)||["",""])[1].toLowerCase()]){e=e.replace(tt,"<$1>");try{for(;r>n;n++)t=this[n]||{},1===t.nodeType&&(x.cleanData(mt(t,!1)),t.innerHTML=e);t=0}catch(i){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var e=x.map(this,function(e){return[e.nextSibling,e.parentNode]}),t=0;return this.domManip(arguments,function(n){var r=e[t++],i=e[t++];i&&(r&&r.parentNode!==i&&(r=this.nextSibling),x(this).remove(),i.insertBefore(n,r))},!0),t?this:this.remove()},detach:function(e){return this.remove(e,!0)},domManip:function(e,t,n){e=f.apply([],e);var r,i,o,s,a,u,l=0,c=this.length,p=this,h=c-1,d=e[0],g=x.isFunction(d);if(g||!(1>=c||"string"!=typeof d||x.support.checkClone)&&st.test(d))return this.each(function(r){var i=p.eq(r);g&&(e[0]=d.call(this,r,i.html())),i.domManip(e,t,n)});if(c&&(r=x.buildFragment(e,this[0].ownerDocument,!1,!n&&this),i=r.firstChild,1===r.childNodes.length&&(r=i),i)){for(o=x.map(mt(r,"script"),ft),s=o.length;c>l;l++)a=r,l!==h&&(a=x.clone(a,!0,!0),s&&x.merge(o,mt(a,"script"))),t.call(this[l],a,l);if(s)for(u=o[o.length-1].ownerDocument,x.map(o,ht),l=0;s>l;l++)a=o[l],at.test(a.type||"")&&!q.access(a,"globalEval")&&x.contains(u,a)&&(a.src?x._evalUrl(a.src):x.globalEval(a.textContent.replace(lt,"")))}return this}}),x.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,t){x.fn[e]=function(e){var n,r=[],i=x(e),o=i.length-1,s=0;for(;o>=s;s++)n=s===o?this:this.clone(!0),x(i[s])[t](n),h.apply(r,n.get());return this.pushStack(r)}}),x.extend({clone:function(e,t,n){var r,i,o,s,a=e.cloneNode(!0),u=x.contains(e.ownerDocument,e);if(!(x.support.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||x.isXMLDoc(e)))for(s=mt(a),o=mt(e),r=0,i=o.length;i>r;r++)yt(o[r],s[r]);if(t)if(n)for(o=o||mt(e),s=s||mt(a),r=0,i=o.length;i>r;r++)gt(o[r],s[r]);else gt(e,a);return s=mt(a,"script"),s.length>0&&dt(s,!u&&mt(e,"script")),a},buildFragment:function(e,t,n,r){var i,o,s,a,u,l,c=0,p=e.length,f=t.createDocumentFragment(),h=[];for(;p>c;c++)if(i=e[c],i||0===i)if("object"===x.type(i))x.merge(h,i.nodeType?[i]:i);else if(rt.test(i)){o=o||f.appendChild(t.createElement("div")),s=(nt.exec(i)||["",""])[1].toLowerCase(),a=ct[s]||ct._default,o.innerHTML=a[1]+i.replace(tt,"<$1>")+a[2],l=a[0];while(l--)o=o.lastChild;x.merge(h,o.childNodes),o=f.firstChild,o.textContent=""}else h.push(t.createTextNode(i));f.textContent="",c=0;while(i=h[c++])if((!r||-1===x.inArray(i,r))&&(u=x.contains(i.ownerDocument,i),o=mt(f.appendChild(i),"script"),u&&dt(o),n)){l=0;while(i=o[l++])at.test(i.type||"")&&n.push(i)}return f},cleanData:function(e){var t,n,r,i,o,s,a=x.event.special,u=0;for(;(n=e[u])!==undefined;u++){if(F.accepts(n)&&(o=n[q.expando],o&&(t=q.cache[o]))){if(r=Object.keys(t.events||{}),r.length)for(s=0;(i=r[s])!==undefined;s++)a[i]?x.event.remove(n,i):x.removeEvent(n,i,t.handle);q.cache[o]&&delete q.cache[o]}delete L.cache[n[L.expando]]}},_evalUrl:function(e){return x.ajax({url:e,type:"GET",dataType:"script",async:!1,global:!1,"throws":!0})}});function pt(e,t){return x.nodeName(e,"table")&&x.nodeName(1===t.nodeType?t:t.firstChild,"tr")?e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody")):e}function ft(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function ht(e){var t=ut.exec(e.type);return t?e.type=t[1]:e.removeAttribute("type"),e}function dt(e,t){var n=e.length,r=0;for(;n>r;r++)q.set(e[r],"globalEval",!t||q.get(t[r],"globalEval"))}function gt(e,t){var n,r,i,o,s,a,u,l;if(1===t.nodeType){if(q.hasData(e)&&(o=q.access(e),s=q.set(t,o),l=o.events)){delete s.handle,s.events={};for(i in l)for(n=0,r=l[i].length;r>n;n++)x.event.add(t,i,l[i][n])}L.hasData(e)&&(a=L.access(e),u=x.extend({},a),L.set(t,u))}}function mt(e,t){var n=e.getElementsByTagName?e.getElementsByTagName(t||"*"):e.querySelectorAll?e.querySelectorAll(t||"*"):[];return t===undefined||t&&x.nodeName(e,t)?x.merge([e],n):n}function yt(e,t){var n=t.nodeName.toLowerCase();"input"===n&&ot.test(e.type)?t.checked=e.checked:("input"===n||"textarea"===n)&&(t.defaultValue=e.defaultValue)}x.fn.extend({wrapAll:function(e){var t;return x.isFunction(e)?this.each(function(t){x(this).wrapAll(e.call(this,t))}):(this[0]&&(t=x(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this)},wrapInner:function(e){return x.isFunction(e)?this.each(function(t){x(this).wrapInner(e.call(this,t))}):this.each(function(){var t=x(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=x.isFunction(e);return this.each(function(n){x(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(){return this.parent().each(function(){x.nodeName(this,"body")||x(this).replaceWith(this.childNodes)}).end()}});var vt,xt,bt=/^(none|table(?!-c[ea]).+)/,wt=/^margin/,Tt=RegExp("^("+b+")(.*)$","i"),Ct=RegExp("^("+b+")(?!px)[a-z%]+$","i"),kt=RegExp("^([+-])=("+b+")","i"),Nt={BODY:"block"},Et={position:"absolute",visibility:"hidden",display:"block"},St={letterSpacing:0,fontWeight:400},jt=["Top","Right","Bottom","Left"],Dt=["Webkit","O","Moz","ms"];function At(e,t){if(t in e)return t;var n=t.charAt(0).toUpperCase()+t.slice(1),r=t,i=Dt.length;while(i--)if(t=Dt[i]+n,t in e)return t;return r}function Lt(e,t){return e=t||e,"none"===x.css(e,"display")||!x.contains(e.ownerDocument,e)}function qt(t){return e.getComputedStyle(t,null)}function Ht(e,t){var n,r,i,o=[],s=0,a=e.length;for(;a>s;s++)r=e[s],r.style&&(o[s]=q.get(r,"olddisplay"),n=r.style.display,t?(o[s]||"none"!==n||(r.style.display=""),""===r.style.display&&Lt(r)&&(o[s]=q.access(r,"olddisplay",Rt(r.nodeName)))):o[s]||(i=Lt(r),(n&&"none"!==n||!i)&&q.set(r,"olddisplay",i?n:x.css(r,"display"))));for(s=0;a>s;s++)r=e[s],r.style&&(t&&"none"!==r.style.display&&""!==r.style.display||(r.style.display=t?o[s]||"":"none"));return e}x.fn.extend({css:function(e,t){return x.access(this,function(e,t,n){var r,i,o={},s=0;if(x.isArray(t)){for(r=qt(e),i=t.length;i>s;s++)o[t[s]]=x.css(e,t[s],!1,r);return o}return n!==undefined?x.style(e,t,n):x.css(e,t)},e,t,arguments.length>1)},show:function(){return Ht(this,!0)},hide:function(){return Ht(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){Lt(this)?x(this).show():x(this).hide()})}}),x.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=vt(e,"opacity");return""===n?"1":n}}}},cssNumber:{columnCount:!0,fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":"cssFloat"},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,s,a=x.camelCase(t),u=e.style;return t=x.cssProps[a]||(x.cssProps[a]=At(u,a)),s=x.cssHooks[t]||x.cssHooks[a],n===undefined?s&&"get"in s&&(i=s.get(e,!1,r))!==undefined?i:u[t]:(o=typeof n,"string"===o&&(i=kt.exec(n))&&(n=(i[1]+1)*i[2]+parseFloat(x.css(e,t)),o="number"),null==n||"number"===o&&isNaN(n)||("number"!==o||x.cssNumber[a]||(n+="px"),x.support.clearCloneStyle||""!==n||0!==t.indexOf("background")||(u[t]="inherit"),s&&"set"in s&&(n=s.set(e,n,r))===undefined||(u[t]=n)),undefined)}},css:function(e,t,n,r){var i,o,s,a=x.camelCase(t);return t=x.cssProps[a]||(x.cssProps[a]=At(e.style,a)),s=x.cssHooks[t]||x.cssHooks[a],s&&"get"in s&&(i=s.get(e,!0,n)),i===undefined&&(i=vt(e,t,r)),"normal"===i&&t in St&&(i=St[t]),""===n||n?(o=parseFloat(i),n===!0||x.isNumeric(o)?o||0:i):i}}),vt=function(e,t,n){var r,i,o,s=n||qt(e),a=s?s.getPropertyValue(t)||s[t]:undefined,u=e.style;return s&&(""!==a||x.contains(e.ownerDocument,e)||(a=x.style(e,t)),Ct.test(a)&&wt.test(t)&&(r=u.width,i=u.minWidth,o=u.maxWidth,u.minWidth=u.maxWidth=u.width=a,a=s.width,u.width=r,u.minWidth=i,u.maxWidth=o)),a};function Ot(e,t,n){var r=Tt.exec(t);return r?Math.max(0,r[1]-(n||0))+(r[2]||"px"):t}function Ft(e,t,n,r,i){var o=n===(r?"border":"content")?4:"width"===t?1:0,s=0;for(;4>o;o+=2)"margin"===n&&(s+=x.css(e,n+jt[o],!0,i)),r?("content"===n&&(s-=x.css(e,"padding"+jt[o],!0,i)),"margin"!==n&&(s-=x.css(e,"border"+jt[o]+"Width",!0,i))):(s+=x.css(e,"padding"+jt[o],!0,i),"padding"!==n&&(s+=x.css(e,"border"+jt[o]+"Width",!0,i)));return s}function Pt(e,t,n){var r=!0,i="width"===t?e.offsetWidth:e.offsetHeight,o=qt(e),s=x.support.boxSizing&&"border-box"===x.css(e,"boxSizing",!1,o);if(0>=i||null==i){if(i=vt(e,t,o),(0>i||null==i)&&(i=e.style[t]),Ct.test(i))return i;r=s&&(x.support.boxSizingReliable||i===e.style[t]),i=parseFloat(i)||0}return i+Ft(e,t,n||(s?"border":"content"),r,o)+"px"}function Rt(e){var t=o,n=Nt[e];return n||(n=Mt(e,t),"none"!==n&&n||(xt=(xt||x("